Compare commits
1 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 64629eaf15 |
@@ -1,72 +0,0 @@
|
||||
---
|
||||
name: pull-requests
|
||||
description: "Guide for creating, updating, and following up on pull requests in the Coder repository. Use when asked to open a PR, update a PR, rewrite a PR description, or follow up on CI/check failures."
|
||||
---
|
||||
|
||||
# Pull Request Skill
|
||||
|
||||
## When to Use This Skill
|
||||
|
||||
Use this skill when asked to:
|
||||
|
||||
- Create a pull request for the current branch.
|
||||
- Update an existing PR branch or description.
|
||||
- Rewrite a PR body.
|
||||
- Follow up on CI or check failures for an existing PR.
|
||||
|
||||
## References
|
||||
|
||||
Use the canonical docs for shared conventions and validation guidance:
|
||||
|
||||
- PR title and description conventions:
|
||||
`.claude/docs/PR_STYLE_GUIDE.md`
|
||||
- Local validation commands and git hooks: `AGENTS.md` (Essential Commands and
|
||||
Git Hooks sections)
|
||||
|
||||
## Lifecycle Rules
|
||||
|
||||
1. **Check for an existing PR** before creating a new one:
|
||||
|
||||
```bash
|
||||
gh pr list --head "$(git branch --show-current)" --author @me --json number --jq '.[0].number // empty'
|
||||
```
|
||||
|
||||
If that returns a number, update that PR. If it returns empty output,
|
||||
create a new one.
|
||||
2. **Check you are not on main.** If the current branch is `main` or `master`,
|
||||
create a feature branch before doing PR work.
|
||||
3. **Default to draft.** Use `gh pr create --draft` unless the user explicitly
|
||||
asks for ready-for-review.
|
||||
4. **Keep description aligned with the full diff.** Re-read the diff against
|
||||
the base branch before writing or updating the title and body. Describe the
|
||||
entire PR diff, not just the last commit.
|
||||
5. **Never auto-merge.** Do not merge or mark ready for review unless the user
|
||||
explicitly asks.
|
||||
6. **Never push to main or master.**
|
||||
|
||||
## CI / Checks Follow-up
|
||||
|
||||
**Always watch CI checks after pushing.** Do not push and walk away.
|
||||
|
||||
After pushing:
|
||||
|
||||
- Monitor CI with `gh pr checks <PR_NUMBER> --watch`.
|
||||
- Use `gh pr view <PR_NUMBER> --json statusCheckRollup` for programmatic check
|
||||
status.
|
||||
|
||||
If checks fail:
|
||||
|
||||
1. Find the failed run ID from the `gh pr checks` output.
|
||||
2. Read the logs with `gh run view <run-id> --log-failed`.
|
||||
3. Fix the problem locally.
|
||||
4. Run `make pre-commit`.
|
||||
5. Push the fix.
|
||||
|
||||
## What Not to Do
|
||||
|
||||
- Do not reference or call helper scripts that do not exist in this
|
||||
repository.
|
||||
- Do not auto-merge or mark ready for review without explicit user request.
|
||||
- Do not push to `origin/main` or `origin/master`.
|
||||
- Do not skip local validation before pushing.
|
||||
- Do not fabricate or embellish PR descriptions.
|
||||
@@ -113,7 +113,7 @@ Coder emphasizes clear error handling, with specific patterns required:
|
||||
|
||||
All tests should run in parallel using `t.Parallel()` to ensure efficient testing and expose potential race conditions. The codebase is rigorously linted with golangci-lint to maintain consistent code quality.
|
||||
|
||||
Git contributions follow [Conventional Commits](https://www.conventionalcommits.org/en/v1.0.0/). See [CONTRIBUTING.md](docs/about/contributing/CONTRIBUTING.md#commit-messages) for full rules. PR titles are linted in CI.
|
||||
Git contributions follow a standard format with commit messages structured as `type: <message>`, where type is one of `feat`, `fix`, or `chore`.
|
||||
|
||||
## Development Workflow
|
||||
|
||||
|
||||
@@ -4,13 +4,22 @@ This guide documents the PR description style used in the Coder repository, base
|
||||
|
||||
## PR Title Format
|
||||
|
||||
Format: `type(scope): description`. See [CONTRIBUTING.md](docs/about/contributing/CONTRIBUTING.md#commit-messages) for full rules. PR titles are linted in CI.
|
||||
Follow [Conventional Commits 1.0.0](https://www.conventionalcommits.org/en/v1.0.0/) format:
|
||||
|
||||
- Types: `feat`, `fix`, `docs`, `style`, `refactor`, `perf`, `test`, `build`, `ci`, `chore`, `revert`
|
||||
- Scopes must be a real path (directory or file stem) containing all changed files
|
||||
- Omit scope if changes span multiple top-level directories
|
||||
```text
|
||||
type(scope): brief description
|
||||
```
|
||||
|
||||
Examples:
|
||||
**Common types:**
|
||||
|
||||
- `feat`: New features
|
||||
- `fix`: Bug fixes
|
||||
- `refactor`: Code refactoring without behavior change
|
||||
- `perf`: Performance improvements
|
||||
- `docs`: Documentation changes
|
||||
- `chore`: Dependency updates, tooling changes
|
||||
|
||||
**Examples:**
|
||||
|
||||
- `feat: add tracing to aibridge`
|
||||
- `fix: move contexts to appropriate locations`
|
||||
@@ -177,6 +186,16 @@ Dependabot PRs are auto-generated - don't try to match their verbose style for m
|
||||
Changes from https://github.com/upstream/repo/pull/XXX/
|
||||
```
|
||||
|
||||
## Attribution Footer
|
||||
|
||||
For AI-generated PRs, end with:
|
||||
|
||||
```markdown
|
||||
🤖 Generated with [Claude Code](https://claude.com/claude-code)
|
||||
|
||||
Co-Authored-By: Claude Sonnet 4.5 <noreply@anthropic.com>
|
||||
```
|
||||
|
||||
## Creating PRs as Draft
|
||||
|
||||
**IMPORTANT**: Unless explicitly told otherwise, always create PRs as drafts using the `--draft` flag:
|
||||
@@ -187,12 +206,11 @@ gh pr create --draft --title "..." --body "..."
|
||||
|
||||
After creating the PR, encourage the user to review it before marking as ready:
|
||||
|
||||
```text
|
||||
```
|
||||
I've created draft PR #XXXX. Please review the changes and mark it as ready for review when you're satisfied.
|
||||
```
|
||||
|
||||
This allows the user to:
|
||||
|
||||
- Review the code changes before requesting reviews from maintainers
|
||||
- Make additional adjustments if needed
|
||||
- Ensure CI passes before notifying reviewers
|
||||
|
||||
@@ -136,11 +136,9 @@ Then make your changes and push normally. Don't use `git push --force` unless th
|
||||
|
||||
## Commit Style
|
||||
|
||||
Format: `type(scope): message`. See [CONTRIBUTING.md](docs/about/contributing/CONTRIBUTING.md#commit-messages) for full rules. PR titles are linted in CI.
|
||||
|
||||
- Types: `feat`, `fix`, `docs`, `style`, `refactor`, `perf`, `test`, `build`, `ci`, `chore`, `revert`
|
||||
- Scopes must be a real path (directory or file stem) containing all changed files
|
||||
- Omit scope if changes span multiple top-level directories
|
||||
- Follow [Conventional Commits 1.0.0](https://www.conventionalcommits.org/en/v1.0.0/)
|
||||
- Format: `type(scope): message`
|
||||
- Types: `feat`, `fix`, `docs`, `style`, `refactor`, `test`, `chore`
|
||||
- Keep message titles concise (~70 characters)
|
||||
- Use imperative, present tense in commit titles
|
||||
|
||||
|
||||
@@ -1,9 +0,0 @@
|
||||
paths:
|
||||
# The triage workflow uses a quoted heredoc (<<'EOF') with ${VAR}
|
||||
# placeholders that envsubst expands later. Shellcheck's SC2016
|
||||
# warns about unexpanded variables in single-quoted strings, but
|
||||
# the non-expansion is intentional here. Actionlint doesn't honor
|
||||
# inline shellcheck disable directives inside heredocs.
|
||||
.github/workflows/triage-via-chat-api.yaml:
|
||||
ignore:
|
||||
- 'SC2016'
|
||||
@@ -64,7 +64,6 @@ runs:
|
||||
TEST_PACKAGES: ${{ inputs.test-packages }}
|
||||
RACE_DETECTION: ${{ inputs.race-detection }}
|
||||
TS_DEBUG_DISCO: "true"
|
||||
TS_DEBUG_DERP: "true"
|
||||
LC_CTYPE: "en_US.UTF-8"
|
||||
LC_ALL: "en_US.UTF-8"
|
||||
run: |
|
||||
|
||||
+35
-97
@@ -35,7 +35,7 @@ jobs:
|
||||
tailnet-integration: ${{ steps.filter.outputs.tailnet-integration }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -45,7 +45,7 @@ jobs:
|
||||
fetch-depth: 1
|
||||
persist-credentials: false
|
||||
- name: check changed files
|
||||
uses: dorny/paths-filter@fbd0ab8f3e69293af611ebaee6363fc25e6d187d # v4.0.1
|
||||
uses: dorny/paths-filter@de90cc6fb38fc0963ad72b210f1f284cd68cea36 # v3.0.2
|
||||
id: filter
|
||||
with:
|
||||
filters: |
|
||||
@@ -157,7 +157,7 @@ jobs:
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-8' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -191,7 +191,7 @@ jobs:
|
||||
|
||||
# Check for any typos
|
||||
- name: Check for typos
|
||||
uses: crate-ci/typos@631208b7aac2daa8b707f55e7331f9112b0e062d # v1.44.0
|
||||
uses: crate-ci/typos@2d0ce569feab1f8752f1dde43cc2f2aa53236e06 # v1.40.0
|
||||
with:
|
||||
config: .github/workflows/typos.toml
|
||||
|
||||
@@ -247,7 +247,7 @@ jobs:
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-8' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -272,7 +272,7 @@ jobs:
|
||||
if: ${{ !cancelled() }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -327,7 +327,7 @@ jobs:
|
||||
timeout-minutes: 20
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -379,7 +379,7 @@ jobs:
|
||||
- windows-2022
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -537,7 +537,7 @@ jobs:
|
||||
embedded-pg-cache: ${{ steps.embedded-pg-cache.outputs.embedded-pg-cache }}
|
||||
|
||||
- name: Upload failed test db dumps
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: failed-test-db-dump-${{matrix.os}}
|
||||
path: "**/*.test.sql"
|
||||
@@ -575,7 +575,7 @@ jobs:
|
||||
timeout-minutes: 25
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -637,7 +637,7 @@ jobs:
|
||||
timeout-minutes: 25
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -709,7 +709,7 @@ jobs:
|
||||
timeout-minutes: 20
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -736,7 +736,7 @@ jobs:
|
||||
timeout-minutes: 20
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -769,7 +769,7 @@ jobs:
|
||||
name: ${{ matrix.variant.name }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -818,7 +818,7 @@ jobs:
|
||||
|
||||
- name: Upload Playwright Failed Tests
|
||||
if: always() && github.actor != 'dependabot[bot]' && runner.os == 'Linux' && !github.event.pull_request.head.repo.fork
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: failed-test-videos${{ matrix.variant.premium && '-premium' || '' }}
|
||||
path: ./site/test-results/**/*.webm
|
||||
@@ -826,7 +826,7 @@ jobs:
|
||||
|
||||
- name: Upload debug log
|
||||
if: always() && github.actor != 'dependabot[bot]' && runner.os == 'Linux' && !github.event.pull_request.head.repo.fork
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: coderd-debug-logs${{ matrix.variant.premium && '-premium' || '' }}
|
||||
path: ./site/e2e/test-results/debug.log
|
||||
@@ -834,7 +834,7 @@ jobs:
|
||||
|
||||
- name: Upload pprof dumps
|
||||
if: always() && github.actor != 'dependabot[bot]' && runner.os == 'Linux' && !github.event.pull_request.head.repo.fork
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: debug-pprof-dumps${{ matrix.variant.premium && '-premium' || '' }}
|
||||
path: ./site/test-results/**/debug-pprof-*.txt
|
||||
@@ -849,7 +849,7 @@ jobs:
|
||||
if: needs.changes.outputs.site == 'true' || needs.changes.outputs.ci == 'true'
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -930,7 +930,7 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -1005,7 +1005,7 @@ jobs:
|
||||
if: always()
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -1043,7 +1043,7 @@ jobs:
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-8' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -1097,7 +1097,7 @@ jobs:
|
||||
IMAGE: ghcr.io/coder/coder-preview:${{ steps.build-docker.outputs.tag }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -1108,7 +1108,7 @@ jobs:
|
||||
persist-credentials: false
|
||||
|
||||
- name: GHCR Login
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
registry: ghcr.io
|
||||
username: ${{ github.actor }}
|
||||
@@ -1198,7 +1198,7 @@ jobs:
|
||||
make -j \
|
||||
build/coder_linux_{amd64,arm64,armv7} \
|
||||
build/coder_"$version"_windows_amd64.zip \
|
||||
build/coder_"$version"_linux_{amd64,arm64,armv7}.{tar.gz,deb}
|
||||
build/coder_"$version"_linux_amd64.{tar.gz,deb}
|
||||
env:
|
||||
# The Windows and Darwin slim binaries must be signed for Coder
|
||||
# Desktop to accept them.
|
||||
@@ -1216,28 +1216,11 @@ jobs:
|
||||
GCLOUD_ACCESS_TOKEN: ${{ steps.gcloud_auth.outputs.access_token }}
|
||||
JSIGN_PATH: /tmp/jsign-6.0.jar
|
||||
|
||||
# Free up disk space before building Docker images. The preceding
|
||||
# Build step produces ~2 GB of binaries and packages, the Go build
|
||||
# cache is ~1.3 GB, and node_modules is ~500 MB. Docker image
|
||||
# builds, pushes, and SBOM generation need headroom that isn't
|
||||
# available without reclaiming some of that space.
|
||||
- name: Clean up build cache
|
||||
run: |
|
||||
set -euxo pipefail
|
||||
# Go caches are no longer needed — binaries are already compiled.
|
||||
go clean -cache -modcache
|
||||
# Remove .apk and .rpm packages that are not uploaded as
|
||||
# artifacts and were only built as make prerequisites.
|
||||
rm -f ./build/*.apk ./build/*.rpm
|
||||
|
||||
- name: Build Linux Docker images
|
||||
id: build-docker
|
||||
env:
|
||||
CODER_IMAGE_BASE: ghcr.io/coder/coder-preview
|
||||
DOCKER_CLI_EXPERIMENTAL: "enabled"
|
||||
# Skip building .deb/.rpm/.apk/.tar.gz as prerequisites for
|
||||
# the Docker image targets — they were already built above.
|
||||
DOCKER_IMAGE_NO_PREREQUISITES: "true"
|
||||
run: |
|
||||
set -euxo pipefail
|
||||
|
||||
@@ -1319,7 +1302,7 @@ jobs:
|
||||
id: attest_main
|
||||
if: github.ref == 'refs/heads/main'
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: "ghcr.io/coder/coder-preview:main"
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -1356,7 +1339,7 @@ jobs:
|
||||
id: attest_latest
|
||||
if: github.ref == 'refs/heads/main'
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: "ghcr.io/coder/coder-preview:latest"
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -1393,7 +1376,7 @@ jobs:
|
||||
id: attest_version
|
||||
if: github.ref == 'refs/heads/main'
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: "ghcr.io/coder/coder-preview:${{ steps.build-docker.outputs.tag }}"
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -1455,60 +1438,15 @@ jobs:
|
||||
^v
|
||||
prune-untagged: true
|
||||
|
||||
- name: Upload build artifact (coder-linux-amd64.tar.gz)
|
||||
- name: Upload build artifacts
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: coder-linux-amd64.tar.gz
|
||||
path: ./build/*_linux_amd64.tar.gz
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-linux-amd64.deb)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-linux-amd64.deb
|
||||
path: ./build/*_linux_amd64.deb
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-linux-arm64.tar.gz)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-linux-arm64.tar.gz
|
||||
path: ./build/*_linux_arm64.tar.gz
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-linux-arm64.deb)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-linux-arm64.deb
|
||||
path: ./build/*_linux_arm64.deb
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-linux-armv7.tar.gz)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-linux-armv7.tar.gz
|
||||
path: ./build/*_linux_armv7.tar.gz
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-linux-armv7.deb)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-linux-armv7.deb
|
||||
path: ./build/*_linux_armv7.deb
|
||||
retention-days: 7
|
||||
|
||||
- name: Upload build artifact (coder-windows-amd64.zip)
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
with:
|
||||
name: coder-windows-amd64.zip
|
||||
path: ./build/*_windows_amd64.zip
|
||||
name: coder
|
||||
path: |
|
||||
./build/*.zip
|
||||
./build/*.tar.gz
|
||||
./build/*.deb
|
||||
retention-days: 7
|
||||
|
||||
# Deploy is handled in deploy.yaml so we can apply concurrency limits.
|
||||
@@ -1543,7 +1481,7 @@ jobs:
|
||||
if: needs.changes.outputs.db == 'true' || needs.changes.outputs.ci == 'true' || github.ref == 'refs/heads/main'
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -23,44 +23,6 @@ permissions:
|
||||
concurrency: pr-${{ github.ref }}
|
||||
|
||||
jobs:
|
||||
community-label:
|
||||
runs-on: ubuntu-latest
|
||||
permissions:
|
||||
pull-requests: write
|
||||
if: >-
|
||||
${{
|
||||
github.event_name == 'pull_request_target' &&
|
||||
github.event.action == 'opened' &&
|
||||
github.event.pull_request.author_association != 'MEMBER' &&
|
||||
github.event.pull_request.author_association != 'COLLABORATOR' &&
|
||||
github.event.pull_request.author_association != 'OWNER'
|
||||
}}
|
||||
steps:
|
||||
- name: Add community label
|
||||
uses: actions/github-script@ed597411d8f924073f98dfc5c65a23a2325f34cd # v8.0.0
|
||||
with:
|
||||
script: |
|
||||
const params = {
|
||||
issue_number: context.issue.number,
|
||||
owner: context.repo.owner,
|
||||
repo: context.repo.repo,
|
||||
}
|
||||
|
||||
const labels = context.payload.pull_request.labels.map((label) => label.name)
|
||||
if (labels.includes("community")) {
|
||||
console.log('PR already has "community" label.')
|
||||
return
|
||||
}
|
||||
|
||||
console.log(
|
||||
'Adding "community" label for author association "%s".',
|
||||
context.payload.pull_request.author_association,
|
||||
)
|
||||
await github.rest.issues.addLabels({
|
||||
...params,
|
||||
labels: ["community"],
|
||||
})
|
||||
|
||||
cla:
|
||||
runs-on: ubuntu-latest
|
||||
permissions:
|
||||
@@ -83,109 +45,6 @@ jobs:
|
||||
# Some users have signed a corporate CLA with Coder so are exempt from signing our community one.
|
||||
allowlist: "coryb,aaronlehmann,dependabot*,blink-so*,blinkagent*"
|
||||
|
||||
title:
|
||||
runs-on: ubuntu-latest
|
||||
if: ${{ github.event_name == 'pull_request_target' }}
|
||||
steps:
|
||||
- name: Validate PR title
|
||||
uses: actions/github-script@ed597411d8f924073f98dfc5c65a23a2325f34cd # v8.0.0
|
||||
with:
|
||||
script: |
|
||||
const { pull_request } = context.payload;
|
||||
const title = pull_request.title;
|
||||
const repo = { owner: context.repo.owner, repo: context.repo.repo };
|
||||
|
||||
const allowedTypes = [
|
||||
"feat", "fix", "docs", "style", "refactor",
|
||||
"perf", "test", "build", "ci", "chore", "revert",
|
||||
];
|
||||
const expectedFormat = `"type(scope): description" or "type: description"`;
|
||||
const guidelinesLink = `See: https://github.com/coder/coder/blob/main/docs/about/contributing/CONTRIBUTING.md#commit-messages`;
|
||||
const scopeHint = (type) =>
|
||||
`Use a broader scope or no scope (e.g., "${type}: ...") for cross-cutting changes.\n` +
|
||||
guidelinesLink;
|
||||
|
||||
console.log("Title: %s", title);
|
||||
|
||||
// Parse conventional commit format: type(scope)!: description
|
||||
const match = title.match(/^(\w+)(\(([^)]*)\))?(!)?\s*:\s*.+/);
|
||||
if (!match) {
|
||||
core.setFailed(
|
||||
`PR title does not match conventional commit format.\n` +
|
||||
`Expected: ${expectedFormat}\n` +
|
||||
`Allowed types: ${allowedTypes.join(", ")}\n` +
|
||||
guidelinesLink
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
const type = match[1];
|
||||
const scope = match[3]; // undefined if no parentheses
|
||||
|
||||
// Validate type.
|
||||
if (!allowedTypes.includes(type)) {
|
||||
core.setFailed(
|
||||
`PR title has invalid type "${type}".\n` +
|
||||
`Expected: ${expectedFormat}\n` +
|
||||
`Allowed types: ${allowedTypes.join(", ")}\n` +
|
||||
guidelinesLink
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
// If no scope, we're done.
|
||||
if (!scope) {
|
||||
console.log("No scope provided, title is valid.");
|
||||
return;
|
||||
}
|
||||
|
||||
console.log("Scope: %s", scope);
|
||||
|
||||
// Fetch changed files.
|
||||
const files = await github.paginate(github.rest.pulls.listFiles, {
|
||||
...repo,
|
||||
pull_number: pull_request.number,
|
||||
per_page: 100,
|
||||
});
|
||||
const changedPaths = files.map(f => f.filename);
|
||||
console.log("Changed files: %d", changedPaths.length);
|
||||
|
||||
// Derive scope type from the changed files. The diff is the
|
||||
// source of truth: if files exist under the scope, the path
|
||||
// exists on the PR branch. No need for Contents API calls.
|
||||
const isDir = changedPaths.some(f => f.startsWith(scope + "/"));
|
||||
const isFile = changedPaths.some(f => f === scope);
|
||||
const isStem = changedPaths.some(f => f.startsWith(scope + "."));
|
||||
|
||||
if (!isDir && !isFile && !isStem) {
|
||||
core.setFailed(
|
||||
`PR title scope "${scope}" does not match any files changed in this PR.\n` +
|
||||
`Scopes must reference a path (directory or file stem) that contains changed files.\n` +
|
||||
scopeHint(type)
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
// Verify all changed files fall under the scope.
|
||||
const outsideFiles = changedPaths.filter(f => {
|
||||
if (isDir && f.startsWith(scope + "/")) return false;
|
||||
if (f === scope) return false;
|
||||
if (isStem && f.startsWith(scope + ".")) return false;
|
||||
return true;
|
||||
});
|
||||
|
||||
if (outsideFiles.length > 0) {
|
||||
const listed = outsideFiles.map(f => " - " + f).join("\n");
|
||||
core.setFailed(
|
||||
`PR title scope "${scope}" does not contain all changed files.\n` +
|
||||
`Files outside scope:\n${listed}\n\n` +
|
||||
scopeHint(type)
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
console.log("PR title is valid.");
|
||||
|
||||
release-labels:
|
||||
runs-on: ubuntu-latest
|
||||
permissions:
|
||||
|
||||
@@ -36,7 +36,7 @@ jobs:
|
||||
verdict: ${{ steps.check.outputs.verdict }} # DEPLOY or NOOP
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -61,11 +61,11 @@ jobs:
|
||||
if: needs.should-deploy.outputs.verdict == 'DEPLOY'
|
||||
permissions:
|
||||
contents: read
|
||||
id-token: write # to authenticate to EKS cluster
|
||||
id-token: write
|
||||
packages: write # to retag image as dogfood
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -76,29 +76,33 @@ jobs:
|
||||
persist-credentials: false
|
||||
|
||||
- name: GHCR Login
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
registry: ghcr.io
|
||||
username: ${{ github.actor }}
|
||||
password: ${{ secrets.GITHUB_TOKEN }}
|
||||
|
||||
- name: Configure AWS Credentials
|
||||
uses: aws-actions/configure-aws-credentials@8df5847569e6427dd6c4fb1cf565c83acfa8afa7 # v6.0.0
|
||||
- name: Authenticate to Google Cloud
|
||||
uses: google-github-actions/auth@7c6bc770dae815cd3e89ee6cdf493a5fab2cc093 # v3.0.0
|
||||
with:
|
||||
role-to-assume: ${{ vars.AWS_DOGFOOD_DEPLOY_ROLE }}
|
||||
aws-region: ${{ vars.AWS_DOGFOOD_DEPLOY_REGION }}
|
||||
workload_identity_provider: ${{ vars.GCP_WORKLOAD_ID_PROVIDER }}
|
||||
service_account: ${{ vars.GCP_SERVICE_ACCOUNT }}
|
||||
|
||||
- name: Get Cluster Credentials
|
||||
run: aws eks update-kubeconfig --name "$AWS_DOGFOOD_CLUSTER_NAME" --region "$AWS_DOGFOOD_DEPLOY_REGION"
|
||||
env:
|
||||
AWS_DOGFOOD_CLUSTER_NAME: ${{ vars.AWS_DOGFOOD_CLUSTER_NAME }}
|
||||
AWS_DOGFOOD_DEPLOY_REGION: ${{ vars.AWS_DOGFOOD_DEPLOY_REGION }}
|
||||
- name: Set up Google Cloud SDK
|
||||
uses: google-github-actions/setup-gcloud@aa5489c8933f4cc7a4f7d45035b3b1440c9c10db # v3.0.1
|
||||
|
||||
- name: Set up Flux CLI
|
||||
uses: fluxcd/flux2/action@8454b02a32e48d775b9f563cb51fdcb1787b5b93 # v2.7.5
|
||||
with:
|
||||
# Keep this and the github action up to date with the version of flux installed in dogfood cluster
|
||||
version: "2.8.2"
|
||||
version: "2.7.0"
|
||||
|
||||
- name: Get Cluster Credentials
|
||||
uses: google-github-actions/get-gke-credentials@3da1e46a907576cefaa90c484278bb5b259dd395 # v3.0.0
|
||||
with:
|
||||
cluster_name: dogfood-v2
|
||||
location: us-central1-a
|
||||
project_id: coder-dogfood-v2
|
||||
|
||||
# Retag image as dogfood while maintaining the multi-arch manifest
|
||||
- name: Tag image as dogfood
|
||||
@@ -142,7 +146,7 @@ jobs:
|
||||
needs: deploy
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -38,7 +38,7 @@ jobs:
|
||||
if: github.repository_owner == 'coder'
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -48,7 +48,7 @@ jobs:
|
||||
persist-credentials: false
|
||||
|
||||
- name: Docker login
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
registry: ghcr.io
|
||||
username: ${{ github.actor }}
|
||||
|
||||
@@ -30,7 +30,7 @@ jobs:
|
||||
- name: Setup Node
|
||||
uses: ./.github/actions/setup-node
|
||||
|
||||
- uses: tj-actions/changed-files@22103cc46bda19c2b464ffe86db46df6922fd323 # v45.0.7
|
||||
- uses: tj-actions/changed-files@e0021407031f5be11a464abee9a0776171c79891 # v45.0.7
|
||||
id: changed-files
|
||||
with:
|
||||
files: |
|
||||
|
||||
@@ -26,7 +26,7 @@ jobs:
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-4' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -78,11 +78,11 @@ jobs:
|
||||
uses: depot/setup-action@15c09a5f77a0840ad4bce955686522a257853461 # v1.7.1
|
||||
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@4d04d5d9486b7bd6fa91e7baf45bbb4f8b9deedd # v4.0.0
|
||||
uses: docker/setup-buildx-action@8d2750c68a42422c14e847fe6c8ac0403b4cbd6f # v3.12.0
|
||||
|
||||
- name: Login to DockerHub
|
||||
if: github.ref == 'refs/heads/main'
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
username: ${{ secrets.DOCKERHUB_USERNAME }}
|
||||
password: ${{ secrets.DOCKERHUB_PASSWORD }}
|
||||
@@ -125,7 +125,7 @@ jobs:
|
||||
id-token: write
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -30,7 +30,7 @@ jobs:
|
||||
|
||||
- name: Sync issues
|
||||
id: sync
|
||||
uses: linear/linear-release-action@5cbaabc187ceb63eee9d446e62e68e5c29a03ae8 # v0.5.0
|
||||
uses: linear/linear-release-action@f64cdc603e6eb7a7ef934bc5492ae929f88c8d1a # v0
|
||||
with:
|
||||
access_key: ${{ secrets.LINEAR_ACCESS_KEY }}
|
||||
command: sync
|
||||
@@ -52,7 +52,7 @@ jobs:
|
||||
|
||||
- name: Complete release
|
||||
id: complete
|
||||
uses: linear/linear-release-action@5cbaabc187ceb63eee9d446e62e68e5c29a03ae8 # v0
|
||||
uses: linear/linear-release-action@f64cdc603e6eb7a7ef934bc5492ae929f88c8d1a # v0
|
||||
with:
|
||||
access_key: ${{ secrets.LINEAR_ACCESS_KEY }}
|
||||
command: complete
|
||||
|
||||
@@ -28,7 +28,7 @@ jobs:
|
||||
- windows-2022
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -15,7 +15,7 @@ jobs:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -19,7 +19,7 @@ jobs:
|
||||
packages: write
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -39,7 +39,7 @@ jobs:
|
||||
PR_OPEN: ${{ steps.check_pr.outputs.pr_open }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -76,7 +76,7 @@ jobs:
|
||||
runs-on: "ubuntu-latest"
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -135,7 +135,7 @@ jobs:
|
||||
PR_NUMBER: ${{ steps.pr_info.outputs.PR_NUMBER }}
|
||||
|
||||
- name: Check changed files
|
||||
uses: dorny/paths-filter@fbd0ab8f3e69293af611ebaee6363fc25e6d187d # v4.0.1
|
||||
uses: dorny/paths-filter@de90cc6fb38fc0963ad72b210f1f284cd68cea36 # v3.0.2
|
||||
id: filter
|
||||
with:
|
||||
base: ${{ github.ref }}
|
||||
@@ -184,7 +184,7 @@ jobs:
|
||||
pull-requests: write # needed for commenting on PRs
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -228,7 +228,7 @@ jobs:
|
||||
CODER_IMAGE_TAG: ${{ needs.get_info.outputs.CODER_IMAGE_TAG }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -248,7 +248,7 @@ jobs:
|
||||
uses: ./.github/actions/setup-sqlc
|
||||
|
||||
- name: GHCR Login
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
registry: ghcr.io
|
||||
username: ${{ github.actor }}
|
||||
@@ -288,7 +288,7 @@ jobs:
|
||||
PR_HOSTNAME: "pr${{ needs.get_info.outputs.PR_NUMBER }}.${{ secrets.PR_DEPLOYMENTS_DOMAIN }}"
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -14,12 +14,12 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
- name: Run Schmoder CI
|
||||
uses: benc-uk/workflow-dispatch@7a027648b88c2413826b6ddd6c76114894dc5ec4 # v1.3.1
|
||||
uses: benc-uk/workflow-dispatch@e2e5e9a103e331dad343f381a29e654aea3cf8fc # v1.2.4
|
||||
with:
|
||||
workflow: ci.yaml
|
||||
repo: coder/schmoder
|
||||
|
||||
@@ -80,7 +80,7 @@ jobs:
|
||||
version: ${{ steps.version.outputs.version }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -155,7 +155,7 @@ jobs:
|
||||
cat "$CODER_RELEASE_NOTES_FILE"
|
||||
|
||||
- name: Docker Login
|
||||
uses: docker/login-action@b45d80f862d83dbcd57f89517bcf500b2ab88fb2 # v4.0.0
|
||||
uses: docker/login-action@c94ce9fb468520275223c153574b00df6fe4bcc9 # v3.7.0
|
||||
with:
|
||||
registry: ghcr.io
|
||||
username: ${{ github.actor }}
|
||||
@@ -358,7 +358,7 @@ jobs:
|
||||
id: attest_base
|
||||
if: ${{ !inputs.dry_run && steps.image-base-tag.outputs.tag != '' }}
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: ${{ steps.image-base-tag.outputs.tag }}
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -474,7 +474,7 @@ jobs:
|
||||
id: attest_main
|
||||
if: ${{ !inputs.dry_run }}
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: ${{ steps.build_docker.outputs.multiarch_image }}
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -518,7 +518,7 @@ jobs:
|
||||
id: attest_latest
|
||||
if: ${{ !inputs.dry_run && steps.build_docker.outputs.created_latest_tag == 'true' }}
|
||||
continue-on-error: true
|
||||
uses: actions/attest@59d89421af93a897026c735860bf21b6eb4f7b26 # v4.1.0
|
||||
uses: actions/attest@e59cbc1ad1ac2d59339667419eb8cdde6eb61e3d # v3.2.0
|
||||
with:
|
||||
subject-name: ${{ steps.latest_tag.outputs.tag }}
|
||||
predicate-type: "https://slsa.dev/provenance/v1"
|
||||
@@ -665,7 +665,7 @@ jobs:
|
||||
|
||||
- name: Upload artifacts to actions (if dry-run)
|
||||
if: ${{ inputs.dry_run }}
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: release-artifacts
|
||||
path: |
|
||||
@@ -681,7 +681,7 @@ jobs:
|
||||
|
||||
- name: Upload latest sbom artifact to actions (if dry-run)
|
||||
if: inputs.dry_run && steps.build_docker.outputs.created_latest_tag == 'true'
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: latest-sbom-artifact
|
||||
path: ./coder_latest_sbom.spdx.json
|
||||
@@ -700,11 +700,13 @@ jobs:
|
||||
name: Publish to Homebrew tap
|
||||
runs-on: ubuntu-latest
|
||||
needs: release
|
||||
if: ${{ !inputs.dry_run && inputs.release_channel == 'mainline' }}
|
||||
if: ${{ !inputs.dry_run }}
|
||||
|
||||
steps:
|
||||
# TODO: skip this if it's not a new release (i.e. a backport). This is
|
||||
# fine right now because it just makes a PR that we can close.
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -780,7 +782,7 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -20,7 +20,7 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -39,7 +39,7 @@ jobs:
|
||||
|
||||
# Upload the results as artifacts.
|
||||
- name: "Upload artifact"
|
||||
uses: actions/upload-artifact@bbbca2ddaa5d8feaa63e36b76fdaad77386f024f # v7.0.0
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: SARIF file
|
||||
path: results.sarif
|
||||
|
||||
@@ -27,7 +27,7 @@ jobs:
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-8' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -63,3 +63,116 @@ jobs:
|
||||
--data "{\"content\": \"$msg\"}" \
|
||||
"${{ secrets.SLACK_SECURITY_FAILURE_WEBHOOK_URL }}"
|
||||
|
||||
trivy:
|
||||
permissions:
|
||||
security-events: write
|
||||
runs-on: ${{ github.repository_owner == 'coder' && 'depot-ubuntu-22.04-8' || 'ubuntu-latest' }}
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
- name: Checkout
|
||||
uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd # v6.0.2
|
||||
with:
|
||||
fetch-depth: 0
|
||||
persist-credentials: false
|
||||
|
||||
- name: Setup Go
|
||||
uses: ./.github/actions/setup-go
|
||||
|
||||
- name: Setup Node
|
||||
uses: ./.github/actions/setup-node
|
||||
|
||||
- name: Setup sqlc
|
||||
uses: ./.github/actions/setup-sqlc
|
||||
|
||||
- name: Install cosign
|
||||
uses: ./.github/actions/install-cosign
|
||||
|
||||
- name: Install syft
|
||||
uses: ./.github/actions/install-syft
|
||||
|
||||
- name: Install yq
|
||||
run: go run github.com/mikefarah/yq/v4@v4.44.3
|
||||
- name: Install mockgen
|
||||
run: ./.github/scripts/retry.sh -- go install go.uber.org/mock/mockgen@v0.6.0
|
||||
- name: Install protoc-gen-go
|
||||
run: ./.github/scripts/retry.sh -- go install google.golang.org/protobuf/cmd/protoc-gen-go@v1.30
|
||||
- name: Install protoc-gen-go-drpc
|
||||
run: ./.github/scripts/retry.sh -- go install storj.io/drpc/cmd/protoc-gen-go-drpc@v0.0.34
|
||||
- name: Install Protoc
|
||||
run: |
|
||||
# protoc must be in lockstep with our dogfood Dockerfile or the
|
||||
# version in the comments will differ. This is also defined in
|
||||
# ci.yaml.
|
||||
set -euxo pipefail
|
||||
cd dogfood/coder
|
||||
mkdir -p /usr/local/bin
|
||||
mkdir -p /usr/local/include
|
||||
|
||||
DOCKER_BUILDKIT=1 docker build . --target proto -t protoc
|
||||
protoc_path=/usr/local/bin/protoc
|
||||
docker run --rm --entrypoint cat protoc /tmp/bin/protoc > $protoc_path
|
||||
chmod +x $protoc_path
|
||||
protoc --version
|
||||
# Copy the generated files to the include directory.
|
||||
docker run --rm -v /usr/local/include:/target protoc cp -r /tmp/include/google /target/
|
||||
ls -la /usr/local/include/google/protobuf/
|
||||
stat /usr/local/include/google/protobuf/timestamp.proto
|
||||
|
||||
- name: Build Coder linux amd64 Docker image
|
||||
id: build
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
version="$(./scripts/version.sh)"
|
||||
image_job="build/coder_${version}_linux_amd64.tag"
|
||||
|
||||
# This environment variable force make to not build packages and
|
||||
# archives (which the Docker image depends on due to technical reasons
|
||||
# related to concurrent FS writes).
|
||||
export DOCKER_IMAGE_NO_PREREQUISITES=true
|
||||
# This environment variables forces scripts/build_docker.sh to build
|
||||
# the base image tag locally instead of using the cached version from
|
||||
# the registry.
|
||||
CODER_IMAGE_BUILD_BASE_TAG="$(CODER_IMAGE_BASE=coder-base ./scripts/image_tag.sh --version "$version")"
|
||||
export CODER_IMAGE_BUILD_BASE_TAG
|
||||
|
||||
# We would like to use make -j here, but it doesn't work with the some recent additions
|
||||
# to our code generation.
|
||||
make "$image_job"
|
||||
echo "image=$(cat "$image_job")" >> "$GITHUB_OUTPUT"
|
||||
|
||||
- name: Run Trivy vulnerability scanner
|
||||
uses: aquasecurity/trivy-action@c1824fd6edce30d7ab345a9989de00bbd46ef284 # v0.34.0
|
||||
with:
|
||||
image-ref: ${{ steps.build.outputs.image }}
|
||||
format: sarif
|
||||
output: trivy-results.sarif
|
||||
severity: "CRITICAL,HIGH"
|
||||
|
||||
- name: Upload Trivy scan results to GitHub Security tab
|
||||
uses: github/codeql-action/upload-sarif@5d4e8d1aca955e8d8589aabd499c5cae939e33c7 # v3.29.5
|
||||
with:
|
||||
sarif_file: trivy-results.sarif
|
||||
category: "Trivy"
|
||||
|
||||
- name: Upload Trivy scan results as an artifact
|
||||
uses: actions/upload-artifact@b7c566a772e6b6bfb58ed0dc250532a479d7789f # v6.0.0
|
||||
with:
|
||||
name: trivy
|
||||
path: trivy-results.sarif
|
||||
retention-days: 7
|
||||
|
||||
- name: Send Slack notification on failure
|
||||
if: ${{ failure() }}
|
||||
run: |
|
||||
msg="❌ Trivy Failed\n\nhttps://github.com/${{ github.repository }}/actions/runs/${{ github.run_id }}"
|
||||
curl \
|
||||
-qfsSL \
|
||||
-X POST \
|
||||
-H "Content-Type: application/json" \
|
||||
--data "{\"content\": \"$msg\"}" \
|
||||
"${{ secrets.SLACK_SECURITY_FAILURE_WEBHOOK_URL }}"
|
||||
|
||||
@@ -18,7 +18,7 @@ jobs:
|
||||
pull-requests: write
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -96,7 +96,7 @@ jobs:
|
||||
contents: write
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -120,7 +120,7 @@ jobs:
|
||||
actions: write
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
|
||||
@@ -1,295 +0,0 @@
|
||||
# This workflow reimplements the AI Triage Automation using the Coder Chat API
|
||||
# instead of the Tasks API. The Chat API (/api/experimental/chats) is a simpler
|
||||
# interface that does not require a dedicated GitHub Action or workspace
|
||||
# provisioning — we just create a chat, poll for completion, and link the
|
||||
# result on the issue. All API calls use curl + jq directly.
|
||||
#
|
||||
# Key differences from the Tasks API workflow (traiage.yaml):
|
||||
# - No checkout of coder/create-task-action; everything is inline curl/jq.
|
||||
# - No template_name / template_preset / prefix inputs — the Chat API handles
|
||||
# resource allocation internally.
|
||||
# - Uses POST /api/experimental/chats to create a chat session.
|
||||
# - Polls GET /api/experimental/chats/<id> until the agent finishes.
|
||||
# - Chat URL format: ${CODER_URL}/agents?chat=${CHAT_ID}
|
||||
|
||||
name: AI Triage via Chat API
|
||||
|
||||
on:
|
||||
issues:
|
||||
types:
|
||||
- labeled
|
||||
workflow_dispatch:
|
||||
inputs:
|
||||
issue_url:
|
||||
description: "GitHub Issue URL to process"
|
||||
required: true
|
||||
type: string
|
||||
|
||||
permissions:
|
||||
contents: read
|
||||
|
||||
jobs:
|
||||
triage-chat:
|
||||
name: Triage GitHub Issue via Chat API
|
||||
runs-on: ubuntu-latest
|
||||
if: github.event.label.name == 'chat-triage' || github.event_name == 'workflow_dispatch'
|
||||
timeout-minutes: 30
|
||||
env:
|
||||
CODER_URL: ${{ secrets.TRAIAGE_CODER_URL }}
|
||||
CODER_SESSION_TOKEN: ${{ secrets.TRAIAGE_CODER_SESSION_TOKEN }}
|
||||
permissions:
|
||||
contents: read
|
||||
issues: write
|
||||
|
||||
steps:
|
||||
# ------------------------------------------------------------------
|
||||
# Step 1: Determine the GitHub user and issue URL.
|
||||
# Identical to the Tasks API workflow — resolve the actor for
|
||||
# workflow_dispatch or the issue sender for label events.
|
||||
# ------------------------------------------------------------------
|
||||
- name: Determine Inputs
|
||||
id: determine-inputs
|
||||
if: always()
|
||||
env:
|
||||
GITHUB_ACTOR: ${{ github.actor }}
|
||||
GITHUB_EVENT_ISSUE_HTML_URL: ${{ github.event.issue.html_url }}
|
||||
GITHUB_EVENT_NAME: ${{ github.event_name }}
|
||||
GITHUB_EVENT_USER_ID: ${{ github.event.sender.id }}
|
||||
GITHUB_EVENT_USER_LOGIN: ${{ github.event.sender.login }}
|
||||
INPUTS_ISSUE_URL: ${{ inputs.issue_url }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
# For workflow_dispatch, use the actor who triggered it.
|
||||
# For issues events, use the issue sender.
|
||||
if [[ "${GITHUB_EVENT_NAME}" == "workflow_dispatch" ]]; then
|
||||
if ! GITHUB_USER_ID=$(gh api "users/${GITHUB_ACTOR}" --jq '.id'); then
|
||||
echo "::error::Failed to get GitHub user ID for actor ${GITHUB_ACTOR}"
|
||||
exit 1
|
||||
fi
|
||||
echo "Using workflow_dispatch actor: ${GITHUB_ACTOR} (ID: ${GITHUB_USER_ID})"
|
||||
echo "github_user_id=${GITHUB_USER_ID}" >> "${GITHUB_OUTPUT}"
|
||||
echo "github_username=${GITHUB_ACTOR}" >> "${GITHUB_OUTPUT}"
|
||||
|
||||
echo "Using issue URL: ${INPUTS_ISSUE_URL}"
|
||||
echo "issue_url=${INPUTS_ISSUE_URL}" >> "${GITHUB_OUTPUT}"
|
||||
|
||||
exit 0
|
||||
elif [[ "${GITHUB_EVENT_NAME}" == "issues" ]]; then
|
||||
GITHUB_USER_ID=${GITHUB_EVENT_USER_ID}
|
||||
echo "Using issue author: ${GITHUB_EVENT_USER_LOGIN} (ID: ${GITHUB_USER_ID})"
|
||||
echo "github_user_id=${GITHUB_USER_ID}" >> "${GITHUB_OUTPUT}"
|
||||
echo "github_username=${GITHUB_EVENT_USER_LOGIN}" >> "${GITHUB_OUTPUT}"
|
||||
|
||||
echo "Using issue URL: ${GITHUB_EVENT_ISSUE_HTML_URL}"
|
||||
echo "issue_url=${GITHUB_EVENT_ISSUE_HTML_URL}" >> "${GITHUB_OUTPUT}"
|
||||
|
||||
exit 0
|
||||
else
|
||||
echo "::error::Unsupported event type: ${GITHUB_EVENT_NAME}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# ------------------------------------------------------------------
|
||||
# Step 2: Verify the triggering user has push access.
|
||||
# Unchanged from the Tasks API workflow.
|
||||
# ------------------------------------------------------------------
|
||||
- name: Verify push access
|
||||
env:
|
||||
GITHUB_REPOSITORY: ${{ github.repository }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
GITHUB_USERNAME: ${{ steps.determine-inputs.outputs.github_username }}
|
||||
GITHUB_USER_ID: ${{ steps.determine-inputs.outputs.github_user_id }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
can_push="$(gh api "/repos/${GITHUB_REPOSITORY}/collaborators/${GITHUB_USERNAME}/permission" --jq '.user.permissions.push')"
|
||||
if [[ "${can_push}" != "true" ]]; then
|
||||
echo "::error title=Access Denied::${GITHUB_USERNAME} does not have push access to ${GITHUB_REPOSITORY}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# ------------------------------------------------------------------
|
||||
# Step 3: Create a chat via the Coder Chat API.
|
||||
# Unlike the Tasks API which provisions a full workspace, the Chat
|
||||
# API creates a lightweight chat session. We POST to
|
||||
# /api/experimental/chats with the triage prompt as the initial
|
||||
# message and receive a chat ID back.
|
||||
# ------------------------------------------------------------------
|
||||
- name: Create chat via Coder Chat API
|
||||
id: create-chat
|
||||
env:
|
||||
ISSUE_URL: ${{ steps.determine-inputs.outputs.issue_url }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
# Build the same triage prompt used by the Tasks API workflow.
|
||||
TASK_PROMPT=$(cat <<'EOF'
|
||||
Fix ${ISSUE_URL}
|
||||
|
||||
1. Use the gh CLI to read the issue description and comments.
|
||||
2. Think carefully and try to understand the root cause. If the issue is unclear or not well defined, ask me to clarify and provide more information.
|
||||
3. Write a proposed implementation plan to PLAN.md for me to review before starting implementation. Your plan should use TDD and only make the minimal changes necessary to fix the root cause.
|
||||
4. When I approve your plan, start working on it. If you encounter issues with the plan, ask me for clarification and update the plan as required.
|
||||
5. When you have finished implementation according to the plan, commit and push your changes, and create a PR using the gh CLI for me to review.
|
||||
EOF
|
||||
)
|
||||
# Perform variable substitution on the prompt — scoped to $ISSUE_URL only.
|
||||
# Using envsubst without arguments would expand every env var in scope
|
||||
# (including CODER_SESSION_TOKEN), so we name the variable explicitly.
|
||||
TASK_PROMPT=$(echo "${TASK_PROMPT}" | envsubst '$ISSUE_URL')
|
||||
|
||||
echo "Creating chat with prompt:"
|
||||
echo "${TASK_PROMPT}"
|
||||
|
||||
# POST to the Chat API to create a new chat session.
|
||||
RESPONSE=$(curl --silent --fail-with-body \
|
||||
-X POST \
|
||||
-H "Coder-Session-Token: ${CODER_SESSION_TOKEN}" \
|
||||
-H "Content-Type: application/json" \
|
||||
-d "$(jq -n --arg prompt "${TASK_PROMPT}" \
|
||||
'{content: [{type: "text", text: $prompt}]}')" \
|
||||
"${CODER_URL}/api/experimental/chats")
|
||||
|
||||
echo "Chat API response:"
|
||||
echo "${RESPONSE}" | jq .
|
||||
|
||||
CHAT_ID=$(echo "${RESPONSE}" | jq -r '.id')
|
||||
CHAT_STATUS=$(echo "${RESPONSE}" | jq -r '.status')
|
||||
|
||||
if [[ -z "${CHAT_ID}" || "${CHAT_ID}" == "null" ]]; then
|
||||
echo "::error::Failed to create chat — no ID returned"
|
||||
echo "Response: ${RESPONSE}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Validate that CHAT_ID is a UUID before using it in URL paths.
|
||||
# This guards against unexpected API responses being interpolated
|
||||
# into subsequent curl calls.
|
||||
if [[ ! "${CHAT_ID}" =~ ^[0-9a-f]{8}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{12}$ ]]; then
|
||||
echo "::error::CHAT_ID is not a valid UUID: ${CHAT_ID}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
CHAT_URL="${CODER_URL}/agents?chat=${CHAT_ID}"
|
||||
|
||||
echo "Chat created: ${CHAT_ID} (status: ${CHAT_STATUS})"
|
||||
echo "Chat URL: ${CHAT_URL}"
|
||||
|
||||
echo "chat_id=${CHAT_ID}" >> "${GITHUB_OUTPUT}"
|
||||
echo "chat_url=${CHAT_URL}" >> "${GITHUB_OUTPUT}"
|
||||
|
||||
# ------------------------------------------------------------------
|
||||
# Step 4: Poll the chat status until the agent finishes.
|
||||
# The Chat API is asynchronous — after creation the agent begins
|
||||
# working in the background. We poll GET /api/experimental/chats/<id>
|
||||
# every 5 seconds until the status is "waiting" (agent needs input),
|
||||
# "completed" (agent finished), or "error". Timeout after 10 minutes.
|
||||
# ------------------------------------------------------------------
|
||||
- name: Poll chat status
|
||||
id: poll-status
|
||||
env:
|
||||
CHAT_ID: ${{ steps.create-chat.outputs.chat_id }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
POLL_INTERVAL=5
|
||||
# 10 minutes = 600 seconds.
|
||||
TIMEOUT=600
|
||||
ELAPSED=0
|
||||
|
||||
echo "Polling chat ${CHAT_ID} every ${POLL_INTERVAL}s (timeout: ${TIMEOUT}s)..."
|
||||
|
||||
while true; do
|
||||
RESPONSE=$(curl --silent --fail-with-body \
|
||||
-H "Coder-Session-Token: ${CODER_SESSION_TOKEN}" \
|
||||
"${CODER_URL}/api/experimental/chats/${CHAT_ID}")
|
||||
|
||||
STATUS=$(echo "${RESPONSE}" | jq -r '.status')
|
||||
|
||||
echo "[${ELAPSED}s] Chat status: ${STATUS}"
|
||||
|
||||
case "${STATUS}" in
|
||||
waiting|completed)
|
||||
echo "Chat reached terminal status: ${STATUS}"
|
||||
echo "final_status=${STATUS}" >> "${GITHUB_OUTPUT}"
|
||||
exit 0
|
||||
;;
|
||||
error)
|
||||
echo "::error::Chat entered error state"
|
||||
echo "${RESPONSE}" | jq .
|
||||
echo "final_status=error" >> "${GITHUB_OUTPUT}"
|
||||
exit 1
|
||||
;;
|
||||
pending|running)
|
||||
# Still working — keep polling.
|
||||
;;
|
||||
*)
|
||||
echo "::warning::Unknown chat status: ${STATUS}"
|
||||
;;
|
||||
esac
|
||||
|
||||
if [[ ${ELAPSED} -ge ${TIMEOUT} ]]; then
|
||||
echo "::error::Timed out after ${TIMEOUT}s waiting for chat to finish"
|
||||
echo "final_status=timeout" >> "${GITHUB_OUTPUT}"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
sleep "${POLL_INTERVAL}"
|
||||
ELAPSED=$((ELAPSED + POLL_INTERVAL))
|
||||
done
|
||||
|
||||
# ------------------------------------------------------------------
|
||||
# Step 5: Comment on the GitHub issue with a link to the chat.
|
||||
# Only comment if the issue belongs to this repository (same guard
|
||||
# as the Tasks API workflow).
|
||||
# ------------------------------------------------------------------
|
||||
- name: Comment on issue
|
||||
if: startsWith(steps.determine-inputs.outputs.issue_url, format('{0}/{1}', github.server_url, github.repository))
|
||||
env:
|
||||
ISSUE_URL: ${{ steps.determine-inputs.outputs.issue_url }}
|
||||
CHAT_URL: ${{ steps.create-chat.outputs.chat_url }}
|
||||
CHAT_ID: ${{ steps.create-chat.outputs.chat_id }}
|
||||
FINAL_STATUS: ${{ steps.poll-status.outputs.final_status }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
COMMENT_BODY=$(cat <<EOF
|
||||
🤖 **AI Triage Chat Created**
|
||||
|
||||
A Coder chat session has been created to investigate this issue.
|
||||
|
||||
**Chat URL:** ${CHAT_URL}
|
||||
**Chat ID:** \`${CHAT_ID}\`
|
||||
**Status:** ${FINAL_STATUS}
|
||||
|
||||
The agent is working on a triage plan. Visit the chat to follow progress or provide guidance.
|
||||
EOF
|
||||
)
|
||||
|
||||
gh issue comment "${ISSUE_URL}" --body "${COMMENT_BODY}"
|
||||
echo "Comment posted on ${ISSUE_URL}"
|
||||
|
||||
# ------------------------------------------------------------------
|
||||
# Step 6: Write a summary to the GitHub Actions step summary.
|
||||
# ------------------------------------------------------------------
|
||||
- name: Write summary
|
||||
env:
|
||||
CHAT_ID: ${{ steps.create-chat.outputs.chat_id }}
|
||||
CHAT_URL: ${{ steps.create-chat.outputs.chat_url }}
|
||||
FINAL_STATUS: ${{ steps.poll-status.outputs.final_status }}
|
||||
ISSUE_URL: ${{ steps.determine-inputs.outputs.issue_url }}
|
||||
run: |
|
||||
set -euo pipefail
|
||||
|
||||
{
|
||||
echo "## AI Triage via Chat API"
|
||||
echo ""
|
||||
echo "**Issue:** ${ISSUE_URL}"
|
||||
echo "**Chat ID:** \`${CHAT_ID}\`"
|
||||
echo "**Chat URL:** ${CHAT_URL}"
|
||||
echo "**Status:** ${FINAL_STATUS}"
|
||||
} >> "${GITHUB_STEP_SUMMARY}"
|
||||
@@ -29,8 +29,6 @@ EDE = "EDE"
|
||||
HELO = "HELO"
|
||||
LKE = "LKE"
|
||||
byt = "byt"
|
||||
cpy = "cpy"
|
||||
Cpy = "Cpy"
|
||||
typ = "typ"
|
||||
# file extensions used in seti icon theme
|
||||
styl = "styl"
|
||||
|
||||
@@ -21,7 +21,7 @@ jobs:
|
||||
pull-requests: write # required to post PR review comments by the action
|
||||
steps:
|
||||
- name: Harden Runner
|
||||
uses: step-security/harden-runner@fa2e9d605c4eeb9fcad4c99c224cee0c6c7f3594 # v2.16.0
|
||||
uses: step-security/harden-runner@5ef0c079ce82195b2a36a210272d6b661572d83e # v2.14.2
|
||||
with:
|
||||
egress-policy: audit
|
||||
|
||||
@@ -30,22 +30,6 @@ jobs:
|
||||
with:
|
||||
persist-credentials: false
|
||||
|
||||
- name: Rewrite same-repo links for PR branch
|
||||
if: github.event_name == 'pull_request'
|
||||
env:
|
||||
HEAD_SHA: ${{ github.event.pull_request.head.sha }}
|
||||
run: |
|
||||
# Rewrite same-repo blob/tree main links to the PR head SHA
|
||||
# so that files or directories introduced in the PR are
|
||||
# reachable during link checking.
|
||||
{
|
||||
echo 'replacementPatterns:'
|
||||
echo " - pattern: \"https://github.com/coder/coder/blob/main/\""
|
||||
echo " replacement: \"https://github.com/coder/coder/blob/${HEAD_SHA}/\""
|
||||
echo " - pattern: \"https://github.com/coder/coder/tree/main/\""
|
||||
echo " replacement: \"https://github.com/coder/coder/tree/${HEAD_SHA}/\""
|
||||
} >> .github/.linkspector.yml
|
||||
|
||||
- name: Check Markdown links
|
||||
uses: umbrelladocs/action-linkspector@652f85bc57bb1e7d4327260decc10aa68f7694c3 # v1.4.0
|
||||
id: markdown-link-check
|
||||
|
||||
@@ -50,7 +50,7 @@ Only pause to ask for confirmation when:
|
||||
| **Format** | `make fmt` | Auto-format code |
|
||||
| **Clean** | `make clean` | Clean build artifacts |
|
||||
| **Pre-commit** | `make pre-commit` | Fast CI checks (gen/fmt/lint/build) |
|
||||
| **Pre-push** | `make pre-push` | Heavier CI checks (allowlisted) |
|
||||
| **Pre-push** | `make pre-push` | All CI checks including tests |
|
||||
|
||||
### Documentation Commands
|
||||
|
||||
@@ -100,31 +100,6 @@ app, err := api.Database.GetOAuth2ProviderAppByClientID(dbauthz.AsSystemRestrict
|
||||
app, err := api.Database.GetOAuth2ProviderAppByClientID(ctx, clientID)
|
||||
```
|
||||
|
||||
### API Design
|
||||
|
||||
- Add swagger annotations when introducing new HTTP endpoints. Do this in
|
||||
the same change as the handler so the docs do not get missed before
|
||||
release.
|
||||
- For user-scoped or resource-scoped routes, prefer path parameters over
|
||||
query parameters when that matches existing route patterns.
|
||||
- For experimental or unstable API paths, skip public doc generation with
|
||||
`// @x-apidocgen {"skip": true}` after the `@Router` annotation. This
|
||||
keeps them out of the published API reference until they stabilize.
|
||||
|
||||
### Database Query Naming
|
||||
|
||||
- Use `ByX` when `X` is the lookup or filter column.
|
||||
- Use `PerX` or `GroupedByX` when `X` is the aggregation or grouping
|
||||
dimension.
|
||||
- Avoid `ByX` names for grouped queries.
|
||||
|
||||
### Database-to-SDK Conversions
|
||||
|
||||
- Extract explicit db-to-SDK conversion helpers instead of inlining large
|
||||
conversion blocks inside handlers.
|
||||
- Keep nullable-field handling, type coercion, and response shaping in the
|
||||
converter so handlers stay focused on request flow and authorization.
|
||||
|
||||
## Quick Reference
|
||||
|
||||
### Full workflows available in imported WORKFLOWS.md
|
||||
@@ -146,20 +121,11 @@ git config core.hooksPath scripts/githooks
|
||||
|
||||
Two hooks run automatically:
|
||||
|
||||
- **pre-commit**: Classifies staged files by type and runs either
|
||||
the full `make pre-commit` or the lightweight `make pre-commit-light`
|
||||
depending on whether Go, TypeScript, SQL, proto, or Makefile
|
||||
changes are present. Falls back to the full target when
|
||||
`CODER_HOOK_RUN_ALL=1` is set. A markdown-only commit takes
|
||||
seconds; a Go change takes several minutes.
|
||||
- **pre-push**: Classifies changed files (vs remote branch or
|
||||
merge-base) and runs `make pre-push` when Go, TypeScript, SQL,
|
||||
proto, or Makefile changes are detected. Skips tests entirely
|
||||
for lightweight changes. Allowlisted in
|
||||
`scripts/githooks/pre-push`. Runs only for developers who opt
|
||||
in. Falls back to `make pre-push` when the diff range can't
|
||||
be determined or `CODER_HOOK_RUN_ALL=1` is set. Allow at least
|
||||
15 minutes for a full run.
|
||||
- **pre-commit**: `make pre-commit` (gen, fmt, lint, typos, build).
|
||||
Fast checks that catch most CI failures. Allow at least 5 minutes.
|
||||
- **pre-push**: `make pre-push` (full CI suite including tests).
|
||||
Runs before pushing to catch everything CI would. Allow at least
|
||||
15 minutes (race tests are slow without cache).
|
||||
|
||||
`git commit` and `git push` will appear to hang while hooks run.
|
||||
This is normal. Do not interrupt, retry, or reduce the timeout.
|
||||
@@ -217,26 +183,6 @@ seems like it should use `time.Sleep`, read through https://github.com/coder/qua
|
||||
|
||||
- Follow [Uber Go Style Guide](https://github.com/uber-go/guide/blob/master/style.md)
|
||||
- Commit format: `type(scope): message`
|
||||
- PR titles follow the same `type(scope): message` format.
|
||||
- When you use a scope, it must be a real filesystem path containing every
|
||||
changed file.
|
||||
- Use a broader path scope, or omit the scope, for cross-cutting changes.
|
||||
- Example: `fix(coderd/chatd): ...` for changes only in `coderd/chatd/`.
|
||||
|
||||
### Frontend Patterns
|
||||
|
||||
- Prefer existing shared UI components and utilities over custom
|
||||
implementations. Reuse common primitives such as loading, table, and error
|
||||
handling components when they fit the use case.
|
||||
- Use Storybook stories for all component and page testing, including
|
||||
visual presentation, user interactions, keyboard navigation, focus
|
||||
management, and accessibility behavior. Do not create standalone
|
||||
vitest/RTL test files for components or pages. Stories double as living
|
||||
documentation, visual regression coverage, and interaction test suites
|
||||
via `play` functions. Reserve plain vitest files for pure logic only:
|
||||
utility functions, data transformations, hooks tested via
|
||||
`renderHook()` that do not require DOM assertions, and query/cache
|
||||
operations with no rendered output.
|
||||
|
||||
### Writing Comments
|
||||
|
||||
|
||||
@@ -27,7 +27,6 @@ ifdef MAKE_TIMED
|
||||
SHELL := $(CURDIR)/scripts/lib/timed-shell.sh
|
||||
.SHELLFLAGS = $@ -ceu
|
||||
export MAKE_TIMED
|
||||
export MAKE_LOGDIR
|
||||
endif
|
||||
|
||||
# This doesn't work on directories.
|
||||
@@ -115,18 +114,15 @@ POSTGRES_VERSION ?= 17
|
||||
POSTGRES_IMAGE ?= us-docker.pkg.dev/coder-v2-images-public/public/postgres:$(POSTGRES_VERSION)
|
||||
|
||||
# Limit parallel Make jobs in pre-commit/pre-push. Defaults to
|
||||
# nproc/4 (min 2) since test, lint, and build targets have internal
|
||||
# nproc/4 (min 2) since test and lint targets have internal
|
||||
# parallelism. Override: make pre-push PARALLEL_JOBS=8
|
||||
PARALLEL_JOBS ?= $(shell n=$$(nproc 2>/dev/null || sysctl -n hw.ncpu 2>/dev/null || echo 8); echo $$(( n / 4 > 2 ? n / 4 : 2 )))
|
||||
|
||||
# Use the highest ZSTD compression level in release builds to
|
||||
# minimize artifact size. For non-release CI builds (e.g. main
|
||||
# branch preview), use multithreaded level 6 which is ~99% faster
|
||||
# at the cost of ~30% larger archives.
|
||||
ifeq ($(CODER_RELEASE),true)
|
||||
# Use the highest ZSTD compression level in CI.
|
||||
ifdef CI
|
||||
ZSTDFLAGS := -22 --ultra
|
||||
else
|
||||
ZSTDFLAGS := -6 -T0
|
||||
ZSTDFLAGS := -6
|
||||
endif
|
||||
|
||||
# Common paths to exclude from find commands, this rule is written so
|
||||
@@ -136,10 +132,18 @@ endif
|
||||
# the search path so that these exclusions match.
|
||||
FIND_EXCLUSIONS= \
|
||||
-not \( \( -path '*/.git/*' -o -path './build/*' -o -path './vendor/*' -o -path './.coderv2/*' -o -path '*/node_modules/*' -o -path '*/out/*' -o -path './coderd/apidoc/*' -o -path '*/.next/*' -o -path '*/.terraform/*' -o -path './_gen/*' \) -prune \)
|
||||
|
||||
# Source files used for make targets, evaluated on use.
|
||||
GO_SRC_FILES := $(shell find . $(FIND_EXCLUSIONS) -type f -name '*.go' -not -name '*_test.go')
|
||||
|
||||
# Same as GO_SRC_FILES but excluding certain files that have problematic
|
||||
# Makefile dependencies (e.g. pnpm).
|
||||
MOST_GO_SRC_FILES := $(shell \
|
||||
find . \
|
||||
$(FIND_EXCLUSIONS) \
|
||||
-type f \
|
||||
-name '*.go' \
|
||||
-not -name '*_test.go' \
|
||||
-not -wholename './agent/agentcontainers/dcspec/dcspec_gen.go' \
|
||||
)
|
||||
# All the shell files in the repo, excluding ignored files.
|
||||
SHELL_SRC_FILES := $(shell find . $(FIND_EXCLUSIONS) -type f -name '*.sh')
|
||||
|
||||
@@ -506,26 +510,13 @@ install: build/coder_$(VERSION)_$(GOOS)_$(GOARCH)$(GOOS_BIN_EXT)
|
||||
cp "$<" "$$output_file"
|
||||
.PHONY: install
|
||||
|
||||
# Only wildcard the go files in the develop directory to avoid rebuilds
|
||||
# when project files are changd. Technically changes to some imports may
|
||||
# not be detected, but it's unlikely to cause any issues.
|
||||
build/.bin/develop: go.mod go.sum $(wildcard scripts/develop/*.go)
|
||||
CGO_ENABLED=0 go build -o $@ ./scripts/develop
|
||||
|
||||
BOLD := $(shell tput bold 2>/dev/null)
|
||||
GREEN := $(shell tput setaf 2 2>/dev/null)
|
||||
RED := $(shell tput setaf 1 2>/dev/null)
|
||||
YELLOW := $(shell tput setaf 3 2>/dev/null)
|
||||
DIM := $(shell tput dim 2>/dev/null || tput setaf 8 2>/dev/null)
|
||||
RESET := $(shell tput sgr0 2>/dev/null)
|
||||
|
||||
fmt: fmt/ts fmt/go fmt/terraform fmt/shfmt fmt/biome fmt/markdown
|
||||
.PHONY: fmt
|
||||
|
||||
# Subset of fmt that does not require Go or Node toolchains.
|
||||
fmt-light: fmt/shfmt fmt/terraform fmt/markdown
|
||||
.PHONY: fmt-light
|
||||
|
||||
fmt/go:
|
||||
ifdef FILE
|
||||
# Format single file
|
||||
@@ -633,10 +624,6 @@ LINT_ACTIONS_TARGETS := $(if $(CI),,lint/actions/actionlint)
|
||||
lint: lint/shellcheck lint/go lint/ts lint/examples lint/helm lint/site-icons lint/markdown lint/check-scopes lint/migrations lint/bootstrap $(LINT_ACTIONS_TARGETS)
|
||||
.PHONY: lint
|
||||
|
||||
# Subset of lint that does not require Go or Node toolchains.
|
||||
lint-light: lint/shellcheck lint/markdown lint/helm lint/bootstrap lint/migrations lint/actions/actionlint lint/typos
|
||||
.PHONY: lint-light
|
||||
|
||||
lint/site-icons:
|
||||
./scripts/check_site_icons.sh
|
||||
.PHONY: lint/site-icons
|
||||
@@ -723,93 +710,89 @@ lint/typos: build/typos-$(TYPOS_VERSION)
|
||||
build/typos-$(TYPOS_VERSION) --config .github/workflows/typos.toml
|
||||
.PHONY: lint/typos
|
||||
|
||||
# pre-commit and pre-push mirror CI checks locally.
|
||||
# pre-commit and pre-push mirror CI "required" jobs locally.
|
||||
# See the "required" job's needs list in .github/workflows/ci.yaml.
|
||||
#
|
||||
# pre-commit runs checks that don't need external services (Docker,
|
||||
# Playwright). This is the git pre-commit hook default since Docker
|
||||
# and browser issues in the local environment would otherwise block
|
||||
# Playwright). This is the git pre-commit hook default since test
|
||||
# and Docker failures in the local environment would otherwise block
|
||||
# all commits.
|
||||
#
|
||||
# pre-push adds heavier checks: Go tests, JS tests, and site build.
|
||||
# The pre-push hook is allowlisted, see scripts/githooks/pre-push.
|
||||
# pre-push runs the full CI suite including tests. This is the git
|
||||
# pre-push hook default, catching everything CI would before pushing.
|
||||
#
|
||||
# pre-commit uses two phases: gen+fmt first, then lint+build. This
|
||||
# avoids races where gen's `go run` creates temporary .go files that
|
||||
# lint's find-based checks pick up. Within each phase, targets run in
|
||||
# parallel via -j. It fails if any tracked files have unstaged
|
||||
# changes afterward.
|
||||
# pre-push uses two-phase execution: gen+fmt+test-postgres-docker
|
||||
# first (writes files, starts Docker), then lint+build+test in
|
||||
# parallel. pre-commit uses two phases: gen+fmt first, then
|
||||
# lint+build. This avoids races where gen's `go run` creates
|
||||
# temporary .go files that lint's find-based checks pick up.
|
||||
# Within each phase, targets run in parallel via -j. Both fail if
|
||||
# any tracked files have unstaged changes afterward.
|
||||
#
|
||||
# Both pre-commit and pre-push:
|
||||
# gen, fmt, lint, lint/typos, slim binary (local arch)
|
||||
#
|
||||
# pre-push only (need external services or are slow):
|
||||
# site/out/index.html (pnpm build)
|
||||
# test-postgres-docker + test (needs Docker)
|
||||
# test-js, test-e2e (needs Playwright)
|
||||
# sqlc-vet (needs Docker)
|
||||
# offlinedocs/check
|
||||
#
|
||||
# Omitted:
|
||||
# test-go-pg-17 (same tests, different PG version)
|
||||
|
||||
define check-unstaged
|
||||
unstaged="$$(git diff --name-only)"
|
||||
if [[ -n $$unstaged ]]; then
|
||||
echo "$(RED)✗ check unstaged changes$(RESET)"
|
||||
echo "$$unstaged" | sed 's/^/ - /'
|
||||
echo ""
|
||||
echo "$(DIM) Verify generated changes are correct before staging:$(RESET)"
|
||||
echo "$(DIM) git diff$(RESET)"
|
||||
echo "$(DIM) git add -u && git commit$(RESET)"
|
||||
echo "ERROR: unstaged changes in tracked files:"
|
||||
echo "$$unstaged"
|
||||
echo
|
||||
echo "Review each change (git diff), verify correctness, then stage:"
|
||||
echo " git add -u && git commit"
|
||||
exit 1
|
||||
fi
|
||||
endef
|
||||
define check-untracked
|
||||
untracked=$$(git ls-files --other --exclude-standard)
|
||||
if [[ -n $$untracked ]]; then
|
||||
echo "$(YELLOW)? check untracked files$(RESET)"
|
||||
echo "$$untracked" | sed 's/^/ - /'
|
||||
echo ""
|
||||
echo "$(DIM) Review if these should be committed or added to .gitignore.$(RESET)"
|
||||
echo "WARNING: untracked files (not in this commit, won't be in CI):"
|
||||
echo "$$untracked"
|
||||
echo
|
||||
fi
|
||||
endef
|
||||
|
||||
pre-commit:
|
||||
start=$$(date +%s)
|
||||
logdir=$$(mktemp -d "$${TMPDIR:-/tmp}/coder-pre-commit.XXXXXX")
|
||||
echo "$(BOLD)pre-commit$(RESET) ($$logdir)"
|
||||
echo "gen + fmt:"
|
||||
$(MAKE) --no-print-directory -j$(PARALLEL_JOBS) MAKE_TIMED=1 MAKE_LOGDIR=$$logdir gen fmt
|
||||
echo "=== Phase 1/2: gen + fmt ==="
|
||||
$(MAKE) -j$(PARALLEL_JOBS) --output-sync=target MAKE_TIMED=1 gen fmt
|
||||
$(check-unstaged)
|
||||
echo "lint + build:"
|
||||
$(MAKE) --no-print-directory -j$(PARALLEL_JOBS) MAKE_TIMED=1 MAKE_LOGDIR=$$logdir \
|
||||
echo "=== Phase 2/2: lint + build ==="
|
||||
$(MAKE) -j$(PARALLEL_JOBS) --output-sync=target MAKE_TIMED=1 \
|
||||
lint \
|
||||
lint/typos \
|
||||
build/coder-slim_$(GOOS)_$(GOARCH)$(GOOS_BIN_EXT)
|
||||
$(check-unstaged)
|
||||
$(check-untracked)
|
||||
rm -rf $$logdir
|
||||
echo "$(GREEN)✓ pre-commit passed$(RESET) ($$(( $$(date +%s) - $$start ))s)"
|
||||
echo "$(BOLD)$(GREEN)=== pre-commit passed in $$(( $$(date +%s) - $$start ))s ===$(RESET)"
|
||||
.PHONY: pre-commit
|
||||
|
||||
# Lightweight pre-commit for changes that don't touch Go or
|
||||
# TypeScript. Skips gen, lint/go, lint/ts, fmt/go, fmt/ts, and
|
||||
# the binary build. Used by the pre-commit hook when only docs,
|
||||
# shell, terraform, helm, or other fast-to-check files changed.
|
||||
pre-commit-light:
|
||||
start=$$(date +%s)
|
||||
logdir=$$(mktemp -d "$${TMPDIR:-/tmp}/coder-pre-commit-light.XXXXXX")
|
||||
echo "$(BOLD)pre-commit-light$(RESET) ($$logdir)"
|
||||
echo "fmt:"
|
||||
$(MAKE) --no-print-directory -j$(PARALLEL_JOBS) MAKE_TIMED=1 MAKE_LOGDIR=$$logdir fmt-light
|
||||
$(check-unstaged)
|
||||
echo "lint:"
|
||||
$(MAKE) --no-print-directory -j$(PARALLEL_JOBS) MAKE_TIMED=1 MAKE_LOGDIR=$$logdir lint-light
|
||||
$(check-unstaged)
|
||||
$(check-untracked)
|
||||
rm -rf $$logdir
|
||||
echo "$(GREEN)✓ pre-commit-light passed$(RESET) ($$(( $$(date +%s) - $$start ))s)"
|
||||
.PHONY: pre-commit-light
|
||||
|
||||
pre-push:
|
||||
start=$$(date +%s)
|
||||
logdir=$$(mktemp -d "$${TMPDIR:-/tmp}/coder-pre-push.XXXXXX")
|
||||
echo "$(BOLD)pre-push$(RESET) ($$logdir)"
|
||||
echo "test + build site:"
|
||||
$(MAKE) --no-print-directory -j$(PARALLEL_JOBS) MAKE_TIMED=1 MAKE_LOGDIR=$$logdir \
|
||||
echo "=== Phase 1/2: gen + fmt + postgres ==="
|
||||
$(MAKE) -j$(PARALLEL_JOBS) --output-sync=target MAKE_TIMED=1 gen fmt test-postgres-docker
|
||||
$(check-unstaged)
|
||||
echo "=== Phase 2/2: lint + build + test ==="
|
||||
$(MAKE) -j$(PARALLEL_JOBS) --output-sync=target MAKE_TIMED=1 \
|
||||
lint \
|
||||
lint/typos \
|
||||
build/coder-slim_$(GOOS)_$(GOARCH)$(GOOS_BIN_EXT) \
|
||||
site/out/index.html \
|
||||
test \
|
||||
test-js \
|
||||
test-storybook \
|
||||
site/out/index.html
|
||||
rm -rf $$logdir
|
||||
echo "$(GREEN)✓ pre-push passed$(RESET) ($$(( $$(date +%s) - $$start ))s)"
|
||||
test-e2e \
|
||||
test-race \
|
||||
sqlc-vet \
|
||||
offlinedocs/check
|
||||
$(check-unstaged)
|
||||
echo "$(BOLD)$(GREEN)=== pre-push passed in $$(( $$(date +%s) - $$start ))s ===$(RESET)"
|
||||
.PHONY: pre-push
|
||||
|
||||
offlinedocs/check: offlinedocs/node_modules/.installed
|
||||
@@ -1341,12 +1324,6 @@ test-js: site/node_modules/.installed
|
||||
pnpm test:ci
|
||||
.PHONY: test-js
|
||||
|
||||
test-storybook: site/node_modules/.installed
|
||||
cd site/
|
||||
pnpm playwright:install
|
||||
pnpm exec vitest run --project=storybook
|
||||
.PHONY: test-storybook
|
||||
|
||||
# sqlc-cloud-is-setup will fail if no SQLc auth token is set. Use this as a
|
||||
# dependency for any sqlc-cloud related targets.
|
||||
sqlc-cloud-is-setup:
|
||||
@@ -1495,5 +1472,3 @@ dogfood/coder/nix.hash: flake.nix flake.lock
|
||||
count-test-databases:
|
||||
PGPASSWORD=postgres psql -h localhost -U postgres -d coder_testing -P pager=off -c 'SELECT test_package, count(*) as count from test_databases GROUP BY test_package ORDER BY count DESC'
|
||||
.PHONY: count-test-databases
|
||||
|
||||
.PHONY: count-test-databases
|
||||
|
||||
+4
-17
@@ -16,6 +16,7 @@ import (
|
||||
"os/user"
|
||||
"path/filepath"
|
||||
"slices"
|
||||
"sort"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
@@ -38,7 +39,6 @@ import (
|
||||
"cdr.dev/slog/v3"
|
||||
"github.com/coder/clistat"
|
||||
"github.com/coder/coder/v2/agent/agentcontainers"
|
||||
"github.com/coder/coder/v2/agent/agentdesktop"
|
||||
"github.com/coder/coder/v2/agent/agentexec"
|
||||
"github.com/coder/coder/v2/agent/agentfiles"
|
||||
"github.com/coder/coder/v2/agent/agentgit"
|
||||
@@ -310,7 +310,6 @@ type agent struct {
|
||||
filesAPI *agentfiles.API
|
||||
gitAPI *agentgit.API
|
||||
processAPI *agentproc.API
|
||||
desktopAPI *agentdesktop.API
|
||||
|
||||
socketServerEnabled bool
|
||||
socketPath string
|
||||
@@ -384,18 +383,10 @@ func (a *agent) init() {
|
||||
|
||||
pathStore := agentgit.NewPathStore()
|
||||
a.filesAPI = agentfiles.NewAPI(a.logger.Named("files"), a.filesystem, pathStore)
|
||||
a.processAPI = agentproc.NewAPI(a.logger.Named("processes"), a.execer, a.updateCommandEnv, pathStore, func() string {
|
||||
if m := a.manifest.Load(); m != nil {
|
||||
return m.Directory
|
||||
}
|
||||
return ""
|
||||
})
|
||||
a.processAPI = agentproc.NewAPI(a.logger.Named("processes"), a.execer, a.updateCommandEnv, pathStore)
|
||||
gitOpts := append([]agentgit.Option{agentgit.WithClock(a.clock)}, a.gitAPIOptions...)
|
||||
a.gitAPI = agentgit.NewAPI(a.logger.Named("git"), pathStore, gitOpts...)
|
||||
desktop := agentdesktop.NewPortableDesktop(
|
||||
a.logger.Named("desktop"), a.execer, a.scriptRunner.ScriptBinDir(),
|
||||
)
|
||||
a.desktopAPI = agentdesktop.NewAPI(a.logger.Named("desktop"), desktop, a.clock)
|
||||
|
||||
a.reconnectingPTYServer = reconnectingpty.NewServer(
|
||||
a.logger.Named("reconnecting-pty"),
|
||||
a.sshServer,
|
||||
@@ -1876,7 +1867,7 @@ func (a *agent) Collect(ctx context.Context, networkStats map[netlogtype.Connect
|
||||
}()
|
||||
}
|
||||
wg.Wait()
|
||||
slices.Sort(durations)
|
||||
sort.Float64s(durations)
|
||||
durationsLength := len(durations)
|
||||
switch {
|
||||
case durationsLength == 0:
|
||||
@@ -2066,10 +2057,6 @@ func (a *agent) Close() error {
|
||||
a.logger.Error(a.hardCtx, "process API close", slog.Error(err))
|
||||
}
|
||||
|
||||
if err := a.desktopAPI.Close(); err != nil {
|
||||
a.logger.Error(a.hardCtx, "desktop API close", slog.Error(err))
|
||||
}
|
||||
|
||||
if a.boundaryLogProxy != nil {
|
||||
err = a.boundaryLogProxy.Close()
|
||||
if err != nil {
|
||||
|
||||
+9
-77
@@ -713,15 +713,15 @@ func TestAgent_Session_TTY_MOTD_Update(t *testing.T) {
|
||||
},
|
||||
}
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
defer cancel()
|
||||
|
||||
setSBInterval := func(_ *agenttest.Client, opts *agent.Options) {
|
||||
opts.ServiceBannerRefreshInterval = testutil.IntervalFast
|
||||
opts.ServiceBannerRefreshInterval = 5 * time.Millisecond
|
||||
}
|
||||
//nolint:dogsled // Allow the blank identifiers.
|
||||
conn, client, _, _, _ := setupAgent(t, agentsdk.Manifest{}, 0, setSBInterval)
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
defer cancel()
|
||||
|
||||
//nolint:paralleltest // These tests need to swap the banner func.
|
||||
for _, port := range sshPorts {
|
||||
sshClient, err := conn.SSHClientOnPort(ctx, port)
|
||||
@@ -733,10 +733,7 @@ func TestAgent_Session_TTY_MOTD_Update(t *testing.T) {
|
||||
for i, test := range tests {
|
||||
t.Run(fmt.Sprintf("(:%d)/%d", port, i), func(t *testing.T) {
|
||||
// Set new banner func and wait for the agent to call it to update the
|
||||
// banner. We wait for two calls to ensure the value has been stored:
|
||||
// the second call can only begin after the first iteration of
|
||||
// fetchServiceBannerLoop completes (call + store), so after
|
||||
// receiving two signals at least one store has happened.
|
||||
// banner.
|
||||
ready := make(chan struct{}, 2)
|
||||
client.SetAnnouncementBannersFunc(func() ([]codersdk.BannerConfig, error) {
|
||||
select {
|
||||
@@ -745,8 +742,8 @@ func TestAgent_Session_TTY_MOTD_Update(t *testing.T) {
|
||||
}
|
||||
return []codersdk.BannerConfig{test.banner}, nil
|
||||
})
|
||||
testutil.TryReceive(ctx, t, ready)
|
||||
testutil.TryReceive(ctx, t, ready)
|
||||
<-ready
|
||||
<-ready // Wait for two updates to ensure the value has propagated.
|
||||
|
||||
session, err := sshClient.NewSession()
|
||||
require.NoError(t, err)
|
||||
@@ -3043,62 +3040,6 @@ func TestAgent_Reconnect(t *testing.T) {
|
||||
closer.Close()
|
||||
}
|
||||
|
||||
func TestAgent_ReconnectNoLifecycleReemit(t *testing.T) {
|
||||
t.Parallel()
|
||||
ctx := testutil.Context(t, testutil.WaitLong)
|
||||
logger := testutil.Logger(t)
|
||||
|
||||
fCoordinator := tailnettest.NewFakeCoordinator()
|
||||
agentID := uuid.New()
|
||||
statsCh := make(chan *proto.Stats, 50)
|
||||
derpMap, _ := tailnettest.RunDERPAndSTUN(t)
|
||||
|
||||
client := agenttest.NewClient(t,
|
||||
logger,
|
||||
agentID,
|
||||
agentsdk.Manifest{
|
||||
DERPMap: derpMap,
|
||||
Scripts: []codersdk.WorkspaceAgentScript{{
|
||||
Script: "echo hello",
|
||||
Timeout: 30 * time.Second,
|
||||
RunOnStart: true,
|
||||
}},
|
||||
},
|
||||
statsCh,
|
||||
fCoordinator,
|
||||
)
|
||||
defer client.Close()
|
||||
|
||||
closer := agent.New(agent.Options{
|
||||
Client: client,
|
||||
Logger: logger.Named("agent"),
|
||||
})
|
||||
defer closer.Close()
|
||||
|
||||
// Wait for the agent to reach Ready state.
|
||||
require.Eventually(t, func() bool {
|
||||
return slices.Contains(client.GetLifecycleStates(), codersdk.WorkspaceAgentLifecycleReady)
|
||||
}, testutil.WaitShort, testutil.IntervalFast)
|
||||
|
||||
statesBefore := slices.Clone(client.GetLifecycleStates())
|
||||
|
||||
// Disconnect by closing the coordinator response channel.
|
||||
call1 := testutil.RequireReceive(ctx, t, fCoordinator.CoordinateCalls)
|
||||
close(call1.Resps)
|
||||
|
||||
// Wait for reconnect.
|
||||
testutil.RequireReceive(ctx, t, fCoordinator.CoordinateCalls)
|
||||
|
||||
// Wait for a stats report as a deterministic steady-state proof.
|
||||
testutil.RequireReceive(ctx, t, statsCh)
|
||||
|
||||
statesAfter := client.GetLifecycleStates()
|
||||
require.Equal(t, statesBefore, statesAfter,
|
||||
"lifecycle states should not be re-reported after reconnect")
|
||||
|
||||
closer.Close()
|
||||
}
|
||||
|
||||
func TestAgent_WriteVSCodeConfigs(t *testing.T) {
|
||||
t.Parallel()
|
||||
logger := testutil.Logger(t)
|
||||
@@ -3553,17 +3494,8 @@ func testSessionOutput(t *testing.T, session *ssh.Session, expected, unexpected
|
||||
require.NoError(t, err)
|
||||
|
||||
ptty.WriteLine("exit 0")
|
||||
|
||||
waitErr := make(chan error, 1)
|
||||
go func() {
|
||||
waitErr <- session.Wait()
|
||||
}()
|
||||
select {
|
||||
case err = <-waitErr:
|
||||
require.NoError(t, err)
|
||||
case <-time.After(testutil.WaitLong):
|
||||
require.Fail(t, "timed out waiting for session to exit")
|
||||
}
|
||||
err = session.Wait()
|
||||
require.NoError(t, err)
|
||||
|
||||
for _, unexpected := range unexpected {
|
||||
require.NotContains(t, stdout.String(), unexpected, "should not show output")
|
||||
|
||||
@@ -57,26 +57,18 @@ type fakeContainerCLI struct {
|
||||
}
|
||||
|
||||
func (f *fakeContainerCLI) List(_ context.Context) (codersdk.WorkspaceAgentListContainersResponse, error) {
|
||||
f.mu.Lock()
|
||||
defer f.mu.Unlock()
|
||||
return f.containers, f.listErr
|
||||
}
|
||||
|
||||
func (f *fakeContainerCLI) DetectArchitecture(_ context.Context, _ string) (string, error) {
|
||||
f.mu.Lock()
|
||||
defer f.mu.Unlock()
|
||||
return f.arch, f.archErr
|
||||
}
|
||||
|
||||
func (f *fakeContainerCLI) Copy(ctx context.Context, name, src, dst string) error {
|
||||
f.mu.Lock()
|
||||
defer f.mu.Unlock()
|
||||
return f.copyErr
|
||||
}
|
||||
|
||||
func (f *fakeContainerCLI) ExecAs(ctx context.Context, name, user string, args ...string) ([]byte, error) {
|
||||
f.mu.Lock()
|
||||
defer f.mu.Unlock()
|
||||
return nil, f.execErr
|
||||
}
|
||||
|
||||
@@ -2697,9 +2689,7 @@ func TestAPI(t *testing.T) {
|
||||
|
||||
// When: The container is recreated (new container ID) with config changes.
|
||||
terraformContainer.ID = "new-container-id"
|
||||
fCCLI.mu.Lock()
|
||||
fCCLI.containers.Containers = []codersdk.WorkspaceAgentContainer{terraformContainer}
|
||||
fCCLI.mu.Unlock()
|
||||
fDCCLI.upID = terraformContainer.ID
|
||||
fDCCLI.readConfig.MergedConfiguration.Customizations.Coder = []agentcontainers.CoderCustomization{{
|
||||
Apps: []agentcontainers.SubAgentApp{{Slug: "app2"}}, // Changed app triggers recreation logic.
|
||||
@@ -2831,9 +2821,7 @@ func TestAPI(t *testing.T) {
|
||||
// Simulate container rebuild: new container ID, changed display apps.
|
||||
newContainerID := "new-container-id"
|
||||
terraformContainer.ID = newContainerID
|
||||
fCCLI.mu.Lock()
|
||||
fCCLI.containers.Containers = []codersdk.WorkspaceAgentContainer{terraformContainer}
|
||||
fCCLI.mu.Unlock()
|
||||
fDCCLI.upID = newContainerID
|
||||
fDCCLI.readConfig.MergedConfiguration.Customizations.Coder = []agentcontainers.CoderCustomization{{
|
||||
DisplayApps: map[codersdk.DisplayApp]bool{
|
||||
@@ -4938,11 +4926,9 @@ func TestDevcontainerPrebuildSupport(t *testing.T) {
|
||||
)
|
||||
api.Start()
|
||||
|
||||
fCCLI.mu.Lock()
|
||||
fCCLI.containers = codersdk.WorkspaceAgentListContainersResponse{
|
||||
Containers: []codersdk.WorkspaceAgentContainer{testContainer},
|
||||
}
|
||||
fCCLI.mu.Unlock()
|
||||
|
||||
// Given: We allow the dev container to be created.
|
||||
fDCCLI.upID = testContainer.ID
|
||||
|
||||
@@ -433,7 +433,7 @@ func convertDockerInspect(raw []byte) ([]codersdk.WorkspaceAgentContainer, []str
|
||||
}
|
||||
portKeys := maps.Keys(in.NetworkSettings.Ports)
|
||||
// Sort the ports for deterministic output.
|
||||
slices.Sort(portKeys)
|
||||
sort.Strings(portKeys)
|
||||
// If we see the same port bound to both ipv4 and ipv6 loopback or unspecified
|
||||
// interfaces to the same container port, there is no point in adding it multiple times.
|
||||
loopbackHostPortContainerPorts := make(map[int]uint16, 0)
|
||||
|
||||
@@ -1,521 +0,0 @@
|
||||
package agentdesktop
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net/http"
|
||||
"strconv"
|
||||
"time"
|
||||
|
||||
"github.com/go-chi/chi/v5"
|
||||
|
||||
"cdr.dev/slog/v3"
|
||||
"github.com/coder/coder/v2/agent/agentssh"
|
||||
"github.com/coder/coder/v2/coderd/httpapi"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/codersdk/workspacesdk"
|
||||
"github.com/coder/quartz"
|
||||
"github.com/coder/websocket"
|
||||
)
|
||||
|
||||
// DesktopAction is the request body for the desktop action endpoint.
|
||||
type DesktopAction struct {
|
||||
Action string `json:"action"`
|
||||
Coordinate *[2]int `json:"coordinate,omitempty"`
|
||||
StartCoordinate *[2]int `json:"start_coordinate,omitempty"`
|
||||
Text *string `json:"text,omitempty"`
|
||||
Duration *int `json:"duration,omitempty"`
|
||||
ScrollAmount *int `json:"scroll_amount,omitempty"`
|
||||
ScrollDirection *string `json:"scroll_direction,omitempty"`
|
||||
// ScaledWidth and ScaledHeight describe the declared model-facing desktop
|
||||
// geometry. When provided, input coordinates are mapped from declared space
|
||||
// to native desktop pixels before dispatching.
|
||||
ScaledWidth *int `json:"scaled_width,omitempty"`
|
||||
ScaledHeight *int `json:"scaled_height,omitempty"`
|
||||
}
|
||||
|
||||
// DesktopActionResponse is the response from the desktop action
|
||||
// endpoint.
|
||||
type DesktopActionResponse struct {
|
||||
Output string `json:"output,omitempty"`
|
||||
ScreenshotData string `json:"screenshot_data,omitempty"`
|
||||
ScreenshotWidth int `json:"screenshot_width,omitempty"`
|
||||
ScreenshotHeight int `json:"screenshot_height,omitempty"`
|
||||
}
|
||||
|
||||
// API exposes the desktop streaming HTTP routes for the agent.
|
||||
type API struct {
|
||||
logger slog.Logger
|
||||
desktop Desktop
|
||||
clock quartz.Clock
|
||||
}
|
||||
|
||||
// NewAPI creates a new desktop streaming API.
|
||||
func NewAPI(logger slog.Logger, desktop Desktop, clock quartz.Clock) *API {
|
||||
if clock == nil {
|
||||
clock = quartz.NewReal()
|
||||
}
|
||||
return &API{
|
||||
logger: logger,
|
||||
desktop: desktop,
|
||||
clock: clock,
|
||||
}
|
||||
}
|
||||
|
||||
// Routes returns the chi router for mounting at /api/v0/desktop.
|
||||
func (a *API) Routes() http.Handler {
|
||||
r := chi.NewRouter()
|
||||
r.Get("/vnc", a.handleDesktopVNC)
|
||||
r.Post("/action", a.handleAction)
|
||||
return r
|
||||
}
|
||||
|
||||
func (a *API) handleDesktopVNC(rw http.ResponseWriter, r *http.Request) {
|
||||
ctx := r.Context()
|
||||
|
||||
// Start the desktop session (idempotent).
|
||||
_, err := a.desktop.Start(ctx)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Failed to start desktop session.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
|
||||
// Get a VNC connection.
|
||||
vncConn, err := a.desktop.VNCConn(ctx)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Failed to connect to VNC server.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
defer vncConn.Close()
|
||||
|
||||
// Accept WebSocket from coderd.
|
||||
conn, err := websocket.Accept(rw, r, &websocket.AcceptOptions{
|
||||
CompressionMode: websocket.CompressionDisabled,
|
||||
})
|
||||
if err != nil {
|
||||
a.logger.Error(ctx, "failed to accept websocket", slog.Error(err))
|
||||
return
|
||||
}
|
||||
|
||||
// No read limit — RFB framebuffer updates can be large.
|
||||
conn.SetReadLimit(-1)
|
||||
|
||||
wsCtx, wsNetConn := codersdk.WebsocketNetConn(ctx, conn, websocket.MessageBinary)
|
||||
defer wsNetConn.Close()
|
||||
|
||||
// Bicopy raw bytes between WebSocket and VNC TCP.
|
||||
agentssh.Bicopy(wsCtx, wsNetConn, vncConn)
|
||||
}
|
||||
|
||||
func (a *API) handleAction(rw http.ResponseWriter, r *http.Request) {
|
||||
ctx := r.Context()
|
||||
handlerStart := a.clock.Now()
|
||||
|
||||
// Ensure the desktop is running and grab native dimensions.
|
||||
cfg, err := a.desktop.Start(ctx)
|
||||
if err != nil {
|
||||
a.logger.Warn(ctx, "handleAction: desktop.Start failed",
|
||||
slog.Error(err),
|
||||
slog.F("elapsed_ms", a.clock.Since(handlerStart).Milliseconds()),
|
||||
)
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Failed to start desktop session.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
|
||||
var action DesktopAction
|
||||
if err := json.NewDecoder(r.Body).Decode(&action); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Failed to decode request body.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
|
||||
a.logger.Info(ctx, "handleAction: started",
|
||||
slog.F("action", action.Action),
|
||||
slog.F("elapsed_ms", a.clock.Since(handlerStart).Milliseconds()),
|
||||
)
|
||||
|
||||
geometry := desktopGeometryForAction(cfg, action)
|
||||
scaleXY := geometry.DeclaredPointToNative
|
||||
|
||||
var resp DesktopActionResponse
|
||||
|
||||
switch action.Action {
|
||||
case "key":
|
||||
if action.Text == nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Missing \"text\" for key action.",
|
||||
})
|
||||
return
|
||||
}
|
||||
if err := a.desktop.KeyPress(ctx, *action.Text); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Key press failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "key action performed"
|
||||
|
||||
case "type":
|
||||
if action.Text == nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Missing \"text\" for type action.",
|
||||
})
|
||||
return
|
||||
}
|
||||
if err := a.desktop.Type(ctx, *action.Text); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Type action failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "type action performed"
|
||||
|
||||
case "cursor_position":
|
||||
nativeX, nativeY, err := a.desktop.CursorPosition(ctx)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Cursor position failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y := geometry.NativePointToDeclared(nativeX, nativeY)
|
||||
resp.Output = "x=" + strconv.Itoa(x) + ",y=" + strconv.Itoa(y)
|
||||
|
||||
case "mouse_move":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
if err := a.desktop.Move(ctx, x, y); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Mouse move failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "mouse_move action performed"
|
||||
|
||||
case "left_click":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
stepStart := a.clock.Now()
|
||||
if err := a.desktop.Click(ctx, x, y, MouseButtonLeft); err != nil {
|
||||
a.logger.Warn(ctx, "handleAction: Click failed",
|
||||
slog.F("action", "left_click"),
|
||||
slog.F("step", "click"),
|
||||
slog.F("step_ms", time.Since(stepStart).Milliseconds()),
|
||||
slog.F("elapsed_ms", a.clock.Since(handlerStart).Milliseconds()),
|
||||
slog.Error(err),
|
||||
)
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Left click failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
a.logger.Debug(ctx, "handleAction: Click completed",
|
||||
slog.F("action", "left_click"),
|
||||
slog.F("step_ms", time.Since(stepStart).Milliseconds()),
|
||||
slog.F("elapsed_ms", a.clock.Since(handlerStart).Milliseconds()),
|
||||
)
|
||||
resp.Output = "left_click action performed"
|
||||
|
||||
case "left_click_drag":
|
||||
if action.Coordinate == nil || action.StartCoordinate == nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Missing \"coordinate\" or \"start_coordinate\" for left_click_drag.",
|
||||
})
|
||||
return
|
||||
}
|
||||
sx, sy := scaleXY(action.StartCoordinate[0], action.StartCoordinate[1])
|
||||
ex, ey := scaleXY(action.Coordinate[0], action.Coordinate[1])
|
||||
if err := a.desktop.Drag(ctx, sx, sy, ex, ey); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Left click drag failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "left_click_drag action performed"
|
||||
|
||||
case "left_mouse_down":
|
||||
if err := a.desktop.ButtonDown(ctx, MouseButtonLeft); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Left mouse down failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "left_mouse_down action performed"
|
||||
|
||||
case "left_mouse_up":
|
||||
if err := a.desktop.ButtonUp(ctx, MouseButtonLeft); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Left mouse up failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "left_mouse_up action performed"
|
||||
|
||||
case "right_click":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
if err := a.desktop.Click(ctx, x, y, MouseButtonRight); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Right click failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "right_click action performed"
|
||||
|
||||
case "middle_click":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
if err := a.desktop.Click(ctx, x, y, MouseButtonMiddle); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Middle click failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "middle_click action performed"
|
||||
|
||||
case "double_click":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
if err := a.desktop.DoubleClick(ctx, x, y, MouseButtonLeft); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Double click failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "double_click action performed"
|
||||
|
||||
case "triple_click":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
for range 3 {
|
||||
if err := a.desktop.Click(ctx, x, y, MouseButtonLeft); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Triple click failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
}
|
||||
resp.Output = "triple_click action performed"
|
||||
|
||||
case "scroll":
|
||||
x, y, err := coordFromAction(action)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
x, y = scaleXY(x, y)
|
||||
|
||||
amount := 3
|
||||
if action.ScrollAmount != nil {
|
||||
amount = *action.ScrollAmount
|
||||
}
|
||||
direction := "down"
|
||||
if action.ScrollDirection != nil {
|
||||
direction = *action.ScrollDirection
|
||||
}
|
||||
|
||||
var dx, dy int
|
||||
switch direction {
|
||||
case "up":
|
||||
dy = -amount
|
||||
case "down":
|
||||
dy = amount
|
||||
case "left":
|
||||
dx = -amount
|
||||
case "right":
|
||||
dx = amount
|
||||
default:
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Invalid scroll direction: " + direction,
|
||||
})
|
||||
return
|
||||
}
|
||||
|
||||
if err := a.desktop.Scroll(ctx, x, y, dx, dy); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Scroll failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "scroll action performed"
|
||||
|
||||
case "hold_key":
|
||||
if action.Text == nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Missing \"text\" for hold_key action.",
|
||||
})
|
||||
return
|
||||
}
|
||||
dur := 1000
|
||||
if action.Duration != nil {
|
||||
dur = *action.Duration
|
||||
}
|
||||
if err := a.desktop.KeyDown(ctx, *action.Text); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Key down failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
timer := a.clock.NewTimer(time.Duration(dur)*time.Millisecond, "agentdesktop", "hold_key")
|
||||
defer timer.Stop()
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
// Context canceled; release the key immediately.
|
||||
if err := a.desktop.KeyUp(ctx, *action.Text); err != nil {
|
||||
a.logger.Warn(ctx, "handleAction: KeyUp after context cancel", slog.Error(err))
|
||||
}
|
||||
return
|
||||
case <-timer.C:
|
||||
}
|
||||
if err := a.desktop.KeyUp(ctx, *action.Text); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Key up failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "hold_key action performed"
|
||||
|
||||
case "screenshot":
|
||||
result, err := a.desktop.Screenshot(ctx, ScreenshotOptions{
|
||||
TargetWidth: geometry.DeclaredWidth,
|
||||
TargetHeight: geometry.DeclaredHeight,
|
||||
})
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Screenshot failed.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
return
|
||||
}
|
||||
resp.Output = "screenshot"
|
||||
resp.ScreenshotData = result.Data
|
||||
resp.ScreenshotWidth = geometry.DeclaredWidth
|
||||
resp.ScreenshotHeight = geometry.DeclaredHeight
|
||||
|
||||
default:
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Unknown action: " + action.Action,
|
||||
})
|
||||
return
|
||||
}
|
||||
|
||||
elapsedMs := a.clock.Since(handlerStart).Milliseconds()
|
||||
if ctx.Err() != nil {
|
||||
a.logger.Error(ctx, "handleAction: context canceled before writing response",
|
||||
slog.F("action", action.Action),
|
||||
slog.F("elapsed_ms", elapsedMs),
|
||||
slog.Error(ctx.Err()),
|
||||
)
|
||||
return
|
||||
}
|
||||
a.logger.Info(ctx, "handleAction: writing response",
|
||||
slog.F("action", action.Action),
|
||||
slog.F("elapsed_ms", elapsedMs),
|
||||
)
|
||||
httpapi.Write(ctx, rw, http.StatusOK, resp)
|
||||
}
|
||||
|
||||
// Close shuts down the desktop session if one is running.
|
||||
func (a *API) Close() error {
|
||||
return a.desktop.Close()
|
||||
}
|
||||
|
||||
// coordFromAction extracts the coordinate pair from a DesktopAction,
|
||||
// returning an error if the coordinate field is missing.
|
||||
func coordFromAction(action DesktopAction) (x, y int, err error) {
|
||||
if action.Coordinate == nil {
|
||||
return 0, 0, &missingFieldError{field: "coordinate", action: action.Action}
|
||||
}
|
||||
return action.Coordinate[0], action.Coordinate[1], nil
|
||||
}
|
||||
|
||||
func desktopGeometryForAction(cfg DisplayConfig, action DesktopAction) workspacesdk.DesktopGeometry {
|
||||
declaredWidth := cfg.Width
|
||||
declaredHeight := cfg.Height
|
||||
if action.ScaledWidth != nil && *action.ScaledWidth > 0 {
|
||||
declaredWidth = *action.ScaledWidth
|
||||
}
|
||||
if action.ScaledHeight != nil && *action.ScaledHeight > 0 {
|
||||
declaredHeight = *action.ScaledHeight
|
||||
}
|
||||
return workspacesdk.NewDesktopGeometryWithDeclared(
|
||||
cfg.Width,
|
||||
cfg.Height,
|
||||
declaredWidth,
|
||||
declaredHeight,
|
||||
)
|
||||
}
|
||||
|
||||
// missingFieldError is returned when a required field is absent from
|
||||
// a DesktopAction.
|
||||
type missingFieldError struct {
|
||||
field string
|
||||
action string
|
||||
}
|
||||
|
||||
func (e *missingFieldError) Error() string {
|
||||
return "Missing \"" + e.field + "\" for " + e.action + " action."
|
||||
}
|
||||
@@ -1,576 +0,0 @@
|
||||
package agentdesktop_test
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"context"
|
||||
"encoding/json"
|
||||
"net"
|
||||
"net/http"
|
||||
"net/http/httptest"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
"golang.org/x/xerrors"
|
||||
|
||||
"cdr.dev/slog/v3/sloggers/slogtest"
|
||||
"github.com/coder/coder/v2/agent/agentdesktop"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/codersdk/workspacesdk"
|
||||
"github.com/coder/quartz"
|
||||
)
|
||||
|
||||
// Ensure fakeDesktop satisfies the Desktop interface at compile time.
|
||||
var _ agentdesktop.Desktop = (*fakeDesktop)(nil)
|
||||
|
||||
// fakeDesktop is a minimal Desktop implementation for unit tests.
|
||||
type fakeDesktop struct {
|
||||
startErr error
|
||||
cursorPos [2]int
|
||||
startCfg agentdesktop.DisplayConfig
|
||||
vncConnErr error
|
||||
screenshotErr error
|
||||
screenshotRes agentdesktop.ScreenshotResult
|
||||
lastShotOpts agentdesktop.ScreenshotOptions
|
||||
closed bool
|
||||
|
||||
// Track calls for assertions.
|
||||
lastMove [2]int
|
||||
lastClick [3]int // x, y, button
|
||||
lastScroll [4]int // x, y, dx, dy
|
||||
lastKey string
|
||||
lastTyped string
|
||||
lastKeyDown string
|
||||
lastKeyUp string
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Start(context.Context) (agentdesktop.DisplayConfig, error) {
|
||||
return f.startCfg, f.startErr
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) VNCConn(context.Context) (net.Conn, error) {
|
||||
return nil, f.vncConnErr
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Screenshot(_ context.Context, opts agentdesktop.ScreenshotOptions) (agentdesktop.ScreenshotResult, error) {
|
||||
f.lastShotOpts = opts
|
||||
return f.screenshotRes, f.screenshotErr
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Move(_ context.Context, x, y int) error {
|
||||
f.lastMove = [2]int{x, y}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Click(_ context.Context, x, y int, _ agentdesktop.MouseButton) error {
|
||||
f.lastClick = [3]int{x, y, 1}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) DoubleClick(_ context.Context, x, y int, _ agentdesktop.MouseButton) error {
|
||||
f.lastClick = [3]int{x, y, 2}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (*fakeDesktop) ButtonDown(context.Context, agentdesktop.MouseButton) error { return nil }
|
||||
func (*fakeDesktop) ButtonUp(context.Context, agentdesktop.MouseButton) error { return nil }
|
||||
|
||||
func (f *fakeDesktop) Scroll(_ context.Context, x, y, dx, dy int) error {
|
||||
f.lastScroll = [4]int{x, y, dx, dy}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (*fakeDesktop) Drag(context.Context, int, int, int, int) error { return nil }
|
||||
|
||||
func (f *fakeDesktop) KeyPress(_ context.Context, key string) error {
|
||||
f.lastKey = key
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) KeyDown(_ context.Context, key string) error {
|
||||
f.lastKeyDown = key
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) KeyUp(_ context.Context, key string) error {
|
||||
f.lastKeyUp = key
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Type(_ context.Context, text string) error {
|
||||
f.lastTyped = text
|
||||
return nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) CursorPosition(context.Context) (x int, y int, err error) {
|
||||
return f.cursorPos[0], f.cursorPos[1], nil
|
||||
}
|
||||
|
||||
func (f *fakeDesktop) Close() error {
|
||||
f.closed = true
|
||||
return nil
|
||||
}
|
||||
|
||||
func TestHandleDesktopVNC_StartError(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{startErr: xerrors.New("no desktop")}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodGet, "/vnc", nil)
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusInternalServerError, rr.Code)
|
||||
|
||||
var resp codersdk.Response
|
||||
err := json.NewDecoder(rr.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "Failed to start desktop session.", resp.Message)
|
||||
}
|
||||
|
||||
func TestHandleAction_Screenshot(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
geometry := workspacesdk.DefaultDesktopGeometry()
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{
|
||||
Width: geometry.NativeWidth,
|
||||
Height: geometry.NativeHeight,
|
||||
},
|
||||
screenshotRes: agentdesktop.ScreenshotResult{Data: "base64data"},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
body := agentdesktop.DesktopAction{Action: "screenshot"}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
|
||||
var result agentdesktop.DesktopActionResponse
|
||||
err = json.NewDecoder(rr.Body).Decode(&result)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "screenshot", result.Output)
|
||||
assert.Equal(t, "base64data", result.ScreenshotData)
|
||||
assert.Equal(t, geometry.NativeWidth, result.ScreenshotWidth)
|
||||
assert.Equal(t, geometry.NativeHeight, result.ScreenshotHeight)
|
||||
assert.Equal(t, agentdesktop.ScreenshotOptions{
|
||||
TargetWidth: geometry.NativeWidth,
|
||||
TargetHeight: geometry.NativeHeight,
|
||||
}, fake.lastShotOpts)
|
||||
}
|
||||
|
||||
func TestHandleAction_ScreenshotUsesDeclaredDimensionsFromRequest(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
screenshotRes: agentdesktop.ScreenshotResult{Data: "base64data"},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
sw := 1280
|
||||
sh := 720
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "screenshot",
|
||||
ScaledWidth: &sw,
|
||||
ScaledHeight: &sh,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, agentdesktop.ScreenshotOptions{TargetWidth: 1280, TargetHeight: 720}, fake.lastShotOpts)
|
||||
|
||||
var result agentdesktop.DesktopActionResponse
|
||||
err = json.NewDecoder(rr.Body).Decode(&result)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, 1280, result.ScreenshotWidth)
|
||||
assert.Equal(t, 720, result.ScreenshotHeight)
|
||||
}
|
||||
|
||||
func TestHandleAction_LeftClick(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "left_click",
|
||||
Coordinate: &[2]int{100, 200},
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
|
||||
var resp agentdesktop.DesktopActionResponse
|
||||
err = json.NewDecoder(rr.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "left_click action performed", resp.Output)
|
||||
assert.Equal(t, [3]int{100, 200, 1}, fake.lastClick)
|
||||
}
|
||||
|
||||
func TestHandleAction_UnknownAction(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
body := agentdesktop.DesktopAction{Action: "explode"}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusBadRequest, rr.Code)
|
||||
}
|
||||
|
||||
func TestHandleAction_KeyAction(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
text := "Return"
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "key",
|
||||
Text: &text,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, "Return", fake.lastKey)
|
||||
}
|
||||
|
||||
func TestHandleAction_TypeAction(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
text := "hello world"
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "type",
|
||||
Text: &text,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, "hello world", fake.lastTyped)
|
||||
}
|
||||
|
||||
func TestHandleAction_HoldKey(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
mClk := quartz.NewMock(t)
|
||||
trap := mClk.Trap().NewTimer("agentdesktop", "hold_key")
|
||||
defer trap.Close()
|
||||
api := agentdesktop.NewAPI(logger, fake, mClk)
|
||||
defer api.Close()
|
||||
|
||||
text := "Shift_L"
|
||||
dur := 100
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "hold_key",
|
||||
Text: &text,
|
||||
Duration: &dur,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
|
||||
done := make(chan struct{})
|
||||
go func() {
|
||||
defer close(done)
|
||||
handler.ServeHTTP(rr, req)
|
||||
}()
|
||||
|
||||
trap.MustWait(req.Context()).MustRelease(req.Context())
|
||||
mClk.Advance(time.Duration(dur) * time.Millisecond).MustWait(req.Context())
|
||||
|
||||
<-done
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
|
||||
var resp agentdesktop.DesktopActionResponse
|
||||
err = json.NewDecoder(rr.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "hold_key action performed", resp.Output)
|
||||
assert.Equal(t, "Shift_L", fake.lastKeyDown)
|
||||
assert.Equal(t, "Shift_L", fake.lastKeyUp)
|
||||
}
|
||||
|
||||
func TestHandleAction_HoldKeyMissingText(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
body := agentdesktop.DesktopAction{Action: "hold_key"}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusBadRequest, rr.Code)
|
||||
|
||||
var resp codersdk.Response
|
||||
err = json.NewDecoder(rr.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "Missing \"text\" for hold_key action.", resp.Message)
|
||||
}
|
||||
|
||||
func TestHandleAction_ScrollDown(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
dir := "down"
|
||||
amount := 5
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "scroll",
|
||||
Coordinate: &[2]int{500, 400},
|
||||
ScrollDirection: &dir,
|
||||
ScrollAmount: &amount,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, [4]int{500, 400, 0, 5}, fake.lastScroll)
|
||||
}
|
||||
|
||||
func TestHandleAction_CoordinateScaling(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
sw := 1280
|
||||
sh := 720
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "mouse_move",
|
||||
Coordinate: &[2]int{640, 360},
|
||||
ScaledWidth: &sw,
|
||||
ScaledHeight: &sh,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, 960, fake.lastMove[0])
|
||||
assert.Equal(t, 540, fake.lastMove[1])
|
||||
}
|
||||
|
||||
func TestHandleAction_CoordinateScalingClampsToLastPixel(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
sw := 1366
|
||||
sh := 768
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "mouse_move",
|
||||
Coordinate: &[2]int{1365, 767},
|
||||
ScaledWidth: &sw,
|
||||
ScaledHeight: &sh,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
assert.Equal(t, 1919, fake.lastMove[0])
|
||||
assert.Equal(t, 1079, fake.lastMove[1])
|
||||
}
|
||||
|
||||
func TestClose_DelegatesToDesktop(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
|
||||
err := api.Close()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, fake.closed)
|
||||
}
|
||||
|
||||
func TestClose_PreventsNewSessions(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
|
||||
err := api.Close()
|
||||
require.NoError(t, err)
|
||||
|
||||
fake.startErr = xerrors.New("desktop is closed")
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodGet, "/vnc", nil)
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusInternalServerError, rr.Code)
|
||||
}
|
||||
|
||||
func TestHandleAction_CursorPositionReturnsDeclaredCoordinates(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
fake := &fakeDesktop{
|
||||
startCfg: agentdesktop.DisplayConfig{Width: 1920, Height: 1080},
|
||||
cursorPos: [2]int{960, 540},
|
||||
}
|
||||
api := agentdesktop.NewAPI(logger, fake, nil)
|
||||
defer api.Close()
|
||||
|
||||
sw := 1280
|
||||
sh := 720
|
||||
body := agentdesktop.DesktopAction{
|
||||
Action: "cursor_position",
|
||||
ScaledWidth: &sw,
|
||||
ScaledHeight: &sh,
|
||||
}
|
||||
b, err := json.Marshal(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
rr := httptest.NewRecorder()
|
||||
req := httptest.NewRequest(http.MethodPost, "/action", bytes.NewReader(b))
|
||||
req.Header.Set("Content-Type", "application/json")
|
||||
|
||||
handler := api.Routes()
|
||||
handler.ServeHTTP(rr, req)
|
||||
|
||||
assert.Equal(t, http.StatusOK, rr.Code)
|
||||
|
||||
var resp agentdesktop.DesktopActionResponse
|
||||
err = json.NewDecoder(rr.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
// Native (960,540) in 1920x1080 should map to declared space in 1280x720.
|
||||
assert.Equal(t, "x=640,y=360", resp.Output)
|
||||
}
|
||||
@@ -1,91 +0,0 @@
|
||||
package agentdesktop
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net"
|
||||
)
|
||||
|
||||
// Desktop abstracts a virtual desktop session running inside a workspace.
|
||||
type Desktop interface {
|
||||
// Start launches the desktop session. It is idempotent — calling
|
||||
// Start on an already-running session returns the existing
|
||||
// config. The returned DisplayConfig describes the running
|
||||
// session.
|
||||
Start(ctx context.Context) (DisplayConfig, error)
|
||||
|
||||
// VNCConn dials the desktop's VNC server and returns a raw
|
||||
// net.Conn carrying RFB binary frames. Each call returns a new
|
||||
// connection; multiple clients can connect simultaneously.
|
||||
// Start must be called before VNCConn.
|
||||
VNCConn(ctx context.Context) (net.Conn, error)
|
||||
|
||||
// Screenshot captures the current framebuffer as a PNG and
|
||||
// returns it base64-encoded. TargetWidth/TargetHeight in opts
|
||||
// are the desired output dimensions (the implementation
|
||||
// rescales); pass 0 to use native resolution.
|
||||
Screenshot(ctx context.Context, opts ScreenshotOptions) (ScreenshotResult, error)
|
||||
|
||||
// Mouse operations.
|
||||
|
||||
// Move moves the mouse cursor to absolute coordinates.
|
||||
Move(ctx context.Context, x, y int) error
|
||||
// Click performs a mouse button click at the given coordinates.
|
||||
Click(ctx context.Context, x, y int, button MouseButton) error
|
||||
// DoubleClick performs a double-click at the given coordinates.
|
||||
DoubleClick(ctx context.Context, x, y int, button MouseButton) error
|
||||
// ButtonDown presses and holds a mouse button.
|
||||
ButtonDown(ctx context.Context, button MouseButton) error
|
||||
// ButtonUp releases a mouse button.
|
||||
ButtonUp(ctx context.Context, button MouseButton) error
|
||||
// Scroll scrolls by (dx, dy) clicks at the given coordinates.
|
||||
Scroll(ctx context.Context, x, y, dx, dy int) error
|
||||
// Drag moves from (startX,startY) to (endX,endY) while holding
|
||||
// the left mouse button.
|
||||
Drag(ctx context.Context, startX, startY, endX, endY int) error
|
||||
|
||||
// Keyboard operations.
|
||||
|
||||
// KeyPress sends a key-down then key-up for a key combo string
|
||||
// (e.g. "Return", "ctrl+c").
|
||||
KeyPress(ctx context.Context, keys string) error
|
||||
// KeyDown presses and holds a key.
|
||||
KeyDown(ctx context.Context, key string) error
|
||||
// KeyUp releases a key.
|
||||
KeyUp(ctx context.Context, key string) error
|
||||
// Type types a string of text character-by-character.
|
||||
Type(ctx context.Context, text string) error
|
||||
|
||||
// CursorPosition returns the current cursor coordinates.
|
||||
CursorPosition(ctx context.Context) (x, y int, err error)
|
||||
|
||||
// Close shuts down the desktop session and cleans up resources.
|
||||
Close() error
|
||||
}
|
||||
|
||||
// DisplayConfig describes a running desktop session.
|
||||
type DisplayConfig struct {
|
||||
Width int // native width in pixels
|
||||
Height int // native height in pixels
|
||||
VNCPort int // local TCP port for the VNC server
|
||||
Display int // X11 display number (e.g. 1 for :1), -1 if N/A
|
||||
}
|
||||
|
||||
// MouseButton identifies a mouse button.
|
||||
type MouseButton string
|
||||
|
||||
const (
|
||||
MouseButtonLeft MouseButton = "left"
|
||||
MouseButtonRight MouseButton = "right"
|
||||
MouseButtonMiddle MouseButton = "middle"
|
||||
)
|
||||
|
||||
// ScreenshotOptions configures a screenshot capture.
|
||||
type ScreenshotOptions struct {
|
||||
TargetWidth int // 0 = native
|
||||
TargetHeight int // 0 = native
|
||||
}
|
||||
|
||||
// ScreenshotResult is a captured screenshot.
|
||||
type ScreenshotResult struct {
|
||||
Data string // base64-encoded PNG
|
||||
}
|
||||
@@ -1,399 +0,0 @@
|
||||
package agentdesktop
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"net"
|
||||
"os"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
"strconv"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"golang.org/x/xerrors"
|
||||
|
||||
"cdr.dev/slog/v3"
|
||||
"github.com/coder/coder/v2/agent/agentexec"
|
||||
"github.com/coder/coder/v2/codersdk/workspacesdk"
|
||||
)
|
||||
|
||||
// portableDesktopOutput is the JSON output from
|
||||
// `portabledesktop up --json`.
|
||||
type portableDesktopOutput struct {
|
||||
VNCPort int `json:"vncPort"`
|
||||
Geometry string `json:"geometry"` // e.g. "1920x1080"
|
||||
}
|
||||
|
||||
// desktopSession tracks a running portabledesktop process.
|
||||
type desktopSession struct {
|
||||
cmd *exec.Cmd
|
||||
vncPort int
|
||||
width int // native width, parsed from geometry
|
||||
height int // native height, parsed from geometry
|
||||
display int // X11 display number, -1 if not available
|
||||
cancel context.CancelFunc
|
||||
}
|
||||
|
||||
// cursorOutput is the JSON output from `portabledesktop cursor --json`.
|
||||
type cursorOutput struct {
|
||||
X int `json:"x"`
|
||||
Y int `json:"y"`
|
||||
}
|
||||
|
||||
// screenshotOutput is the JSON output from
|
||||
// `portabledesktop screenshot --json`.
|
||||
type screenshotOutput struct {
|
||||
Data string `json:"data"`
|
||||
}
|
||||
|
||||
// portableDesktop implements Desktop by shelling out to the
|
||||
// portabledesktop CLI via agentexec.Execer.
|
||||
type portableDesktop struct {
|
||||
logger slog.Logger
|
||||
execer agentexec.Execer
|
||||
scriptBinDir string // coder script bin directory
|
||||
|
||||
mu sync.Mutex
|
||||
session *desktopSession // nil until started
|
||||
binPath string // resolved path to binary, cached
|
||||
closed bool
|
||||
}
|
||||
|
||||
// NewPortableDesktop creates a Desktop backed by the portabledesktop
|
||||
// CLI binary, using execer to spawn child processes. scriptBinDir is
|
||||
// the coder script bin directory checked for the binary.
|
||||
func NewPortableDesktop(
|
||||
logger slog.Logger,
|
||||
execer agentexec.Execer,
|
||||
scriptBinDir string,
|
||||
) Desktop {
|
||||
return &portableDesktop{
|
||||
logger: logger,
|
||||
execer: execer,
|
||||
scriptBinDir: scriptBinDir,
|
||||
}
|
||||
}
|
||||
|
||||
// Start launches the desktop session (idempotent).
|
||||
func (p *portableDesktop) Start(ctx context.Context) (DisplayConfig, error) {
|
||||
p.mu.Lock()
|
||||
defer p.mu.Unlock()
|
||||
|
||||
if p.closed {
|
||||
return DisplayConfig{}, xerrors.New("desktop is closed")
|
||||
}
|
||||
|
||||
if err := p.ensureBinary(ctx); err != nil {
|
||||
return DisplayConfig{}, xerrors.Errorf("ensure portabledesktop binary: %w", err)
|
||||
}
|
||||
|
||||
// If we have an existing session, check if it's still alive.
|
||||
if p.session != nil {
|
||||
if !(p.session.cmd.ProcessState != nil && p.session.cmd.ProcessState.Exited()) {
|
||||
return DisplayConfig{
|
||||
Width: p.session.width,
|
||||
Height: p.session.height,
|
||||
VNCPort: p.session.vncPort,
|
||||
Display: p.session.display,
|
||||
}, nil
|
||||
}
|
||||
// Process died — clean up and recreate.
|
||||
p.logger.Warn(ctx, "portabledesktop process died, recreating session")
|
||||
p.session.cancel()
|
||||
p.session = nil
|
||||
}
|
||||
|
||||
// Spawn portabledesktop up --json.
|
||||
sessionCtx, sessionCancel := context.WithCancel(context.Background())
|
||||
|
||||
//nolint:gosec // portabledesktop is a trusted binary resolved via ensureBinary.
|
||||
cmd := p.execer.CommandContext(sessionCtx, p.binPath, "up", "--json",
|
||||
"--geometry", fmt.Sprintf("%dx%d", workspacesdk.DesktopNativeWidth, workspacesdk.DesktopNativeHeight))
|
||||
stdout, err := cmd.StdoutPipe()
|
||||
if err != nil {
|
||||
sessionCancel()
|
||||
return DisplayConfig{}, xerrors.Errorf("create stdout pipe: %w", err)
|
||||
}
|
||||
|
||||
if err := cmd.Start(); err != nil {
|
||||
sessionCancel()
|
||||
return DisplayConfig{}, xerrors.Errorf("start portabledesktop: %w", err)
|
||||
}
|
||||
|
||||
// Parse the JSON output to get VNC port and geometry.
|
||||
var output portableDesktopOutput
|
||||
if err := json.NewDecoder(stdout).Decode(&output); err != nil {
|
||||
sessionCancel()
|
||||
_ = cmd.Process.Kill()
|
||||
_ = cmd.Wait()
|
||||
return DisplayConfig{}, xerrors.Errorf("parse portabledesktop output: %w", err)
|
||||
}
|
||||
|
||||
if output.VNCPort == 0 {
|
||||
sessionCancel()
|
||||
_ = cmd.Process.Kill()
|
||||
_ = cmd.Wait()
|
||||
return DisplayConfig{}, xerrors.New("portabledesktop returned port 0")
|
||||
}
|
||||
|
||||
var w, h int
|
||||
if output.Geometry != "" {
|
||||
if _, err := fmt.Sscanf(output.Geometry, "%dx%d", &w, &h); err != nil {
|
||||
p.logger.Warn(ctx, "failed to parse geometry, using defaults",
|
||||
slog.F("geometry", output.Geometry),
|
||||
slog.Error(err),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
p.logger.Info(ctx, "started portabledesktop session",
|
||||
slog.F("vnc_port", output.VNCPort),
|
||||
slog.F("width", w),
|
||||
slog.F("height", h),
|
||||
slog.F("pid", cmd.Process.Pid),
|
||||
)
|
||||
|
||||
p.session = &desktopSession{
|
||||
cmd: cmd,
|
||||
vncPort: output.VNCPort,
|
||||
width: w,
|
||||
height: h,
|
||||
display: -1,
|
||||
cancel: sessionCancel,
|
||||
}
|
||||
|
||||
return DisplayConfig{
|
||||
Width: w,
|
||||
Height: h,
|
||||
VNCPort: output.VNCPort,
|
||||
Display: -1,
|
||||
}, nil
|
||||
}
|
||||
|
||||
// VNCConn dials the desktop's VNC server and returns a raw
|
||||
// net.Conn carrying RFB binary frames.
|
||||
func (p *portableDesktop) VNCConn(_ context.Context) (net.Conn, error) {
|
||||
p.mu.Lock()
|
||||
session := p.session
|
||||
p.mu.Unlock()
|
||||
|
||||
if session == nil {
|
||||
return nil, xerrors.New("desktop session not started")
|
||||
}
|
||||
|
||||
return net.Dial("tcp", fmt.Sprintf("127.0.0.1:%d", session.vncPort))
|
||||
}
|
||||
|
||||
// Screenshot captures the current framebuffer as a base64-encoded PNG.
|
||||
func (p *portableDesktop) Screenshot(ctx context.Context, opts ScreenshotOptions) (ScreenshotResult, error) {
|
||||
args := []string{"screenshot", "--json"}
|
||||
if opts.TargetWidth > 0 {
|
||||
args = append(args, "--target-width", strconv.Itoa(opts.TargetWidth))
|
||||
}
|
||||
if opts.TargetHeight > 0 {
|
||||
args = append(args, "--target-height", strconv.Itoa(opts.TargetHeight))
|
||||
}
|
||||
|
||||
out, err := p.runCmd(ctx, args...)
|
||||
if err != nil {
|
||||
return ScreenshotResult{}, err
|
||||
}
|
||||
|
||||
var result screenshotOutput
|
||||
if err := json.Unmarshal([]byte(out), &result); err != nil {
|
||||
return ScreenshotResult{}, xerrors.Errorf("parse screenshot output: %w", err)
|
||||
}
|
||||
|
||||
return ScreenshotResult(result), nil
|
||||
}
|
||||
|
||||
// Move moves the mouse cursor to absolute coordinates.
|
||||
func (p *portableDesktop) Move(ctx context.Context, x, y int) error {
|
||||
_, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(x), strconv.Itoa(y))
|
||||
return err
|
||||
}
|
||||
|
||||
// Click performs a mouse button click at the given coordinates.
|
||||
func (p *portableDesktop) Click(ctx context.Context, x, y int, button MouseButton) error {
|
||||
if _, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(x), strconv.Itoa(y)); err != nil {
|
||||
return err
|
||||
}
|
||||
_, err := p.runCmd(ctx, "mouse", "click", string(button))
|
||||
return err
|
||||
}
|
||||
|
||||
// DoubleClick performs a double-click at the given coordinates.
|
||||
func (p *portableDesktop) DoubleClick(ctx context.Context, x, y int, button MouseButton) error {
|
||||
if _, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(x), strconv.Itoa(y)); err != nil {
|
||||
return err
|
||||
}
|
||||
if _, err := p.runCmd(ctx, "mouse", "click", string(button)); err != nil {
|
||||
return err
|
||||
}
|
||||
_, err := p.runCmd(ctx, "mouse", "click", string(button))
|
||||
return err
|
||||
}
|
||||
|
||||
// ButtonDown presses and holds a mouse button.
|
||||
func (p *portableDesktop) ButtonDown(ctx context.Context, button MouseButton) error {
|
||||
_, err := p.runCmd(ctx, "mouse", "down", string(button))
|
||||
return err
|
||||
}
|
||||
|
||||
// ButtonUp releases a mouse button.
|
||||
func (p *portableDesktop) ButtonUp(ctx context.Context, button MouseButton) error {
|
||||
_, err := p.runCmd(ctx, "mouse", "up", string(button))
|
||||
return err
|
||||
}
|
||||
|
||||
// Scroll scrolls by (dx, dy) clicks at the given coordinates.
|
||||
func (p *portableDesktop) Scroll(ctx context.Context, x, y, dx, dy int) error {
|
||||
if _, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(x), strconv.Itoa(y)); err != nil {
|
||||
return err
|
||||
}
|
||||
_, err := p.runCmd(ctx, "mouse", "scroll", strconv.Itoa(dx), strconv.Itoa(dy))
|
||||
return err
|
||||
}
|
||||
|
||||
// Drag moves from (startX,startY) to (endX,endY) while holding the
|
||||
// left mouse button.
|
||||
func (p *portableDesktop) Drag(ctx context.Context, startX, startY, endX, endY int) error {
|
||||
if _, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(startX), strconv.Itoa(startY)); err != nil {
|
||||
return err
|
||||
}
|
||||
if _, err := p.runCmd(ctx, "mouse", "down", string(MouseButtonLeft)); err != nil {
|
||||
return err
|
||||
}
|
||||
if _, err := p.runCmd(ctx, "mouse", "move", strconv.Itoa(endX), strconv.Itoa(endY)); err != nil {
|
||||
return err
|
||||
}
|
||||
_, err := p.runCmd(ctx, "mouse", "up", string(MouseButtonLeft))
|
||||
return err
|
||||
}
|
||||
|
||||
// KeyPress sends a key-down then key-up for a key combo string.
|
||||
func (p *portableDesktop) KeyPress(ctx context.Context, keys string) error {
|
||||
_, err := p.runCmd(ctx, "keyboard", "key", keys)
|
||||
return err
|
||||
}
|
||||
|
||||
// KeyDown presses and holds a key.
|
||||
func (p *portableDesktop) KeyDown(ctx context.Context, key string) error {
|
||||
_, err := p.runCmd(ctx, "keyboard", "down", key)
|
||||
return err
|
||||
}
|
||||
|
||||
// KeyUp releases a key.
|
||||
func (p *portableDesktop) KeyUp(ctx context.Context, key string) error {
|
||||
_, err := p.runCmd(ctx, "keyboard", "up", key)
|
||||
return err
|
||||
}
|
||||
|
||||
// Type types a string of text character-by-character.
|
||||
func (p *portableDesktop) Type(ctx context.Context, text string) error {
|
||||
_, err := p.runCmd(ctx, "keyboard", "type", text)
|
||||
return err
|
||||
}
|
||||
|
||||
// CursorPosition returns the current cursor coordinates.
|
||||
func (p *portableDesktop) CursorPosition(ctx context.Context) (x int, y int, err error) {
|
||||
out, err := p.runCmd(ctx, "cursor", "--json")
|
||||
if err != nil {
|
||||
return 0, 0, err
|
||||
}
|
||||
|
||||
var result cursorOutput
|
||||
if err := json.Unmarshal([]byte(out), &result); err != nil {
|
||||
return 0, 0, xerrors.Errorf("parse cursor output: %w", err)
|
||||
}
|
||||
|
||||
return result.X, result.Y, nil
|
||||
}
|
||||
|
||||
// Close shuts down the desktop session and cleans up resources.
|
||||
func (p *portableDesktop) Close() error {
|
||||
p.mu.Lock()
|
||||
defer p.mu.Unlock()
|
||||
|
||||
p.closed = true
|
||||
if p.session != nil {
|
||||
p.session.cancel()
|
||||
// Xvnc is a child process — killing it cleans up the X
|
||||
// session.
|
||||
_ = p.session.cmd.Process.Kill()
|
||||
_ = p.session.cmd.Wait()
|
||||
p.session = nil
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// runCmd executes a portabledesktop subcommand and returns combined
|
||||
// output. The caller must have previously called ensureBinary.
|
||||
func (p *portableDesktop) runCmd(ctx context.Context, args ...string) (string, error) {
|
||||
start := time.Now()
|
||||
//nolint:gosec // args are constructed by the caller, not user input.
|
||||
cmd := p.execer.CommandContext(ctx, p.binPath, args...)
|
||||
out, err := cmd.CombinedOutput()
|
||||
elapsed := time.Since(start)
|
||||
if err != nil {
|
||||
p.logger.Warn(ctx, "portabledesktop command failed",
|
||||
slog.F("args", args),
|
||||
slog.F("elapsed_ms", elapsed.Milliseconds()),
|
||||
slog.Error(err),
|
||||
slog.F("output", string(out)),
|
||||
)
|
||||
return "", xerrors.Errorf("portabledesktop %s: %w: %s", args[0], err, string(out))
|
||||
}
|
||||
if elapsed > 5*time.Second {
|
||||
p.logger.Warn(ctx, "portabledesktop command slow",
|
||||
slog.F("args", args),
|
||||
slog.F("elapsed_ms", elapsed.Milliseconds()),
|
||||
)
|
||||
} else {
|
||||
p.logger.Debug(ctx, "portabledesktop command completed",
|
||||
slog.F("args", args),
|
||||
slog.F("elapsed_ms", elapsed.Milliseconds()),
|
||||
)
|
||||
}
|
||||
return string(out), nil
|
||||
}
|
||||
|
||||
// ensureBinary resolves the portabledesktop binary from PATH or the
|
||||
// coder script bin directory. It must be called while p.mu is held.
|
||||
func (p *portableDesktop) ensureBinary(ctx context.Context) error {
|
||||
if p.binPath != "" {
|
||||
return nil
|
||||
}
|
||||
|
||||
// 1. Check PATH.
|
||||
if path, err := exec.LookPath("portabledesktop"); err == nil {
|
||||
p.logger.Info(ctx, "found portabledesktop in PATH",
|
||||
slog.F("path", path),
|
||||
)
|
||||
p.binPath = path
|
||||
return nil
|
||||
}
|
||||
|
||||
// 2. Check the coder script bin directory.
|
||||
scriptBinPath := filepath.Join(p.scriptBinDir, "portabledesktop")
|
||||
if info, err := os.Stat(scriptBinPath); err == nil && !info.IsDir() {
|
||||
// On Windows, permission bits don't indicate executability,
|
||||
// so accept any regular file.
|
||||
if runtime.GOOS == "windows" || info.Mode()&0o111 != 0 {
|
||||
p.logger.Info(ctx, "found portabledesktop in script bin directory",
|
||||
slog.F("path", scriptBinPath),
|
||||
)
|
||||
p.binPath = scriptBinPath
|
||||
return nil
|
||||
}
|
||||
p.logger.Warn(ctx, "portabledesktop found in script bin directory but not executable",
|
||||
slog.F("path", scriptBinPath),
|
||||
slog.F("mode", info.Mode().String()),
|
||||
)
|
||||
}
|
||||
|
||||
return xerrors.New("portabledesktop binary not found in PATH or script bin directory")
|
||||
}
|
||||
@@ -1,545 +0,0 @@
|
||||
package agentdesktop
|
||||
|
||||
import (
|
||||
"context"
|
||||
"os"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
"strings"
|
||||
"sync"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
"cdr.dev/slog/v3/sloggers/slogtest"
|
||||
"github.com/coder/coder/v2/agent/agentexec"
|
||||
"github.com/coder/coder/v2/pty"
|
||||
)
|
||||
|
||||
// recordedExecer implements agentexec.Execer by recording every
|
||||
// invocation and delegating to a real shell command built from a
|
||||
// caller-supplied mapping of subcommand → shell script body.
|
||||
type recordedExecer struct {
|
||||
mu sync.Mutex
|
||||
commands [][]string
|
||||
// scripts maps a subcommand keyword (e.g. "up", "screenshot")
|
||||
// to a shell snippet whose stdout will be the command output.
|
||||
scripts map[string]string
|
||||
}
|
||||
|
||||
func (r *recordedExecer) record(cmd string, args ...string) {
|
||||
r.mu.Lock()
|
||||
defer r.mu.Unlock()
|
||||
r.commands = append(r.commands, append([]string{cmd}, args...))
|
||||
}
|
||||
|
||||
func (r *recordedExecer) allCommands() [][]string {
|
||||
r.mu.Lock()
|
||||
defer r.mu.Unlock()
|
||||
out := make([][]string, len(r.commands))
|
||||
copy(out, r.commands)
|
||||
return out
|
||||
}
|
||||
|
||||
// scriptFor finds the first matching script key present in args.
|
||||
func (r *recordedExecer) scriptFor(args []string) string {
|
||||
for _, a := range args {
|
||||
if s, ok := r.scripts[a]; ok {
|
||||
return s
|
||||
}
|
||||
}
|
||||
// Fallback: succeed silently.
|
||||
return "true"
|
||||
}
|
||||
|
||||
func (r *recordedExecer) CommandContext(ctx context.Context, cmd string, args ...string) *exec.Cmd {
|
||||
r.record(cmd, args...)
|
||||
script := r.scriptFor(args)
|
||||
//nolint:gosec // Test helper — script content is controlled by the test.
|
||||
return exec.CommandContext(ctx, "sh", "-c", script)
|
||||
}
|
||||
|
||||
func (r *recordedExecer) PTYCommandContext(ctx context.Context, cmd string, args ...string) *pty.Cmd {
|
||||
r.record(cmd, args...)
|
||||
return pty.CommandContext(ctx, "sh", "-c", r.scriptFor(args))
|
||||
}
|
||||
|
||||
// --- portableDesktop tests ---
|
||||
|
||||
func TestPortableDesktop_Start_ParsesOutput(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
|
||||
// The "up" script prints the JSON line then sleeps until
|
||||
// the context is canceled (simulating a long-running process).
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"up": `printf '{"vncPort":5901,"geometry":"1920x1080"}\n' && sleep 120`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop", // pre-set so ensureBinary is a no-op
|
||||
}
|
||||
|
||||
ctx := t.Context()
|
||||
cfg, err := pd.Start(ctx)
|
||||
require.NoError(t, err)
|
||||
|
||||
assert.Equal(t, 1920, cfg.Width)
|
||||
assert.Equal(t, 1080, cfg.Height)
|
||||
assert.Equal(t, 5901, cfg.VNCPort)
|
||||
assert.Equal(t, -1, cfg.Display)
|
||||
|
||||
// Clean up the long-running process.
|
||||
require.NoError(t, pd.Close())
|
||||
}
|
||||
|
||||
func TestPortableDesktop_Start_Idempotent(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"up": `printf '{"vncPort":5901,"geometry":"1920x1080"}\n' && sleep 120`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
ctx := t.Context()
|
||||
cfg1, err := pd.Start(ctx)
|
||||
require.NoError(t, err)
|
||||
|
||||
cfg2, err := pd.Start(ctx)
|
||||
require.NoError(t, err)
|
||||
|
||||
assert.Equal(t, cfg1, cfg2, "second Start should return the same config")
|
||||
|
||||
// The execer should have been called exactly once for "up".
|
||||
cmds := rec.allCommands()
|
||||
upCalls := 0
|
||||
for _, c := range cmds {
|
||||
for _, a := range c {
|
||||
if a == "up" {
|
||||
upCalls++
|
||||
}
|
||||
}
|
||||
}
|
||||
assert.Equal(t, 1, upCalls, "expected exactly one 'up' invocation")
|
||||
|
||||
require.NoError(t, pd.Close())
|
||||
}
|
||||
|
||||
func TestPortableDesktop_Screenshot(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"screenshot": `echo '{"data":"abc123"}'`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
ctx := t.Context()
|
||||
result, err := pd.Screenshot(ctx, ScreenshotOptions{})
|
||||
require.NoError(t, err)
|
||||
|
||||
assert.Equal(t, "abc123", result.Data)
|
||||
}
|
||||
|
||||
func TestPortableDesktop_Screenshot_WithTargetDimensions(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"screenshot": `echo '{"data":"x"}'`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
ctx := t.Context()
|
||||
_, err := pd.Screenshot(ctx, ScreenshotOptions{
|
||||
TargetWidth: 800,
|
||||
TargetHeight: 600,
|
||||
})
|
||||
require.NoError(t, err)
|
||||
|
||||
cmds := rec.allCommands()
|
||||
require.NotEmpty(t, cmds)
|
||||
|
||||
// The last command should contain the target dimension flags.
|
||||
last := cmds[len(cmds)-1]
|
||||
joined := strings.Join(last, " ")
|
||||
assert.Contains(t, joined, "--target-width 800")
|
||||
assert.Contains(t, joined, "--target-height 600")
|
||||
}
|
||||
|
||||
func TestPortableDesktop_MouseMethods(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
// Each sub-test verifies a single mouse method dispatches the
|
||||
// correct CLI arguments.
|
||||
tests := []struct {
|
||||
name string
|
||||
invoke func(context.Context, *portableDesktop) error
|
||||
wantArgs []string // substrings expected in a recorded command
|
||||
}{
|
||||
{
|
||||
name: "Move",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.Move(ctx, 42, 99)
|
||||
},
|
||||
wantArgs: []string{"mouse", "move", "42", "99"},
|
||||
},
|
||||
{
|
||||
name: "Click",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.Click(ctx, 10, 20, MouseButtonLeft)
|
||||
},
|
||||
// Click does move then click.
|
||||
wantArgs: []string{"mouse", "click", "left"},
|
||||
},
|
||||
{
|
||||
name: "DoubleClick",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.DoubleClick(ctx, 5, 6, MouseButtonRight)
|
||||
},
|
||||
wantArgs: []string{"mouse", "click", "right"},
|
||||
},
|
||||
{
|
||||
name: "ButtonDown",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.ButtonDown(ctx, MouseButtonMiddle)
|
||||
},
|
||||
wantArgs: []string{"mouse", "down", "middle"},
|
||||
},
|
||||
{
|
||||
name: "ButtonUp",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.ButtonUp(ctx, MouseButtonLeft)
|
||||
},
|
||||
wantArgs: []string{"mouse", "up", "left"},
|
||||
},
|
||||
{
|
||||
name: "Scroll",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.Scroll(ctx, 50, 60, 3, 4)
|
||||
},
|
||||
wantArgs: []string{"mouse", "scroll", "3", "4"},
|
||||
},
|
||||
{
|
||||
name: "Drag",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.Drag(ctx, 10, 20, 30, 40)
|
||||
},
|
||||
// Drag ends with mouse up left.
|
||||
wantArgs: []string{"mouse", "up", "left"},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"mouse": `echo ok`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
err := tt.invoke(t.Context(), pd)
|
||||
require.NoError(t, err)
|
||||
|
||||
cmds := rec.allCommands()
|
||||
require.NotEmpty(t, cmds, "expected at least one command")
|
||||
|
||||
// Find at least one recorded command that contains
|
||||
// all expected argument substrings.
|
||||
found := false
|
||||
for _, cmd := range cmds {
|
||||
joined := strings.Join(cmd, " ")
|
||||
match := true
|
||||
for _, want := range tt.wantArgs {
|
||||
if !strings.Contains(joined, want) {
|
||||
match = false
|
||||
break
|
||||
}
|
||||
}
|
||||
if match {
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
assert.True(t, found,
|
||||
"no recorded command matched %v; got %v", tt.wantArgs, cmds)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestPortableDesktop_KeyboardMethods(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
invoke func(context.Context, *portableDesktop) error
|
||||
wantArgs []string
|
||||
}{
|
||||
{
|
||||
name: "KeyPress",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.KeyPress(ctx, "Return")
|
||||
},
|
||||
wantArgs: []string{"keyboard", "key", "Return"},
|
||||
},
|
||||
{
|
||||
name: "KeyDown",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.KeyDown(ctx, "shift")
|
||||
},
|
||||
wantArgs: []string{"keyboard", "down", "shift"},
|
||||
},
|
||||
{
|
||||
name: "KeyUp",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.KeyUp(ctx, "shift")
|
||||
},
|
||||
wantArgs: []string{"keyboard", "up", "shift"},
|
||||
},
|
||||
{
|
||||
name: "Type",
|
||||
invoke: func(ctx context.Context, pd *portableDesktop) error {
|
||||
return pd.Type(ctx, "hello world")
|
||||
},
|
||||
wantArgs: []string{"keyboard", "type", "hello world"},
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"keyboard": `echo ok`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
err := tt.invoke(t.Context(), pd)
|
||||
require.NoError(t, err)
|
||||
|
||||
cmds := rec.allCommands()
|
||||
require.NotEmpty(t, cmds)
|
||||
|
||||
last := cmds[len(cmds)-1]
|
||||
joined := strings.Join(last, " ")
|
||||
for _, want := range tt.wantArgs {
|
||||
assert.Contains(t, joined, want)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestPortableDesktop_CursorPosition(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"cursor": `echo '{"x":100,"y":200}'`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
x, y, err := pd.CursorPosition(t.Context())
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, 100, x)
|
||||
assert.Equal(t, 200, y)
|
||||
}
|
||||
|
||||
func TestPortableDesktop_Close(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
|
||||
rec := &recordedExecer{
|
||||
scripts: map[string]string{
|
||||
"up": `printf '{"vncPort":5901,"geometry":"1024x768"}\n' && sleep 120`,
|
||||
},
|
||||
}
|
||||
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: rec,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "portabledesktop",
|
||||
}
|
||||
|
||||
ctx := t.Context()
|
||||
_, err := pd.Start(ctx)
|
||||
require.NoError(t, err)
|
||||
|
||||
// Session should exist.
|
||||
pd.mu.Lock()
|
||||
require.NotNil(t, pd.session)
|
||||
pd.mu.Unlock()
|
||||
|
||||
require.NoError(t, pd.Close())
|
||||
|
||||
// Session should be cleaned up.
|
||||
pd.mu.Lock()
|
||||
assert.Nil(t, pd.session)
|
||||
assert.True(t, pd.closed)
|
||||
pd.mu.Unlock()
|
||||
|
||||
// Subsequent Start must fail.
|
||||
_, err = pd.Start(ctx)
|
||||
require.Error(t, err)
|
||||
assert.Contains(t, err.Error(), "desktop is closed")
|
||||
}
|
||||
|
||||
// --- ensureBinary tests ---
|
||||
|
||||
func TestEnsureBinary_UsesCachedBinPath(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
// When binPath is already set, ensureBinary should return
|
||||
// immediately without doing any work.
|
||||
logger := slogtest.Make(t, nil)
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: agentexec.DefaultExecer,
|
||||
scriptBinDir: t.TempDir(),
|
||||
binPath: "/already/set",
|
||||
}
|
||||
|
||||
err := pd.ensureBinary(t.Context())
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "/already/set", pd.binPath)
|
||||
}
|
||||
|
||||
func TestEnsureBinary_UsesScriptBinDir(t *testing.T) {
|
||||
// Cannot use t.Parallel because t.Setenv modifies the process
|
||||
// environment.
|
||||
|
||||
scriptBinDir := t.TempDir()
|
||||
binPath := filepath.Join(scriptBinDir, "portabledesktop")
|
||||
require.NoError(t, os.WriteFile(binPath, []byte("#!/bin/sh\n"), 0o600))
|
||||
require.NoError(t, os.Chmod(binPath, 0o755))
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: agentexec.DefaultExecer,
|
||||
scriptBinDir: scriptBinDir,
|
||||
}
|
||||
|
||||
// Clear PATH so LookPath won't find a real binary.
|
||||
t.Setenv("PATH", "")
|
||||
|
||||
err := pd.ensureBinary(t.Context())
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, binPath, pd.binPath)
|
||||
}
|
||||
|
||||
func TestEnsureBinary_ScriptBinDirNotExecutable(t *testing.T) {
|
||||
if runtime.GOOS == "windows" {
|
||||
t.Skip("Windows does not support Unix permission bits")
|
||||
}
|
||||
// Cannot use t.Parallel because t.Setenv modifies the process
|
||||
// environment.
|
||||
|
||||
scriptBinDir := t.TempDir()
|
||||
binPath := filepath.Join(scriptBinDir, "portabledesktop")
|
||||
// Write without execute permission.
|
||||
require.NoError(t, os.WriteFile(binPath, []byte("#!/bin/sh\n"), 0o600))
|
||||
_ = binPath
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: agentexec.DefaultExecer,
|
||||
scriptBinDir: scriptBinDir,
|
||||
}
|
||||
|
||||
// Clear PATH so LookPath won't find a real binary.
|
||||
t.Setenv("PATH", "")
|
||||
|
||||
err := pd.ensureBinary(t.Context())
|
||||
require.Error(t, err)
|
||||
assert.Contains(t, err.Error(), "not found")
|
||||
}
|
||||
|
||||
func TestEnsureBinary_NotFound(t *testing.T) {
|
||||
// Cannot use t.Parallel because t.Setenv modifies the process
|
||||
// environment.
|
||||
|
||||
logger := slogtest.Make(t, nil)
|
||||
pd := &portableDesktop{
|
||||
logger: logger,
|
||||
execer: agentexec.DefaultExecer,
|
||||
scriptBinDir: t.TempDir(), // empty directory
|
||||
}
|
||||
|
||||
// Clear PATH so LookPath won't find a real binary.
|
||||
t.Setenv("PATH", "")
|
||||
|
||||
err := pd.ensureBinary(t.Context())
|
||||
require.Error(t, err)
|
||||
assert.Contains(t, err.Error(), "not found")
|
||||
}
|
||||
|
||||
// Ensure that portableDesktop satisfies the Desktop interface at
|
||||
// compile time. This uses the unexported type so it lives in the
|
||||
// internal test package.
|
||||
var _ Desktop = (*portableDesktop)(nil)
|
||||
+70
-154
@@ -14,6 +14,7 @@ import (
|
||||
"syscall"
|
||||
|
||||
"github.com/google/uuid"
|
||||
"github.com/spf13/afero"
|
||||
"golang.org/x/xerrors"
|
||||
|
||||
"cdr.dev/slog/v3"
|
||||
@@ -332,18 +333,25 @@ func (api *API) writeFile(ctx context.Context, r *http.Request, path string) (HT
|
||||
return status, err
|
||||
}
|
||||
|
||||
// Check if the target already exists so we can preserve its
|
||||
// permissions on the temp file before rename.
|
||||
var mode *os.FileMode
|
||||
if stat, serr := api.filesystem.Stat(path); serr == nil {
|
||||
if stat.IsDir() {
|
||||
return http.StatusBadRequest, xerrors.Errorf("open %s: is a directory", path)
|
||||
f, err := api.filesystem.Create(path)
|
||||
if err != nil {
|
||||
status := http.StatusInternalServerError
|
||||
switch {
|
||||
case errors.Is(err, os.ErrPermission):
|
||||
status = http.StatusForbidden
|
||||
case errors.Is(err, syscall.EISDIR):
|
||||
status = http.StatusBadRequest
|
||||
}
|
||||
m := stat.Mode()
|
||||
mode = &m
|
||||
return status, err
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
_, err = io.Copy(f, r.Body)
|
||||
if err != nil && !errors.Is(err, io.EOF) && ctx.Err() == nil {
|
||||
api.logger.Error(ctx, "workspace agent write file", slog.Error(err))
|
||||
}
|
||||
|
||||
return api.atomicWrite(ctx, path, mode, r.Body)
|
||||
return 0, nil
|
||||
}
|
||||
|
||||
func (api *API) HandleEditFiles(rw http.ResponseWriter, r *http.Request) {
|
||||
@@ -439,163 +447,84 @@ func (api *API) editFile(ctx context.Context, path string, edits []workspacesdk.
|
||||
content := string(data)
|
||||
|
||||
for _, edit := range edits {
|
||||
var err error
|
||||
content, err = fuzzyReplace(content, edit)
|
||||
if err != nil {
|
||||
return http.StatusBadRequest, xerrors.Errorf("edit %s: %w", path, err)
|
||||
}
|
||||
}
|
||||
|
||||
m := stat.Mode()
|
||||
return api.atomicWrite(ctx, path, &m, strings.NewReader(content))
|
||||
}
|
||||
|
||||
// atomicWrite writes content from r to path via a temp file in the
|
||||
// same directory. If the target exists, its permissions are preserved.
|
||||
// On failure the temp file is cleaned up and the original is
|
||||
// untouched.
|
||||
func (api *API) atomicWrite(ctx context.Context, path string, mode *os.FileMode, r io.Reader) (int, error) {
|
||||
dir := filepath.Dir(path)
|
||||
tmpName := filepath.Join(dir, fmt.Sprintf(".%s.tmp.%s", filepath.Base(path), uuid.New().String()[:8]))
|
||||
|
||||
tmpfile, err := api.filesystem.OpenFile(tmpName, os.O_WRONLY|os.O_CREATE|os.O_EXCL, 0o666)
|
||||
if err != nil {
|
||||
status := http.StatusInternalServerError
|
||||
if errors.Is(err, os.ErrPermission) {
|
||||
status = http.StatusForbidden
|
||||
}
|
||||
return status, err
|
||||
}
|
||||
|
||||
cleanup := func() {
|
||||
if err := api.filesystem.Remove(tmpName); err != nil {
|
||||
api.logger.Warn(ctx, "unable to clean up temp file", slog.Error(err))
|
||||
}
|
||||
}
|
||||
|
||||
_, err = io.Copy(tmpfile, r)
|
||||
if err != nil {
|
||||
_ = tmpfile.Close()
|
||||
cleanup()
|
||||
return http.StatusInternalServerError, xerrors.Errorf("write %s: %w", path, err)
|
||||
}
|
||||
|
||||
// Close before rename to flush buffered data and catch write
|
||||
// errors (e.g. delayed allocation failures).
|
||||
if err := tmpfile.Close(); err != nil {
|
||||
cleanup()
|
||||
return http.StatusInternalServerError, xerrors.Errorf("write %s: %w", path, err)
|
||||
}
|
||||
|
||||
// Set permissions on the temp file before rename so there is
|
||||
// no window where the target has wrong permissions.
|
||||
if mode != nil {
|
||||
if err := api.filesystem.Chmod(tmpName, *mode); err != nil {
|
||||
api.logger.Warn(ctx, "unable to set file permissions",
|
||||
var ok bool
|
||||
content, ok = fuzzyReplace(content, edit.Search, edit.Replace)
|
||||
if !ok {
|
||||
api.logger.Warn(ctx, "edit search string not found, skipping",
|
||||
slog.F("path", path),
|
||||
slog.Error(err),
|
||||
slog.F("search_preview", truncate(edit.Search, 64)),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
if err := api.filesystem.Rename(tmpName, path); err != nil {
|
||||
cleanup()
|
||||
status := http.StatusInternalServerError
|
||||
if errors.Is(err, os.ErrPermission) {
|
||||
status = http.StatusForbidden
|
||||
// Create an adjacent file to ensure it will be on the same device and can be
|
||||
// moved atomically.
|
||||
tmpfile, err := afero.TempFile(api.filesystem, filepath.Dir(path), filepath.Base(path))
|
||||
if err != nil {
|
||||
return http.StatusInternalServerError, err
|
||||
}
|
||||
defer tmpfile.Close()
|
||||
|
||||
if _, err := tmpfile.Write([]byte(content)); err != nil {
|
||||
if rerr := api.filesystem.Remove(tmpfile.Name()); rerr != nil {
|
||||
api.logger.Warn(ctx, "unable to clean up temp file", slog.Error(rerr))
|
||||
}
|
||||
return status, xerrors.Errorf("write %s: %w", path, err)
|
||||
return http.StatusInternalServerError, xerrors.Errorf("edit %s: %w", path, err)
|
||||
}
|
||||
|
||||
err = api.filesystem.Rename(tmpfile.Name(), path)
|
||||
if err != nil {
|
||||
return http.StatusInternalServerError, err
|
||||
}
|
||||
|
||||
return 0, nil
|
||||
}
|
||||
|
||||
// fuzzyReplace attempts to find `search` inside `content` and replace it
|
||||
// with `replace`. It uses a cascading match strategy inspired by
|
||||
// fuzzyReplace attempts to find `search` inside `content` and replace its first
|
||||
// occurrence with `replace`. It uses a cascading match strategy inspired by
|
||||
// openai/codex's apply_patch:
|
||||
//
|
||||
// 1. Exact substring match (byte-for-byte).
|
||||
// 2. Line-by-line match ignoring trailing whitespace on each line.
|
||||
// 3. Line-by-line match ignoring all leading/trailing whitespace
|
||||
// (indentation-tolerant).
|
||||
// 3. Line-by-line match ignoring all leading/trailing whitespace (indentation-tolerant).
|
||||
//
|
||||
// When edit.ReplaceAll is false (the default), the search string must
|
||||
// match exactly one location. If multiple matches are found, an error
|
||||
// is returned asking the caller to include more context or set
|
||||
// replace_all.
|
||||
// When a fuzzy match is found (passes 2 or 3), the replacement is still applied
|
||||
// at the byte offsets of the original content so that surrounding text (including
|
||||
// indentation of untouched lines) is preserved.
|
||||
//
|
||||
// When a fuzzy match is found (passes 2 or 3), the replacement is still
|
||||
// applied at the byte offsets of the original content so that surrounding
|
||||
// text (including indentation of untouched lines) is preserved.
|
||||
func fuzzyReplace(content string, edit workspacesdk.FileEdit) (string, error) {
|
||||
search := edit.Search
|
||||
replace := edit.Replace
|
||||
|
||||
// Pass 1 – exact substring match.
|
||||
// Returns the (possibly modified) content and a bool indicating whether a match
|
||||
// was found.
|
||||
func fuzzyReplace(content, search, replace string) (string, bool) {
|
||||
// Pass 1 – exact substring (replace all occurrences).
|
||||
if strings.Contains(content, search) {
|
||||
if edit.ReplaceAll {
|
||||
return strings.ReplaceAll(content, search, replace), nil
|
||||
}
|
||||
count := strings.Count(content, search)
|
||||
if count > 1 {
|
||||
return "", xerrors.Errorf("search string matches %d occurrences "+
|
||||
"(expected exactly 1). Include more surrounding "+
|
||||
"context to make the match unique, or set "+
|
||||
"replace_all to true", count)
|
||||
}
|
||||
// Exactly one match.
|
||||
return strings.Replace(content, search, replace, 1), nil
|
||||
return strings.ReplaceAll(content, search, replace), true
|
||||
}
|
||||
|
||||
// For line-level fuzzy matching we split both content and search
|
||||
// into lines.
|
||||
// For line-level fuzzy matching we split both content and search into lines.
|
||||
contentLines := strings.SplitAfter(content, "\n")
|
||||
searchLines := strings.SplitAfter(search, "\n")
|
||||
|
||||
// A trailing newline in the search produces an empty final element
|
||||
// from SplitAfter. Drop it so it doesn't interfere with line
|
||||
// matching.
|
||||
// A trailing newline in the search produces an empty final element from
|
||||
// SplitAfter. Drop it so it doesn't interfere with line matching.
|
||||
if len(searchLines) > 0 && searchLines[len(searchLines)-1] == "" {
|
||||
searchLines = searchLines[:len(searchLines)-1]
|
||||
}
|
||||
|
||||
trimRight := func(a, b string) bool {
|
||||
return strings.TrimRight(a, " \t\r\n") == strings.TrimRight(b, " \t\r\n")
|
||||
}
|
||||
trimAll := func(a, b string) bool {
|
||||
return strings.TrimSpace(a) == strings.TrimSpace(b)
|
||||
}
|
||||
|
||||
// Pass 2 – trim trailing whitespace on each line.
|
||||
if start, end, ok := seekLines(contentLines, searchLines, trimRight); ok {
|
||||
if !edit.ReplaceAll {
|
||||
if count := countLineMatches(contentLines, searchLines, trimRight); count > 1 {
|
||||
return "", xerrors.Errorf("search string matches %d occurrences "+
|
||||
"(expected exactly 1). Include more surrounding "+
|
||||
"context to make the match unique, or set "+
|
||||
"replace_all to true", count)
|
||||
}
|
||||
}
|
||||
return spliceLines(contentLines, start, end, replace), nil
|
||||
if start, end, ok := seekLines(contentLines, searchLines, func(a, b string) bool {
|
||||
return strings.TrimRight(a, " \t\r\n") == strings.TrimRight(b, " \t\r\n")
|
||||
}); ok {
|
||||
return spliceLines(contentLines, start, end, replace), true
|
||||
}
|
||||
|
||||
// Pass 3 – trim all leading and trailing whitespace
|
||||
// (indentation-tolerant).
|
||||
if start, end, ok := seekLines(contentLines, searchLines, trimAll); ok {
|
||||
if !edit.ReplaceAll {
|
||||
if count := countLineMatches(contentLines, searchLines, trimAll); count > 1 {
|
||||
return "", xerrors.Errorf("search string matches %d occurrences "+
|
||||
"(expected exactly 1). Include more surrounding "+
|
||||
"context to make the match unique, or set "+
|
||||
"replace_all to true", count)
|
||||
}
|
||||
}
|
||||
return spliceLines(contentLines, start, end, replace), nil
|
||||
// Pass 3 – trim all leading and trailing whitespace (indentation-tolerant).
|
||||
if start, end, ok := seekLines(contentLines, searchLines, func(a, b string) bool {
|
||||
return strings.TrimSpace(a) == strings.TrimSpace(b)
|
||||
}); ok {
|
||||
return spliceLines(contentLines, start, end, replace), true
|
||||
}
|
||||
|
||||
return "", xerrors.New("search string not found in file. Verify the search " +
|
||||
"string matches the file content exactly, including whitespace " +
|
||||
"and indentation")
|
||||
return content, false
|
||||
}
|
||||
|
||||
// seekLines scans contentLines looking for a contiguous subsequence that matches
|
||||
@@ -620,26 +549,6 @@ outer:
|
||||
return 0, 0, false
|
||||
}
|
||||
|
||||
// countLineMatches counts how many non-overlapping contiguous
|
||||
// subsequences of contentLines match searchLines according to eq.
|
||||
func countLineMatches(contentLines, searchLines []string, eq func(a, b string) bool) int {
|
||||
count := 0
|
||||
if len(searchLines) == 0 || len(searchLines) > len(contentLines) {
|
||||
return count
|
||||
}
|
||||
outer:
|
||||
for i := 0; i <= len(contentLines)-len(searchLines); i++ {
|
||||
for j, sLine := range searchLines {
|
||||
if !eq(contentLines[i+j], sLine) {
|
||||
continue outer
|
||||
}
|
||||
}
|
||||
count++
|
||||
i += len(searchLines) - 1 // skip past this match
|
||||
}
|
||||
return count
|
||||
}
|
||||
|
||||
// spliceLines replaces contentLines[start:end] with replacement text, returning
|
||||
// the full content as a single string.
|
||||
func spliceLines(contentLines []string, start, end int, replacement string) string {
|
||||
@@ -653,3 +562,10 @@ func spliceLines(contentLines []string, start, end int, replacement string) stri
|
||||
}
|
||||
return b.String()
|
||||
}
|
||||
|
||||
func truncate(s string, n int) string {
|
||||
if len(s) <= n {
|
||||
return s
|
||||
}
|
||||
return s[:n] + "..."
|
||||
}
|
||||
|
||||
@@ -14,7 +14,6 @@ import (
|
||||
"strings"
|
||||
"syscall"
|
||||
"testing"
|
||||
"testing/iotest"
|
||||
|
||||
"github.com/go-chi/chi/v5"
|
||||
"github.com/google/uuid"
|
||||
@@ -400,83 +399,6 @@ func TestWriteFile(t *testing.T) {
|
||||
}
|
||||
}
|
||||
|
||||
func TestWriteFile_ReportsIOError(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
logger := slogtest.Make(t, &slogtest.Options{IgnoreErrors: true}).Leveled(slog.LevelDebug)
|
||||
fs := afero.NewMemMapFs()
|
||||
api := agentfiles.NewAPI(logger, fs, nil)
|
||||
|
||||
tmpdir := os.TempDir()
|
||||
path := filepath.Join(tmpdir, "write-io-error")
|
||||
err := afero.WriteFile(fs, path, []byte("original"), 0o644)
|
||||
require.NoError(t, err)
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitShort)
|
||||
defer cancel()
|
||||
|
||||
// A reader that always errors simulates a failed body read
|
||||
// (e.g. network interruption). The atomic write should leave
|
||||
// the original file intact.
|
||||
body := iotest.ErrReader(xerrors.New("simulated I/O error"))
|
||||
w := httptest.NewRecorder()
|
||||
r := httptest.NewRequestWithContext(ctx, http.MethodPost,
|
||||
fmt.Sprintf("/write-file?path=%s", path), body)
|
||||
api.Routes().ServeHTTP(w, r)
|
||||
|
||||
require.Equal(t, http.StatusInternalServerError, w.Code)
|
||||
got := &codersdk.Error{}
|
||||
err = json.NewDecoder(w.Body).Decode(got)
|
||||
require.NoError(t, err)
|
||||
require.ErrorContains(t, got, "simulated I/O error")
|
||||
|
||||
// The original file must survive the failed write.
|
||||
data, err := afero.ReadFile(fs, path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, "original", string(data))
|
||||
}
|
||||
|
||||
func TestWriteFile_PreservesPermissions(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
if runtime.GOOS == "windows" {
|
||||
t.Skip("file permissions are not reliably supported on Windows")
|
||||
}
|
||||
|
||||
dir := t.TempDir()
|
||||
logger := slogtest.Make(t, nil).Leveled(slog.LevelDebug)
|
||||
osFs := afero.NewOsFs()
|
||||
api := agentfiles.NewAPI(logger, osFs, nil)
|
||||
|
||||
path := filepath.Join(dir, "script.sh")
|
||||
err := afero.WriteFile(osFs, path, []byte("#!/bin/sh\necho hello\n"), 0o755)
|
||||
require.NoError(t, err)
|
||||
|
||||
info, err := osFs.Stat(path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, os.FileMode(0o755), info.Mode().Perm())
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitShort)
|
||||
defer cancel()
|
||||
|
||||
// Overwrite the file with new content.
|
||||
w := httptest.NewRecorder()
|
||||
r := httptest.NewRequestWithContext(ctx, http.MethodPost,
|
||||
fmt.Sprintf("/write-file?path=%s", path),
|
||||
bytes.NewReader([]byte("#!/bin/sh\necho world\n")))
|
||||
api.Routes().ServeHTTP(w, r)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
data, err := afero.ReadFile(osFs, path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, "#!/bin/sh\necho world\n", string(data))
|
||||
|
||||
info, err = osFs.Stat(path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, os.FileMode(0o755), info.Mode().Perm(),
|
||||
"write_file should preserve the original file's permissions")
|
||||
}
|
||||
|
||||
func TestEditFiles(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
@@ -636,8 +558,6 @@ func TestEditFiles(t *testing.T) {
|
||||
},
|
||||
errCode: http.StatusInternalServerError,
|
||||
errors: []string{"rename failed"},
|
||||
// Original file must survive the failed rename.
|
||||
expected: map[string]string{failRenameFilePath: "foo bar"},
|
||||
},
|
||||
{
|
||||
name: "Edit1",
|
||||
@@ -656,9 +576,7 @@ func TestEditFiles(t *testing.T) {
|
||||
expected: map[string]string{filepath.Join(tmpdir, "edit1"): "bar bar"},
|
||||
},
|
||||
{
|
||||
// When the second edit creates ambiguity (two "bar"
|
||||
// occurrences), it should fail.
|
||||
name: "EditEditAmbiguous",
|
||||
name: "EditEdit", // Edits affect previous edits.
|
||||
contents: map[string]string{filepath.Join(tmpdir, "edit-edit"): "foo bar"},
|
||||
edits: []workspacesdk.FileEdits{
|
||||
{
|
||||
@@ -675,33 +593,7 @@ func TestEditFiles(t *testing.T) {
|
||||
},
|
||||
},
|
||||
},
|
||||
errCode: http.StatusBadRequest,
|
||||
errors: []string{"matches 2 occurrences"},
|
||||
// File should not be modified on error.
|
||||
expected: map[string]string{filepath.Join(tmpdir, "edit-edit"): "foo bar"},
|
||||
},
|
||||
{
|
||||
// With replace_all the cascading edit replaces
|
||||
// both occurrences.
|
||||
name: "EditEditReplaceAll",
|
||||
contents: map[string]string{filepath.Join(tmpdir, "edit-edit-ra"): "foo bar"},
|
||||
edits: []workspacesdk.FileEdits{
|
||||
{
|
||||
Path: filepath.Join(tmpdir, "edit-edit-ra"),
|
||||
Edits: []workspacesdk.FileEdit{
|
||||
{
|
||||
Search: "foo",
|
||||
Replace: "bar",
|
||||
},
|
||||
{
|
||||
Search: "bar",
|
||||
Replace: "qux",
|
||||
ReplaceAll: true,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
expected: map[string]string{filepath.Join(tmpdir, "edit-edit-ra"): "qux qux"},
|
||||
expected: map[string]string{filepath.Join(tmpdir, "edit-edit"): "qux qux"},
|
||||
},
|
||||
{
|
||||
name: "Multiline",
|
||||
@@ -828,7 +720,7 @@ func TestEditFiles(t *testing.T) {
|
||||
expected: map[string]string{filepath.Join(tmpdir, "exact-preferred"): "goodbye world"},
|
||||
},
|
||||
{
|
||||
name: "NoMatchErrors",
|
||||
name: "NoMatchStillSucceeds",
|
||||
contents: map[string]string{filepath.Join(tmpdir, "no-match"): "original content"},
|
||||
edits: []workspacesdk.FileEdits{
|
||||
{
|
||||
@@ -841,46 +733,9 @@ func TestEditFiles(t *testing.T) {
|
||||
},
|
||||
},
|
||||
},
|
||||
errCode: http.StatusBadRequest,
|
||||
errors: []string{"search string not found in file"},
|
||||
// File should remain unchanged.
|
||||
expected: map[string]string{filepath.Join(tmpdir, "no-match"): "original content"},
|
||||
},
|
||||
{
|
||||
name: "AmbiguousExactMatch",
|
||||
contents: map[string]string{filepath.Join(tmpdir, "ambig-exact"): "foo bar foo baz foo"},
|
||||
edits: []workspacesdk.FileEdits{
|
||||
{
|
||||
Path: filepath.Join(tmpdir, "ambig-exact"),
|
||||
Edits: []workspacesdk.FileEdit{
|
||||
{
|
||||
Search: "foo",
|
||||
Replace: "qux",
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
errCode: http.StatusBadRequest,
|
||||
errors: []string{"matches 3 occurrences"},
|
||||
expected: map[string]string{filepath.Join(tmpdir, "ambig-exact"): "foo bar foo baz foo"},
|
||||
},
|
||||
{
|
||||
name: "ReplaceAllExact",
|
||||
contents: map[string]string{filepath.Join(tmpdir, "ra-exact"): "foo bar foo baz foo"},
|
||||
edits: []workspacesdk.FileEdits{
|
||||
{
|
||||
Path: filepath.Join(tmpdir, "ra-exact"),
|
||||
Edits: []workspacesdk.FileEdit{
|
||||
{
|
||||
Search: "foo",
|
||||
Replace: "qux",
|
||||
ReplaceAll: true,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
expected: map[string]string{filepath.Join(tmpdir, "ra-exact"): "qux bar qux baz qux"},
|
||||
},
|
||||
{
|
||||
name: "MixedWhitespaceMultiline",
|
||||
contents: map[string]string{filepath.Join(tmpdir, "mixed-ws"): "func main() {\n\tresult := compute()\n\tfmt.Println(result)\n}"},
|
||||
@@ -987,67 +842,6 @@ func TestEditFiles(t *testing.T) {
|
||||
}
|
||||
}
|
||||
|
||||
func TestEditFiles_PreservesPermissions(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
if runtime.GOOS == "windows" {
|
||||
t.Skip("file permissions are not reliably supported on Windows")
|
||||
}
|
||||
|
||||
dir := t.TempDir()
|
||||
logger := slogtest.Make(t, nil).Leveled(slog.LevelDebug)
|
||||
osFs := afero.NewOsFs()
|
||||
api := agentfiles.NewAPI(logger, osFs, nil)
|
||||
|
||||
path := filepath.Join(dir, "script.sh")
|
||||
err := afero.WriteFile(osFs, path, []byte("#!/bin/sh\necho hello\n"), 0o755)
|
||||
require.NoError(t, err)
|
||||
|
||||
// Sanity-check the initial mode.
|
||||
info, err := osFs.Stat(path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, os.FileMode(0o755), info.Mode().Perm())
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitShort)
|
||||
defer cancel()
|
||||
|
||||
body := workspacesdk.FileEditRequest{
|
||||
Files: []workspacesdk.FileEdits{
|
||||
{
|
||||
Path: path,
|
||||
Edits: []workspacesdk.FileEdit{
|
||||
{
|
||||
Search: "hello",
|
||||
Replace: "world",
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
buf := bytes.NewBuffer(nil)
|
||||
enc := json.NewEncoder(buf)
|
||||
enc.SetEscapeHTML(false)
|
||||
err = enc.Encode(body)
|
||||
require.NoError(t, err)
|
||||
|
||||
w := httptest.NewRecorder()
|
||||
r := httptest.NewRequestWithContext(ctx, http.MethodPost, "/edit-files", buf)
|
||||
api.Routes().ServeHTTP(w, r)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
// Verify content was updated.
|
||||
data, err := afero.ReadFile(osFs, path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, "#!/bin/sh\necho world\n", string(data))
|
||||
|
||||
// Verify permissions are preserved after the
|
||||
// temp-file-and-rename cycle.
|
||||
info, err = osFs.Stat(path)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, os.FileMode(0o755), info.Mode().Perm(),
|
||||
"edit_files should preserve the original file's permissions")
|
||||
}
|
||||
|
||||
func TestHandleWriteFile_ChatHeaders_UpdatesPathStore(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
package agentgit
|
||||
|
||||
import (
|
||||
"slices"
|
||||
"sort"
|
||||
"sync"
|
||||
|
||||
"github.com/google/uuid"
|
||||
@@ -99,7 +99,7 @@ func (ps *PathStore) GetPaths(chatID uuid.UUID) []string {
|
||||
for p := range m {
|
||||
out = append(out, p)
|
||||
}
|
||||
slices.Sort(out)
|
||||
sort.Strings(out)
|
||||
return out
|
||||
}
|
||||
|
||||
|
||||
+4
-89
@@ -1,13 +1,10 @@
|
||||
package agentproc
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net/http"
|
||||
"sort"
|
||||
"time"
|
||||
|
||||
"github.com/go-chi/chi/v5"
|
||||
"github.com/google/uuid"
|
||||
@@ -20,13 +17,6 @@ import (
|
||||
"github.com/coder/coder/v2/codersdk/workspacesdk"
|
||||
)
|
||||
|
||||
const (
|
||||
// maxWaitDuration is the maximum time a blocking
|
||||
// process output request can wait, regardless of
|
||||
// what the client requests.
|
||||
maxWaitDuration = 5 * time.Minute
|
||||
)
|
||||
|
||||
// API exposes process-related operations through the agent.
|
||||
type API struct {
|
||||
logger slog.Logger
|
||||
@@ -35,10 +25,10 @@ type API struct {
|
||||
}
|
||||
|
||||
// NewAPI creates a new process API handler.
|
||||
func NewAPI(logger slog.Logger, execer agentexec.Execer, updateEnv func(current []string) (updated []string, err error), pathStore *agentgit.PathStore, workingDir func() string) *API {
|
||||
func NewAPI(logger slog.Logger, execer agentexec.Execer, updateEnv func(current []string) (updated []string, err error), pathStore *agentgit.PathStore) *API {
|
||||
return &API{
|
||||
logger: logger,
|
||||
manager: newManager(logger, execer, updateEnv, workingDir),
|
||||
manager: newManager(logger, execer, updateEnv),
|
||||
pathStore: pathStore,
|
||||
}
|
||||
}
|
||||
@@ -79,12 +69,7 @@ func (api *API) handleStartProcess(rw http.ResponseWriter, r *http.Request) {
|
||||
return
|
||||
}
|
||||
|
||||
var chatID string
|
||||
if id, _, ok := agentgit.ExtractChatContext(r); ok {
|
||||
chatID = id.String()
|
||||
}
|
||||
|
||||
proc, err := api.manager.start(req, chatID)
|
||||
proc, err := api.manager.start(req)
|
||||
if err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Failed to start process.",
|
||||
@@ -120,28 +105,7 @@ func (api *API) handleStartProcess(rw http.ResponseWriter, r *http.Request) {
|
||||
func (api *API) handleListProcesses(rw http.ResponseWriter, r *http.Request) {
|
||||
ctx := r.Context()
|
||||
|
||||
var chatID string
|
||||
if id, _, ok := agentgit.ExtractChatContext(r); ok {
|
||||
chatID = id.String()
|
||||
}
|
||||
|
||||
infos := api.manager.list(chatID)
|
||||
|
||||
// Sort by running state (running first), then by started_at
|
||||
// descending so the most recent processes appear first.
|
||||
sort.Slice(infos, func(i, j int) bool {
|
||||
if infos[i].Running != infos[j].Running {
|
||||
return infos[i].Running
|
||||
}
|
||||
return infos[i].StartedAt > infos[j].StartedAt
|
||||
})
|
||||
|
||||
// Cap the response to avoid bloating LLM context.
|
||||
const maxListProcesses = 10
|
||||
if len(infos) > maxListProcesses {
|
||||
infos = infos[:maxListProcesses]
|
||||
}
|
||||
|
||||
infos := api.manager.list()
|
||||
httpapi.Write(ctx, rw, http.StatusOK, workspacesdk.ListProcessesResponse{
|
||||
Processes: infos,
|
||||
})
|
||||
@@ -160,44 +124,6 @@ func (api *API) handleProcessOutput(rw http.ResponseWriter, r *http.Request) {
|
||||
return
|
||||
}
|
||||
|
||||
// Enforce chat ID isolation. If the request carries
|
||||
// a chat context, only allow access to processes
|
||||
// belonging to that chat.
|
||||
if chatID, _, ok := agentgit.ExtractChatContext(r); ok {
|
||||
if proc.chatID != "" && proc.chatID != chatID.String() {
|
||||
httpapi.Write(ctx, rw, http.StatusNotFound, codersdk.Response{
|
||||
Message: fmt.Sprintf("Process %q not found.", id),
|
||||
})
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
// Check for blocking mode via query params.
|
||||
waitStr := r.URL.Query().Get("wait")
|
||||
wantWait := waitStr == "true"
|
||||
|
||||
if wantWait {
|
||||
// Extend the write deadline so the HTTP server's
|
||||
// WriteTimeout does not kill the connection while
|
||||
// we block.
|
||||
rc := http.NewResponseController(rw)
|
||||
// Add headroom beyond the wait timeout so there's time to
|
||||
// write the response after the blocking wait completes.
|
||||
if err := rc.SetWriteDeadline(time.Now().Add(maxWaitDuration + 30*time.Second)); err != nil {
|
||||
api.logger.Error(ctx, "extend write deadline for blocking process output",
|
||||
slog.Error(err),
|
||||
)
|
||||
}
|
||||
|
||||
// Cap the wait at maxWaitDuration regardless of
|
||||
// client-supplied timeout.
|
||||
waitCtx, waitCancel := context.WithTimeout(ctx, maxWaitDuration)
|
||||
defer waitCancel()
|
||||
|
||||
_ = proc.waitForOutput(waitCtx)
|
||||
// Fall through to read snapshot below.
|
||||
}
|
||||
|
||||
output, truncated := proc.output()
|
||||
info := proc.info()
|
||||
|
||||
@@ -215,17 +141,6 @@ func (api *API) handleSignalProcess(rw http.ResponseWriter, r *http.Request) {
|
||||
|
||||
id := chi.URLParam(r, "id")
|
||||
|
||||
// Enforce chat ID isolation.
|
||||
if chatID, _, ok := agentgit.ExtractChatContext(r); ok {
|
||||
proc, procOK := api.manager.get(id)
|
||||
if procOK && proc.chatID != "" && proc.chatID != chatID.String() {
|
||||
httpapi.Write(ctx, rw, http.StatusNotFound, codersdk.Response{
|
||||
Message: fmt.Sprintf("Process %q not found.", id),
|
||||
})
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
var req workspacesdk.SignalProcessRequest
|
||||
if err := json.NewDecoder(r.Body).Decode(&req); err != nil {
|
||||
httpapi.Write(ctx, rw, http.StatusBadRequest, codersdk.Response{
|
||||
|
||||
+6
-478
@@ -7,10 +7,8 @@ import (
|
||||
"fmt"
|
||||
"net/http"
|
||||
"net/http/httptest"
|
||||
"os"
|
||||
"runtime"
|
||||
"strings"
|
||||
"sync"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
@@ -29,7 +27,7 @@ import (
|
||||
)
|
||||
|
||||
// postStart sends a POST /start request and returns the recorder.
|
||||
func postStart(t *testing.T, handler http.Handler, req workspacesdk.StartProcessRequest, headers ...http.Header) *httptest.ResponseRecorder {
|
||||
func postStart(t *testing.T, handler http.Handler, req workspacesdk.StartProcessRequest) *httptest.ResponseRecorder {
|
||||
t.Helper()
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
@@ -40,13 +38,6 @@ func postStart(t *testing.T, handler http.Handler, req workspacesdk.StartProcess
|
||||
|
||||
w := httptest.NewRecorder()
|
||||
r := httptest.NewRequestWithContext(ctx, http.MethodPost, "/start", bytes.NewReader(body))
|
||||
for _, h := range headers {
|
||||
for k, vals := range h {
|
||||
for _, v := range vals {
|
||||
r.Header.Add(k, v)
|
||||
}
|
||||
}
|
||||
}
|
||||
handler.ServeHTTP(w, r)
|
||||
return w
|
||||
}
|
||||
@@ -78,22 +69,6 @@ func getOutput(t *testing.T, handler http.Handler, id string) *httptest.Response
|
||||
return w
|
||||
}
|
||||
|
||||
// getOutputWithHeaders sends a GET /{id}/output request with
|
||||
// custom headers and returns the recorder.
|
||||
func getOutputWithHeaders(t *testing.T, handler http.Handler, id string, headers http.Header) *httptest.ResponseRecorder {
|
||||
t.Helper()
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
defer cancel()
|
||||
path := fmt.Sprintf("/%s/output", id)
|
||||
req := httptest.NewRequestWithContext(ctx, http.MethodGet, path, nil)
|
||||
for k, v := range headers {
|
||||
req.Header[k] = v
|
||||
}
|
||||
w := httptest.NewRecorder()
|
||||
handler.ServeHTTP(w, req)
|
||||
return w
|
||||
}
|
||||
|
||||
// postSignal sends a POST /{id}/signal request and returns
|
||||
// the recorder.
|
||||
func postSignal(t *testing.T, handler http.Handler, id string, req workspacesdk.SignalProcessRequest) *httptest.ResponseRecorder {
|
||||
@@ -115,25 +90,18 @@ func postSignal(t *testing.T, handler http.Handler, id string, req workspacesdk.
|
||||
// execer, returning the handler and API.
|
||||
func newTestAPI(t *testing.T) http.Handler {
|
||||
t.Helper()
|
||||
return newTestAPIWithOptions(t, nil, nil)
|
||||
return newTestAPIWithUpdateEnv(t, nil)
|
||||
}
|
||||
|
||||
// newTestAPIWithUpdateEnv creates a new API with an optional
|
||||
// updateEnv hook for testing environment injection.
|
||||
func newTestAPIWithUpdateEnv(t *testing.T, updateEnv func([]string) ([]string, error)) http.Handler {
|
||||
t.Helper()
|
||||
return newTestAPIWithOptions(t, updateEnv, nil)
|
||||
}
|
||||
|
||||
// newTestAPIWithOptions creates a new API with optional
|
||||
// updateEnv and workingDir hooks.
|
||||
func newTestAPIWithOptions(t *testing.T, updateEnv func([]string) ([]string, error), workingDir func() string) http.Handler {
|
||||
t.Helper()
|
||||
|
||||
logger := slogtest.Make(t, &slogtest.Options{
|
||||
IgnoreErrors: true,
|
||||
}).Leveled(slog.LevelDebug)
|
||||
api := agentproc.NewAPI(logger, agentexec.DefaultExecer, updateEnv, nil, workingDir)
|
||||
api := agentproc.NewAPI(logger, agentexec.DefaultExecer, updateEnv, nil)
|
||||
t.Cleanup(func() {
|
||||
_ = api.Close()
|
||||
})
|
||||
@@ -172,10 +140,10 @@ func waitForExit(t *testing.T, handler http.Handler, id string) workspacesdk.Pro
|
||||
|
||||
// startAndGetID is a helper that starts a process and returns
|
||||
// the process ID.
|
||||
func startAndGetID(t *testing.T, handler http.Handler, req workspacesdk.StartProcessRequest, headers ...http.Header) string {
|
||||
func startAndGetID(t *testing.T, handler http.Handler, req workspacesdk.StartProcessRequest) string {
|
||||
t.Helper()
|
||||
|
||||
w := postStart(t, handler, req, headers...)
|
||||
w := postStart(t, handler, req)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.StartProcessResponse
|
||||
@@ -278,100 +246,6 @@ func TestStartProcess(t *testing.T) {
|
||||
require.Contains(t, resp.Output, "marker.txt")
|
||||
})
|
||||
|
||||
t.Run("DefaultWorkDirIsHome", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
// No working directory closure, so the process
|
||||
// should fall back to $HOME. We verify through
|
||||
// the process list API which reports the resolved
|
||||
// working directory using native OS paths,
|
||||
// avoiding shell path format mismatches on
|
||||
// Windows (Git Bash returns POSIX paths).
|
||||
handler := newTestAPI(t)
|
||||
|
||||
homeDir, err := os.UserHomeDir()
|
||||
require.NoError(t, err)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo ok",
|
||||
})
|
||||
|
||||
resp := waitForExit(t, handler, id)
|
||||
require.NotNil(t, resp.ExitCode)
|
||||
require.Equal(t, 0, *resp.ExitCode)
|
||||
|
||||
w := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
var listResp workspacesdk.ListProcessesResponse
|
||||
require.NoError(t, json.NewDecoder(w.Body).Decode(&listResp))
|
||||
var proc *workspacesdk.ProcessInfo
|
||||
for i := range listResp.Processes {
|
||||
if listResp.Processes[i].ID == id {
|
||||
proc = &listResp.Processes[i]
|
||||
break
|
||||
}
|
||||
}
|
||||
require.NotNil(t, proc, "process not found in list")
|
||||
require.Equal(t, homeDir, proc.WorkDir)
|
||||
})
|
||||
|
||||
t.Run("DefaultWorkDirFromClosure", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
// The closure provides a valid directory, so the
|
||||
// process should start there. Use the marker file
|
||||
// pattern to avoid path format mismatches on
|
||||
// Windows.
|
||||
tmpDir := t.TempDir()
|
||||
handler := newTestAPIWithOptions(t, nil, func() string {
|
||||
return tmpDir
|
||||
})
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "touch marker.txt && ls marker.txt",
|
||||
})
|
||||
|
||||
resp := waitForExit(t, handler, id)
|
||||
require.NotNil(t, resp.ExitCode)
|
||||
require.Equal(t, 0, *resp.ExitCode)
|
||||
require.Contains(t, resp.Output, "marker.txt")
|
||||
})
|
||||
|
||||
t.Run("DefaultWorkDirClosureNonExistentFallsBackToHome", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
// The closure returns a path that doesn't exist,
|
||||
// so the process should fall back to $HOME.
|
||||
handler := newTestAPIWithOptions(t, nil, func() string {
|
||||
return "/tmp/nonexistent-dir-" + fmt.Sprintf("%d", time.Now().UnixNano())
|
||||
})
|
||||
|
||||
homeDir, err := os.UserHomeDir()
|
||||
require.NoError(t, err)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo ok",
|
||||
})
|
||||
|
||||
resp := waitForExit(t, handler, id)
|
||||
require.NotNil(t, resp.ExitCode)
|
||||
require.Equal(t, 0, *resp.ExitCode)
|
||||
|
||||
w := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
var listResp workspacesdk.ListProcessesResponse
|
||||
require.NoError(t, json.NewDecoder(w.Body).Decode(&listResp))
|
||||
var proc *workspacesdk.ProcessInfo
|
||||
for i := range listResp.Processes {
|
||||
if listResp.Processes[i].ID == id {
|
||||
proc = &listResp.Processes[i]
|
||||
break
|
||||
}
|
||||
}
|
||||
require.NotNil(t, proc, "process not found in list")
|
||||
require.Equal(t, homeDir, proc.WorkDir)
|
||||
})
|
||||
|
||||
t.Run("CustomEnv", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
@@ -459,180 +333,6 @@ func TestListProcesses(t *testing.T) {
|
||||
require.Empty(t, resp.Processes)
|
||||
})
|
||||
|
||||
t.Run("FilterByChatID", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
chatA := uuid.New().String()
|
||||
chatB := uuid.New().String()
|
||||
headersA := http.Header{workspacesdk.CoderChatIDHeader: {chatA}}
|
||||
headersB := http.Header{workspacesdk.CoderChatIDHeader: {chatB}}
|
||||
|
||||
// Start processes with different chat IDs.
|
||||
id1 := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo chat-a",
|
||||
}, headersA)
|
||||
waitForExit(t, handler, id1)
|
||||
|
||||
id2 := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo chat-b",
|
||||
}, headersB)
|
||||
waitForExit(t, handler, id2)
|
||||
|
||||
id3 := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo chat-a-2",
|
||||
}, headersA)
|
||||
waitForExit(t, handler, id3)
|
||||
|
||||
// List with chat A header should return 2 processes.
|
||||
w := getListWithChatHeader(t, handler, chatA)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ListProcessesResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp.Processes, 2)
|
||||
|
||||
ids := make(map[string]bool)
|
||||
for _, p := range resp.Processes {
|
||||
ids[p.ID] = true
|
||||
}
|
||||
require.True(t, ids[id1])
|
||||
require.True(t, ids[id3])
|
||||
|
||||
// List with chat B header should return 1 process.
|
||||
w2 := getListWithChatHeader(t, handler, chatB)
|
||||
require.Equal(t, http.StatusOK, w2.Code)
|
||||
|
||||
var resp2 workspacesdk.ListProcessesResponse
|
||||
err = json.NewDecoder(w2.Body).Decode(&resp2)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp2.Processes, 1)
|
||||
require.Equal(t, id2, resp2.Processes[0].ID)
|
||||
|
||||
// List without chat header should return all 3.
|
||||
w3 := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w3.Code)
|
||||
|
||||
var resp3 workspacesdk.ListProcessesResponse
|
||||
err = json.NewDecoder(w3.Body).Decode(&resp3)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp3.Processes, 3)
|
||||
})
|
||||
|
||||
t.Run("ChatIDFiltering", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
chatID := uuid.New().String()
|
||||
headers := http.Header{workspacesdk.CoderChatIDHeader: {chatID}}
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo with-chat",
|
||||
}, headers)
|
||||
waitForExit(t, handler, id)
|
||||
|
||||
// Listing with the same chat header should return
|
||||
// the process.
|
||||
w := getListWithChatHeader(t, handler, chatID)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ListProcessesResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp.Processes, 1)
|
||||
require.Equal(t, id, resp.Processes[0].ID)
|
||||
|
||||
// Listing with a different chat header should not
|
||||
// return the process.
|
||||
w2 := getListWithChatHeader(t, handler, uuid.New().String())
|
||||
require.Equal(t, http.StatusOK, w2.Code)
|
||||
|
||||
var resp2 workspacesdk.ListProcessesResponse
|
||||
err = json.NewDecoder(w2.Body).Decode(&resp2)
|
||||
require.NoError(t, err)
|
||||
require.Empty(t, resp2.Processes)
|
||||
|
||||
// Listing without a chat header should return the
|
||||
// process (no filtering).
|
||||
w3 := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w3.Code)
|
||||
|
||||
var resp3 workspacesdk.ListProcessesResponse
|
||||
err = json.NewDecoder(w3.Body).Decode(&resp3)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp3.Processes, 1)
|
||||
})
|
||||
|
||||
t.Run("SortAndLimit", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
// Start 12 short-lived processes so we exceed the
|
||||
// limit of 10.
|
||||
for i := 0; i < 12; i++ {
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: fmt.Sprintf("echo proc-%d", i),
|
||||
})
|
||||
waitForExit(t, handler, id)
|
||||
}
|
||||
|
||||
w := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ListProcessesResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp.Processes, 10, "should be capped at 10")
|
||||
|
||||
// All returned processes are exited, so they should
|
||||
// be sorted by StartedAt descending (newest first).
|
||||
for i := 1; i < len(resp.Processes); i++ {
|
||||
require.GreaterOrEqual(t, resp.Processes[i-1].StartedAt, resp.Processes[i].StartedAt,
|
||||
"processes should be sorted by started_at descending")
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("RunningProcessesSortedFirst", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
// Start an exited process first.
|
||||
exitedID := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo done",
|
||||
})
|
||||
waitForExit(t, handler, exitedID)
|
||||
|
||||
// Start a running process after.
|
||||
runningID := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "sleep 300",
|
||||
Background: true,
|
||||
})
|
||||
|
||||
w := getList(t, handler)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ListProcessesResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, resp.Processes, 2)
|
||||
|
||||
// Running process should come first regardless of
|
||||
// start order.
|
||||
require.Equal(t, runningID, resp.Processes[0].ID)
|
||||
require.True(t, resp.Processes[0].Running)
|
||||
require.Equal(t, exitedID, resp.Processes[1].ID)
|
||||
require.False(t, resp.Processes[1].Running)
|
||||
|
||||
// Clean up.
|
||||
postSignal(t, handler, runningID, workspacesdk.SignalProcessRequest{
|
||||
Signal: "kill",
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("MixedRunningAndExited", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
@@ -681,23 +381,6 @@ func TestListProcesses(t *testing.T) {
|
||||
})
|
||||
}
|
||||
|
||||
// getListWithChatHeader sends a GET /list request with the
|
||||
// Coder-Chat-Id header set and returns the recorder.
|
||||
func getListWithChatHeader(t *testing.T, handler http.Handler, chatID string) *httptest.ResponseRecorder {
|
||||
t.Helper()
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
defer cancel()
|
||||
|
||||
w := httptest.NewRecorder()
|
||||
r := httptest.NewRequestWithContext(ctx, http.MethodGet, "/list", nil)
|
||||
if chatID != "" {
|
||||
r.Header.Set(workspacesdk.CoderChatIDHeader, chatID)
|
||||
}
|
||||
handler.ServeHTTP(w, r)
|
||||
return w
|
||||
}
|
||||
|
||||
func TestProcessOutput(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
@@ -756,161 +439,6 @@ func TestProcessOutput(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
require.Contains(t, resp.Message, "not found")
|
||||
})
|
||||
|
||||
t.Run("ChatIDEnforcement", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
// Start a process with chat-a.
|
||||
chatA := uuid.New()
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo secret",
|
||||
Background: true,
|
||||
}, http.Header{
|
||||
workspacesdk.CoderChatIDHeader: {chatA.String()},
|
||||
})
|
||||
waitForExit(t, handler, id)
|
||||
|
||||
// Chat-b should NOT see this process.
|
||||
chatB := uuid.New()
|
||||
w1 := getOutputWithHeaders(t, handler, id, http.Header{
|
||||
workspacesdk.CoderChatIDHeader: {chatB.String()},
|
||||
})
|
||||
require.Equal(t, http.StatusNotFound, w1.Code)
|
||||
|
||||
// Without any chat ID header, should return 200
|
||||
// (backwards compatible).
|
||||
w2 := getOutput(t, handler, id)
|
||||
require.Equal(t, http.StatusOK, w2.Code)
|
||||
})
|
||||
|
||||
t.Run("WaitForExit", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo hello-wait && sleep 0.1",
|
||||
})
|
||||
|
||||
w := getOutputWithWait(t, handler, id)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ProcessOutputResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.False(t, resp.Running)
|
||||
require.NotNil(t, resp.ExitCode)
|
||||
require.Equal(t, 0, *resp.ExitCode)
|
||||
require.Contains(t, resp.Output, "hello-wait")
|
||||
})
|
||||
|
||||
t.Run("WaitAlreadyExited", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "echo done",
|
||||
})
|
||||
|
||||
waitForExit(t, handler, id)
|
||||
|
||||
w := getOutputWithWait(t, handler, id)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ProcessOutputResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.False(t, resp.Running)
|
||||
require.Contains(t, resp.Output, "done")
|
||||
})
|
||||
|
||||
t.Run("WaitTimeout", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "sleep 300",
|
||||
Background: true,
|
||||
})
|
||||
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.IntervalMedium)
|
||||
defer cancel()
|
||||
|
||||
w := getOutputWithWaitCtx(ctx, t, handler, id)
|
||||
require.Equal(t, http.StatusOK, w.Code)
|
||||
|
||||
var resp workspacesdk.ProcessOutputResponse
|
||||
err := json.NewDecoder(w.Body).Decode(&resp)
|
||||
require.NoError(t, err)
|
||||
require.True(t, resp.Running)
|
||||
|
||||
// Kill and wait for the process so cleanup does
|
||||
// not hang.
|
||||
postSignal(
|
||||
t, handler, id,
|
||||
workspacesdk.SignalProcessRequest{Signal: "kill"},
|
||||
)
|
||||
waitForExit(t, handler, id)
|
||||
})
|
||||
|
||||
t.Run("ConcurrentWaiters", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
handler := newTestAPI(t)
|
||||
|
||||
id := startAndGetID(t, handler, workspacesdk.StartProcessRequest{
|
||||
Command: "sleep 300",
|
||||
Background: true,
|
||||
})
|
||||
|
||||
var (
|
||||
wg sync.WaitGroup
|
||||
resps [2]workspacesdk.ProcessOutputResponse
|
||||
codes [2]int
|
||||
)
|
||||
for i := range 2 {
|
||||
wg.Add(1)
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
w := getOutputWithWait(t, handler, id)
|
||||
codes[i] = w.Code
|
||||
_ = json.NewDecoder(w.Body).Decode(&resps[i])
|
||||
}()
|
||||
}
|
||||
|
||||
// Signal the process to exit so both waiters unblock.
|
||||
postSignal(
|
||||
t, handler, id,
|
||||
workspacesdk.SignalProcessRequest{Signal: "kill"},
|
||||
)
|
||||
|
||||
wg.Wait()
|
||||
|
||||
for i := range 2 {
|
||||
require.Equal(t, http.StatusOK, codes[i], "waiter %d", i)
|
||||
require.False(t, resps[i].Running, "waiter %d", i)
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
func getOutputWithWait(t *testing.T, handler http.Handler, id string) *httptest.ResponseRecorder {
|
||||
t.Helper()
|
||||
ctx, cancel := context.WithTimeout(context.Background(), testutil.WaitLong)
|
||||
defer cancel()
|
||||
return getOutputWithWaitCtx(ctx, t, handler, id)
|
||||
}
|
||||
|
||||
func getOutputWithWaitCtx(ctx context.Context, t *testing.T, handler http.Handler, id string) *httptest.ResponseRecorder {
|
||||
t.Helper()
|
||||
path := fmt.Sprintf("/%s/output?wait=true", id)
|
||||
req := httptest.NewRequestWithContext(ctx, http.MethodGet, path, nil)
|
||||
w := httptest.NewRecorder()
|
||||
handler.ServeHTTP(w, req)
|
||||
return w
|
||||
}
|
||||
|
||||
func TestSignalProcess(t *testing.T) {
|
||||
@@ -1055,7 +583,7 @@ func TestHandleStartProcess_ChatHeaders_EmptyWorkDir_StillNotifies(t *testing.T)
|
||||
logger := slogtest.Make(t, nil).Leveled(slog.LevelDebug)
|
||||
api := agentproc.NewAPI(logger, agentexec.DefaultExecer, func(current []string) ([]string, error) {
|
||||
return current, nil
|
||||
}, pathStore, nil)
|
||||
}, pathStore)
|
||||
defer api.Close()
|
||||
|
||||
routes := api.Routes()
|
||||
|
||||
@@ -39,13 +39,11 @@ const (
|
||||
// how much output is written.
|
||||
type HeadTailBuffer struct {
|
||||
mu sync.Mutex
|
||||
cond *sync.Cond
|
||||
head []byte
|
||||
tail []byte
|
||||
tailPos int
|
||||
tailFull bool
|
||||
headFull bool
|
||||
closed bool
|
||||
totalBytes int
|
||||
maxHead int
|
||||
maxTail int
|
||||
@@ -54,24 +52,20 @@ type HeadTailBuffer struct {
|
||||
// NewHeadTailBuffer creates a new HeadTailBuffer with the
|
||||
// default head and tail sizes.
|
||||
func NewHeadTailBuffer() *HeadTailBuffer {
|
||||
b := &HeadTailBuffer{
|
||||
return &HeadTailBuffer{
|
||||
maxHead: MaxHeadBytes,
|
||||
maxTail: MaxTailBytes,
|
||||
}
|
||||
b.cond = sync.NewCond(&b.mu)
|
||||
return b
|
||||
}
|
||||
|
||||
// NewHeadTailBufferSized creates a HeadTailBuffer with custom
|
||||
// head and tail sizes. This is useful for testing truncation
|
||||
// logic with smaller buffers.
|
||||
func NewHeadTailBufferSized(maxHead, maxTail int) *HeadTailBuffer {
|
||||
b := &HeadTailBuffer{
|
||||
return &HeadTailBuffer{
|
||||
maxHead: maxHead,
|
||||
maxTail: maxTail,
|
||||
}
|
||||
b.cond = sync.NewCond(&b.mu)
|
||||
return b
|
||||
}
|
||||
|
||||
// Write implements io.Writer. It is safe for concurrent use.
|
||||
@@ -302,15 +296,6 @@ func truncateLines(s string) string {
|
||||
return b.String()
|
||||
}
|
||||
|
||||
// Close marks the buffer as closed and wakes any waiters.
|
||||
// This is called when the process exits.
|
||||
func (b *HeadTailBuffer) Close() {
|
||||
b.mu.Lock()
|
||||
defer b.mu.Unlock()
|
||||
b.closed = true
|
||||
b.cond.Broadcast()
|
||||
}
|
||||
|
||||
// Reset clears the buffer, discarding all data.
|
||||
func (b *HeadTailBuffer) Reset() {
|
||||
b.mu.Lock()
|
||||
@@ -320,7 +305,5 @@ func (b *HeadTailBuffer) Reset() {
|
||||
b.tailPos = 0
|
||||
b.tailFull = false
|
||||
b.headFull = false
|
||||
b.closed = false
|
||||
b.totalBytes = 0
|
||||
b.cond.Broadcast()
|
||||
}
|
||||
|
||||
@@ -1,26 +0,0 @@
|
||||
//go:build !windows
|
||||
|
||||
package agentproc
|
||||
|
||||
import (
|
||||
"os"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
// procSysProcAttr returns the SysProcAttr to use when spawning
|
||||
// processes. On Unix, Setpgid creates a new process group so
|
||||
// that signals can be delivered to the entire group (the shell
|
||||
// and all its children).
|
||||
func procSysProcAttr() *syscall.SysProcAttr {
|
||||
return &syscall.SysProcAttr{
|
||||
Setpgid: true,
|
||||
}
|
||||
}
|
||||
|
||||
// signalProcess sends a signal to the process group rooted at p.
|
||||
// Using the negative PID sends the signal to every process in the
|
||||
// group, ensuring child processes (e.g. from shell pipelines) are
|
||||
// also signaled.
|
||||
func signalProcess(p *os.Process, sig syscall.Signal) error {
|
||||
return syscall.Kill(-p.Pid, sig)
|
||||
}
|
||||
@@ -1,20 +0,0 @@
|
||||
package agentproc
|
||||
|
||||
import (
|
||||
"os"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
// procSysProcAttr returns the SysProcAttr to use when spawning
|
||||
// processes. On Windows, process groups are not supported in the
|
||||
// same way as Unix, so this returns an empty struct.
|
||||
func procSysProcAttr() *syscall.SysProcAttr {
|
||||
return &syscall.SysProcAttr{}
|
||||
}
|
||||
|
||||
// signalProcess sends a signal directly to the process. Windows
|
||||
// does not support process group signaling, so we fall back to
|
||||
// sending the signal to the process itself.
|
||||
func signalProcess(p *os.Process, _ syscall.Signal) error {
|
||||
return p.Kill()
|
||||
}
|
||||
+26
-107
@@ -21,10 +21,6 @@ import (
|
||||
var (
|
||||
errProcessNotFound = xerrors.New("process not found")
|
||||
errProcessNotRunning = xerrors.New("process is not running")
|
||||
|
||||
// exitedProcessReapAge is how long an exited process is
|
||||
// kept before being automatically removed from the map.
|
||||
exitedProcessReapAge = 5 * time.Minute
|
||||
)
|
||||
|
||||
// process represents a running or completed process.
|
||||
@@ -34,7 +30,6 @@ type process struct {
|
||||
command string
|
||||
workDir string
|
||||
background bool
|
||||
chatID string
|
||||
cmd *exec.Cmd
|
||||
cancel context.CancelFunc
|
||||
buf *HeadTailBuffer
|
||||
@@ -70,25 +65,23 @@ func (p *process) output() (string, *workspacesdk.ProcessTruncation) {
|
||||
|
||||
// manager tracks processes spawned by the agent.
|
||||
type manager struct {
|
||||
mu sync.Mutex
|
||||
logger slog.Logger
|
||||
execer agentexec.Execer
|
||||
clock quartz.Clock
|
||||
procs map[string]*process
|
||||
closed bool
|
||||
updateEnv func(current []string) (updated []string, err error)
|
||||
workingDir func() string
|
||||
mu sync.Mutex
|
||||
logger slog.Logger
|
||||
execer agentexec.Execer
|
||||
clock quartz.Clock
|
||||
procs map[string]*process
|
||||
closed bool
|
||||
updateEnv func(current []string) (updated []string, err error)
|
||||
}
|
||||
|
||||
// newManager creates a new process manager.
|
||||
func newManager(logger slog.Logger, execer agentexec.Execer, updateEnv func(current []string) (updated []string, err error), workingDir func() string) *manager {
|
||||
func newManager(logger slog.Logger, execer agentexec.Execer, updateEnv func(current []string) (updated []string, err error)) *manager {
|
||||
return &manager{
|
||||
logger: logger,
|
||||
execer: execer,
|
||||
clock: quartz.NewReal(),
|
||||
procs: make(map[string]*process),
|
||||
updateEnv: updateEnv,
|
||||
workingDir: workingDir,
|
||||
logger: logger,
|
||||
execer: execer,
|
||||
clock: quartz.NewReal(),
|
||||
procs: make(map[string]*process),
|
||||
updateEnv: updateEnv,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -96,7 +89,7 @@ func newManager(logger slog.Logger, execer agentexec.Execer, updateEnv func(curr
|
||||
// processes use a long-lived context so the process survives
|
||||
// the HTTP request lifecycle. The background flag only affects
|
||||
// client-side polling behavior.
|
||||
func (m *manager) start(req workspacesdk.StartProcessRequest, chatID string) (*process, error) {
|
||||
func (m *manager) start(req workspacesdk.StartProcessRequest) (*process, error) {
|
||||
m.mu.Lock()
|
||||
if m.closed {
|
||||
m.mu.Unlock()
|
||||
@@ -111,9 +104,10 @@ func (m *manager) start(req workspacesdk.StartProcessRequest, chatID string) (*p
|
||||
// the process is not tied to any HTTP request.
|
||||
ctx, cancel := context.WithCancel(context.Background())
|
||||
cmd := m.execer.CommandContext(ctx, "sh", "-c", req.Command)
|
||||
cmd.Dir = m.resolveWorkDir(req.WorkDir)
|
||||
if req.WorkDir != "" {
|
||||
cmd.Dir = req.WorkDir
|
||||
}
|
||||
cmd.Stdin = nil
|
||||
cmd.SysProcAttr = procSysProcAttr()
|
||||
|
||||
// WaitDelay ensures cmd.Wait returns promptly after
|
||||
// the process is killed, even if child processes are
|
||||
@@ -158,9 +152,8 @@ func (m *manager) start(req workspacesdk.StartProcessRequest, chatID string) (*p
|
||||
proc := &process{
|
||||
id: id,
|
||||
command: req.Command,
|
||||
workDir: cmd.Dir,
|
||||
workDir: req.WorkDir,
|
||||
background: req.Background,
|
||||
chatID: chatID,
|
||||
cmd: cmd,
|
||||
cancel: cancel,
|
||||
buf: buf,
|
||||
@@ -208,9 +201,6 @@ func (m *manager) start(req workspacesdk.StartProcessRequest, chatID string) (*p
|
||||
proc.exitCode = &code
|
||||
proc.mu.Unlock()
|
||||
|
||||
// Wake any waiters blocked on new output or
|
||||
// process exit before closing the done channel.
|
||||
proc.buf.Close()
|
||||
close(proc.done)
|
||||
}()
|
||||
|
||||
@@ -225,32 +215,14 @@ func (m *manager) get(id string) (*process, bool) {
|
||||
return proc, ok
|
||||
}
|
||||
|
||||
// list returns info about all tracked processes. Exited
|
||||
// processes older than exitedProcessReapAge are removed.
|
||||
// If chatID is non-empty, only processes belonging to that
|
||||
// chat are returned.
|
||||
func (m *manager) list(chatID string) []workspacesdk.ProcessInfo {
|
||||
// list returns info about all tracked processes.
|
||||
func (m *manager) list() []workspacesdk.ProcessInfo {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
|
||||
now := m.clock.Now()
|
||||
infos := make([]workspacesdk.ProcessInfo, 0, len(m.procs))
|
||||
for id, proc := range m.procs {
|
||||
info := proc.info()
|
||||
// Reap processes that exited more than 5 minutes ago
|
||||
// to prevent unbounded map growth.
|
||||
if !info.Running && info.ExitedAt != nil {
|
||||
exitedAt := time.Unix(*info.ExitedAt, 0)
|
||||
if now.Sub(exitedAt) > exitedProcessReapAge {
|
||||
delete(m.procs, id)
|
||||
continue
|
||||
}
|
||||
}
|
||||
// Filter by chatID if provided.
|
||||
if chatID != "" && proc.chatID != chatID {
|
||||
continue
|
||||
}
|
||||
infos = append(infos, info)
|
||||
for _, proc := range m.procs {
|
||||
infos = append(infos, proc.info())
|
||||
}
|
||||
return infos
|
||||
}
|
||||
@@ -276,15 +248,13 @@ func (m *manager) signal(id string, sig string) error {
|
||||
|
||||
switch sig {
|
||||
case "kill":
|
||||
// Use process group kill to ensure child processes
|
||||
// (e.g. from shell pipelines) are also killed.
|
||||
if err := signalProcess(proc.cmd.Process, syscall.SIGKILL); err != nil {
|
||||
if err := proc.cmd.Process.Kill(); err != nil {
|
||||
return xerrors.Errorf("kill process: %w", err)
|
||||
}
|
||||
case "terminate":
|
||||
// Use process group signal to ensure child processes
|
||||
// are also terminated.
|
||||
if err := signalProcess(proc.cmd.Process, syscall.SIGTERM); err != nil {
|
||||
//nolint:revive // syscall.SIGTERM is portable enough
|
||||
// for our supported platforms.
|
||||
if err := proc.cmd.Process.Signal(syscall.SIGTERM); err != nil {
|
||||
return xerrors.Errorf("terminate process: %w", err)
|
||||
}
|
||||
default:
|
||||
@@ -322,54 +292,3 @@ func (m *manager) Close() error {
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// waitForOutput blocks until the buffer is closed (process
|
||||
// exited) or the context is canceled. Returns nil when the
|
||||
// buffer closed, ctx.Err() when the context expired.
|
||||
func (p *process) waitForOutput(ctx context.Context) error {
|
||||
p.buf.cond.L.Lock()
|
||||
defer p.buf.cond.L.Unlock()
|
||||
|
||||
nevermind := make(chan struct{})
|
||||
defer close(nevermind)
|
||||
go func() {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
// Acquire the lock before broadcasting to
|
||||
// guarantee the waiter has entered cond.Wait()
|
||||
// (which atomically releases the lock).
|
||||
// Without this, a Broadcast between the loop
|
||||
// predicate check and cond.Wait() is lost.
|
||||
p.buf.cond.L.Lock()
|
||||
defer p.buf.cond.L.Unlock()
|
||||
p.buf.cond.Broadcast()
|
||||
case <-nevermind:
|
||||
}
|
||||
}()
|
||||
|
||||
for ctx.Err() == nil && !p.buf.closed {
|
||||
p.buf.cond.Wait()
|
||||
}
|
||||
return ctx.Err()
|
||||
}
|
||||
|
||||
// resolveWorkDir returns the directory a process should start in.
|
||||
// Priority: explicit request dir > agent configured dir > $HOME.
|
||||
// Falls through when a candidate is empty or does not exist on
|
||||
// disk, matching the behavior of SSH sessions.
|
||||
func (m *manager) resolveWorkDir(requested string) string {
|
||||
if requested != "" {
|
||||
return requested
|
||||
}
|
||||
if m.workingDir != nil {
|
||||
if dir := m.workingDir(); dir != "" {
|
||||
if info, err := os.Stat(dir); err == nil && info.IsDir() {
|
||||
return dir
|
||||
}
|
||||
}
|
||||
}
|
||||
if home, err := os.UserHomeDir(); err == nil {
|
||||
return home
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
@@ -398,11 +398,11 @@ func (r *Runner) run(ctx context.Context, script codersdk.WorkspaceAgentScript,
|
||||
},
|
||||
})
|
||||
if err != nil {
|
||||
logger.Warn(ctx, "reporting script completed", slog.Error(err))
|
||||
logger.Error(ctx, fmt.Sprintf("reporting script completed: %s", err.Error()))
|
||||
}
|
||||
})
|
||||
if err != nil {
|
||||
logger.Warn(ctx, "reporting script completed: track command goroutine", slog.Error(err))
|
||||
logger.Error(ctx, fmt.Sprintf("reporting script completed: track command goroutine: %s", err.Error()))
|
||||
}
|
||||
}()
|
||||
|
||||
|
||||
@@ -30,7 +30,6 @@ func (a *agent) apiHandler() http.Handler {
|
||||
r.Mount("/api/v0", a.filesAPI.Routes())
|
||||
r.Mount("/api/v0/git", a.gitAPI.Routes())
|
||||
r.Mount("/api/v0/processes", a.processAPI.Routes())
|
||||
r.Mount("/api/v0/desktop", a.desktopAPI.Routes())
|
||||
|
||||
if a.devcontainers {
|
||||
r.Mount("/api/v0/containers", a.containerAPI.Routes())
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"context"
|
||||
"net"
|
||||
"path/filepath"
|
||||
"sync"
|
||||
"testing"
|
||||
|
||||
"github.com/google/uuid"
|
||||
@@ -22,6 +23,26 @@ import (
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
)
|
||||
|
||||
// logSink captures structured log entries for testing.
|
||||
type logSink struct {
|
||||
mu sync.Mutex
|
||||
entries []slog.SinkEntry
|
||||
}
|
||||
|
||||
func (s *logSink) LogEntry(_ context.Context, e slog.SinkEntry) {
|
||||
s.mu.Lock()
|
||||
defer s.mu.Unlock()
|
||||
s.entries = append(s.entries, e)
|
||||
}
|
||||
|
||||
func (*logSink) Sync() {}
|
||||
|
||||
func (s *logSink) getEntries() []slog.SinkEntry {
|
||||
s.mu.Lock()
|
||||
defer s.mu.Unlock()
|
||||
return append([]slog.SinkEntry{}, s.entries...)
|
||||
}
|
||||
|
||||
// getField returns the value of a field by name from a slog.Map.
|
||||
func getField(fields slog.Map, name string) interface{} {
|
||||
for _, f := range fields {
|
||||
@@ -55,8 +76,8 @@ func TestBoundaryLogs_EndToEnd(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
t.Cleanup(func() { require.NoError(t, srv.Close()) })
|
||||
|
||||
sink := testutil.NewFakeSink(t)
|
||||
logger := sink.Logger(slog.LevelInfo)
|
||||
sink := &logSink{}
|
||||
logger := slog.Make(sink)
|
||||
workspaceID := uuid.New()
|
||||
templateID := uuid.New()
|
||||
templateVersionID := uuid.New()
|
||||
@@ -97,10 +118,10 @@ func TestBoundaryLogs_EndToEnd(t *testing.T) {
|
||||
sendBoundaryLogsRequest(t, conn, req)
|
||||
|
||||
require.Eventually(t, func() bool {
|
||||
return len(sink.Entries()) >= 1
|
||||
return len(sink.getEntries()) >= 1
|
||||
}, testutil.WaitShort, testutil.IntervalFast)
|
||||
|
||||
entries := sink.Entries()
|
||||
entries := sink.getEntries()
|
||||
require.Len(t, entries, 1)
|
||||
entry := entries[0]
|
||||
require.Equal(t, slog.LevelInfo, entry.Level)
|
||||
@@ -131,10 +152,10 @@ func TestBoundaryLogs_EndToEnd(t *testing.T) {
|
||||
sendBoundaryLogsRequest(t, conn, req2)
|
||||
|
||||
require.Eventually(t, func() bool {
|
||||
return len(sink.Entries()) >= 2
|
||||
return len(sink.getEntries()) >= 2
|
||||
}, testutil.WaitShort, testutil.IntervalFast)
|
||||
|
||||
entries = sink.Entries()
|
||||
entries = sink.getEntries()
|
||||
entry = entries[1]
|
||||
require.Len(t, entries, 2)
|
||||
require.Equal(t, slog.LevelInfo, entry.Level)
|
||||
|
||||
@@ -4,7 +4,7 @@ import (
|
||||
"context"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"slices"
|
||||
"sort"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
@@ -228,6 +228,6 @@ func resultPaths(results []filefinder.Result) []string {
|
||||
for i, r := range results {
|
||||
paths[i] = r.Path
|
||||
}
|
||||
slices.Sort(paths)
|
||||
sort.Strings(paths)
|
||||
return paths
|
||||
}
|
||||
|
||||
+8
-31
@@ -2,7 +2,6 @@ package reaper
|
||||
|
||||
import (
|
||||
"os"
|
||||
"sync"
|
||||
|
||||
"github.com/hashicorp/go-reap"
|
||||
|
||||
@@ -43,42 +42,20 @@ func WithLogger(logger slog.Logger) Option {
|
||||
}
|
||||
}
|
||||
|
||||
// WithReaperStop sets a channel that, when closed, stops the reaper
|
||||
// WithDone sets a channel that, when closed, stops the reaper
|
||||
// goroutine. Callers that invoke ForkReap more than once in the
|
||||
// same process (e.g. tests) should use this to prevent goroutine
|
||||
// accumulation.
|
||||
func WithReaperStop(ch chan struct{}) Option {
|
||||
func WithDone(ch chan struct{}) Option {
|
||||
return func(o *options) {
|
||||
o.ReaperStop = ch
|
||||
}
|
||||
}
|
||||
|
||||
// WithReaperStopped sets a channel that is closed after the
|
||||
// reaper goroutine has fully exited.
|
||||
func WithReaperStopped(ch chan struct{}) Option {
|
||||
return func(o *options) {
|
||||
o.ReaperStopped = ch
|
||||
}
|
||||
}
|
||||
|
||||
// WithReapLock sets a mutex shared between the reaper and Wait4.
|
||||
// The reaper holds the write lock while reaping, and ForkReap
|
||||
// holds the read lock during Wait4, preventing the reaper from
|
||||
// stealing the child's exit status. This is only needed for
|
||||
// tests with instant-exit children where the race window is
|
||||
// large.
|
||||
func WithReapLock(mu *sync.RWMutex) Option {
|
||||
return func(o *options) {
|
||||
o.ReapLock = mu
|
||||
o.Done = ch
|
||||
}
|
||||
}
|
||||
|
||||
type options struct {
|
||||
ExecArgs []string
|
||||
PIDs reap.PidCh
|
||||
CatchSignals []os.Signal
|
||||
Logger slog.Logger
|
||||
ReaperStop chan struct{}
|
||||
ReaperStopped chan struct{}
|
||||
ReapLock *sync.RWMutex
|
||||
ExecArgs []string
|
||||
PIDs reap.PidCh
|
||||
CatchSignals []os.Signal
|
||||
Logger slog.Logger
|
||||
Done chan struct{}
|
||||
}
|
||||
|
||||
+34
-99
@@ -7,7 +7,6 @@ import (
|
||||
"os"
|
||||
"os/exec"
|
||||
"os/signal"
|
||||
"sync"
|
||||
"syscall"
|
||||
"testing"
|
||||
"time"
|
||||
@@ -19,82 +18,35 @@ import (
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
)
|
||||
|
||||
// subprocessEnvKey is set when a test re-execs itself as an
|
||||
// isolated subprocess. Tests that call ForkReap or send signals
|
||||
// to their own process check this to decide whether to run real
|
||||
// test logic or launch the subprocess and wait for it.
|
||||
const subprocessEnvKey = "CODER_REAPER_TEST_SUBPROCESS"
|
||||
// withDone returns an option that stops the reaper goroutine when t
|
||||
// completes, preventing goroutine accumulation across subtests.
|
||||
func withDone(t *testing.T) reaper.Option {
|
||||
t.Helper()
|
||||
done := make(chan struct{})
|
||||
t.Cleanup(func() { close(done) })
|
||||
return reaper.WithDone(done)
|
||||
}
|
||||
|
||||
// runSubprocess re-execs the current test binary in a new process
|
||||
// running only the named test. This isolates ForkReap's
|
||||
// syscall.ForkExec and any process-directed signals (e.g. SIGINT)
|
||||
// from the parent test binary, making these tests safe to run in
|
||||
// CI and alongside other tests.
|
||||
// TestReap checks that's the reaper is successfully reaping
|
||||
// exited processes and passing the PIDs through the shared
|
||||
// channel.
|
||||
//
|
||||
// Returns true inside the subprocess (caller should proceed with
|
||||
// the real test logic). Returns false in the parent after the
|
||||
// subprocess exits successfully (caller should return).
|
||||
func runSubprocess(t *testing.T) bool {
|
||||
t.Helper()
|
||||
|
||||
if os.Getenv(subprocessEnvKey) == "1" {
|
||||
return true
|
||||
}
|
||||
|
||||
ctx := testutil.Context(t, testutil.WaitMedium)
|
||||
|
||||
//nolint:gosec // Test-controlled arguments.
|
||||
cmd := exec.CommandContext(ctx, os.Args[0],
|
||||
"-test.run=^"+t.Name()+"$",
|
||||
"-test.v",
|
||||
)
|
||||
cmd.Env = append(os.Environ(), subprocessEnvKey+"=1")
|
||||
|
||||
out, err := cmd.CombinedOutput()
|
||||
t.Logf("Subprocess output:\n%s", out)
|
||||
require.NoError(t, err, "subprocess failed")
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
// withDone returns options that stop the reaper goroutine when t
|
||||
// completes and wait for it to fully exit, preventing
|
||||
// overlapping reapers across sequential subtests.
|
||||
func withDone(t *testing.T) []reaper.Option {
|
||||
t.Helper()
|
||||
stop := make(chan struct{})
|
||||
stopped := make(chan struct{})
|
||||
t.Cleanup(func() {
|
||||
close(stop)
|
||||
<-stopped
|
||||
})
|
||||
return []reaper.Option{
|
||||
reaper.WithReaperStop(stop),
|
||||
reaper.WithReaperStopped(stopped),
|
||||
}
|
||||
}
|
||||
|
||||
// TestReap checks that the reaper successfully reaps exited
|
||||
// processes and passes their PIDs through the shared channel.
|
||||
//nolint:paralleltest
|
||||
func TestReap(t *testing.T) {
|
||||
t.Parallel()
|
||||
// Don't run the reaper test in CI. It does weird
|
||||
// things like forkexecing which may have unintended
|
||||
// consequences in CI.
|
||||
if testutil.InCI() {
|
||||
t.Skip("Detected CI, skipping reaper tests")
|
||||
}
|
||||
if !runSubprocess(t) {
|
||||
return
|
||||
}
|
||||
|
||||
pids := make(reap.PidCh, 1)
|
||||
var reapLock sync.RWMutex
|
||||
opts := append([]reaper.Option{
|
||||
exitCode, err := reaper.ForkReap(
|
||||
reaper.WithPIDCallback(pids),
|
||||
// Provide some argument that immediately exits.
|
||||
reaper.WithExecArgs("/bin/sh", "-c", "exit 0"),
|
||||
reaper.WithReapLock(&reapLock),
|
||||
}, withDone(t)...)
|
||||
reapLock.RLock()
|
||||
exitCode, err := reaper.ForkReap(opts...)
|
||||
reapLock.RUnlock()
|
||||
withDone(t),
|
||||
)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, 0, exitCode)
|
||||
|
||||
@@ -114,7 +66,7 @@ func TestReap(t *testing.T) {
|
||||
|
||||
expectedPIDs := []int{cmd.Process.Pid, cmd2.Process.Pid}
|
||||
|
||||
for range len(expectedPIDs) {
|
||||
for i := 0; i < len(expectedPIDs); i++ {
|
||||
select {
|
||||
case <-time.After(testutil.WaitShort):
|
||||
t.Fatalf("Timed out waiting for process")
|
||||
@@ -124,15 +76,11 @@ func TestReap(t *testing.T) {
|
||||
}
|
||||
}
|
||||
|
||||
//nolint:tparallel // Subtests must be sequential, each starts its own reaper.
|
||||
//nolint:paralleltest
|
||||
func TestForkReapExitCodes(t *testing.T) {
|
||||
t.Parallel()
|
||||
if testutil.InCI() {
|
||||
t.Skip("Detected CI, skipping reaper tests")
|
||||
}
|
||||
if !runSubprocess(t) {
|
||||
return
|
||||
}
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
@@ -147,35 +95,26 @@ func TestForkReapExitCodes(t *testing.T) {
|
||||
{"SIGTERM", "kill -15 $$", 128 + 15},
|
||||
}
|
||||
|
||||
//nolint:paralleltest // Subtests must be sequential, each starts its own reaper.
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
var reapLock sync.RWMutex
|
||||
opts := append([]reaper.Option{
|
||||
exitCode, err := reaper.ForkReap(
|
||||
reaper.WithExecArgs("/bin/sh", "-c", tt.command),
|
||||
reaper.WithReapLock(&reapLock),
|
||||
}, withDone(t)...)
|
||||
reapLock.RLock()
|
||||
exitCode, err := reaper.ForkReap(opts...)
|
||||
reapLock.RUnlock()
|
||||
withDone(t),
|
||||
)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, tt.expectedCode, exitCode, "exit code mismatch for %q", tt.command)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// TestReapInterrupt verifies that ForkReap forwards caught signals
|
||||
// to the child process. The test sends SIGINT to its own process
|
||||
// and checks that the child receives it. Running in a subprocess
|
||||
// ensures SIGINT cannot kill the parent test binary.
|
||||
//nolint:paralleltest // Signal handling.
|
||||
func TestReapInterrupt(t *testing.T) {
|
||||
t.Parallel()
|
||||
// Don't run the reaper test in CI. It does weird
|
||||
// things like forkexecing which may have unintended
|
||||
// consequences in CI.
|
||||
if testutil.InCI() {
|
||||
t.Skip("Detected CI, skipping reaper tests")
|
||||
}
|
||||
if !runSubprocess(t) {
|
||||
return
|
||||
}
|
||||
|
||||
errC := make(chan error, 1)
|
||||
pids := make(reap.PidCh, 1)
|
||||
@@ -187,28 +126,24 @@ func TestReapInterrupt(t *testing.T) {
|
||||
defer signal.Stop(usrSig)
|
||||
|
||||
go func() {
|
||||
opts := append([]reaper.Option{
|
||||
exitCode, err := reaper.ForkReap(
|
||||
reaper.WithPIDCallback(pids),
|
||||
reaper.WithCatchSignals(os.Interrupt),
|
||||
withDone(t),
|
||||
// Signal propagation does not extend to children of children, so
|
||||
// we create a little bash script to ensure sleep is interrupted.
|
||||
reaper.WithExecArgs("/bin/sh", "-c", fmt.Sprintf(
|
||||
"pid=0; trap 'kill -USR2 %d; kill -TERM $pid' INT; sleep 10 &\npid=$!; kill -USR1 %d; wait",
|
||||
os.Getpid(), os.Getpid(),
|
||||
)),
|
||||
}, withDone(t)...)
|
||||
exitCode, err := reaper.ForkReap(opts...)
|
||||
reaper.WithExecArgs("/bin/sh", "-c", fmt.Sprintf("pid=0; trap 'kill -USR2 %d; kill -TERM $pid' INT; sleep 10 &\npid=$!; kill -USR1 %d; wait", os.Getpid(), os.Getpid())),
|
||||
)
|
||||
// The child exits with 128 + SIGTERM (15) = 143, but the trap catches
|
||||
// SIGINT and sends SIGTERM to the sleep process, so exit code varies.
|
||||
_ = exitCode
|
||||
errC <- err
|
||||
}()
|
||||
|
||||
require.Equal(t, syscall.SIGUSR1, <-usrSig)
|
||||
|
||||
require.Equal(t, <-usrSig, syscall.SIGUSR1)
|
||||
err := syscall.Kill(os.Getpid(), syscall.SIGINT)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, <-usrSig, syscall.SIGUSR2)
|
||||
|
||||
require.Equal(t, syscall.SIGUSR2, <-usrSig)
|
||||
require.NoError(t, <-errC)
|
||||
}
|
||||
|
||||
+14
-24
@@ -19,36 +19,31 @@ func IsInitProcess() bool {
|
||||
return os.Getpid() == 1
|
||||
}
|
||||
|
||||
// startSignalForwarding registers signal handlers synchronously
|
||||
// then forwards caught signals to the child in a background
|
||||
// goroutine. Registering before the goroutine starts ensures no
|
||||
// signal is lost between ForkExec and the handler being ready.
|
||||
func startSignalForwarding(logger slog.Logger, pid int, sigs []os.Signal) {
|
||||
func catchSignals(logger slog.Logger, pid int, sigs []os.Signal) {
|
||||
if len(sigs) == 0 {
|
||||
return
|
||||
}
|
||||
|
||||
sc := make(chan os.Signal, 1)
|
||||
signal.Notify(sc, sigs...)
|
||||
defer signal.Stop(sc)
|
||||
|
||||
logger.Info(context.Background(), "reaper catching signals",
|
||||
slog.F("signals", sigs),
|
||||
slog.F("child_pid", pid),
|
||||
)
|
||||
|
||||
go func() {
|
||||
defer signal.Stop(sc)
|
||||
for s := range sc {
|
||||
sig, ok := s.(syscall.Signal)
|
||||
if ok {
|
||||
logger.Info(context.Background(), "reaper caught signal, killing child process",
|
||||
slog.F("signal", sig.String()),
|
||||
slog.F("child_pid", pid),
|
||||
)
|
||||
_ = syscall.Kill(pid, sig)
|
||||
}
|
||||
for {
|
||||
s := <-sc
|
||||
sig, ok := s.(syscall.Signal)
|
||||
if ok {
|
||||
logger.Info(context.Background(), "reaper caught signal, killing child process",
|
||||
slog.F("signal", sig.String()),
|
||||
slog.F("child_pid", pid),
|
||||
)
|
||||
_ = syscall.Kill(pid, sig)
|
||||
}
|
||||
}()
|
||||
}
|
||||
}
|
||||
|
||||
// ForkReap spawns a goroutine that reaps children. In order to avoid
|
||||
@@ -69,12 +64,7 @@ func ForkReap(opt ...Option) (int, error) {
|
||||
o(opts)
|
||||
}
|
||||
|
||||
go func() {
|
||||
reap.ReapChildren(opts.PIDs, nil, opts.ReaperStop, opts.ReapLock)
|
||||
if opts.ReaperStopped != nil {
|
||||
close(opts.ReaperStopped)
|
||||
}
|
||||
}()
|
||||
go reap.ReapChildren(opts.PIDs, nil, opts.Done, nil)
|
||||
|
||||
pwd, err := os.Getwd()
|
||||
if err != nil {
|
||||
@@ -100,7 +90,7 @@ func ForkReap(opt ...Option) (int, error) {
|
||||
return 1, xerrors.Errorf("fork exec: %w", err)
|
||||
}
|
||||
|
||||
startSignalForwarding(opts.Logger, pid, opts.CatchSignals)
|
||||
go catchSignals(opts.Logger, pid, opts.CatchSignals)
|
||||
|
||||
var wstatus syscall.WaitStatus
|
||||
_, err = syscall.Wait4(pid, &wstatus, 0, nil)
|
||||
|
||||
@@ -24,7 +24,6 @@ import (
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/provisioner/echo"
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
"github.com/coder/quartz"
|
||||
"github.com/coder/serpent"
|
||||
)
|
||||
|
||||
@@ -41,18 +40,6 @@ func New(t testing.TB, args ...string) (*serpent.Invocation, config.Root) {
|
||||
return NewWithCommand(t, cmd, args...)
|
||||
}
|
||||
|
||||
// NewWithClock is like New, but injects the given clock for
|
||||
// tests that are time-dependent.
|
||||
func NewWithClock(t testing.TB, clk quartz.Clock, args ...string) (*serpent.Invocation, config.Root) {
|
||||
var root cli.RootCmd
|
||||
root.SetClock(clk)
|
||||
|
||||
cmd, err := root.Command(root.AGPL())
|
||||
require.NoError(t, err)
|
||||
|
||||
return NewWithCommand(t, cmd, args...)
|
||||
}
|
||||
|
||||
type logWriter struct {
|
||||
prefix string
|
||||
log slog.Logger
|
||||
|
||||
@@ -5,7 +5,7 @@ import (
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
"slices"
|
||||
"sort"
|
||||
"strings"
|
||||
"testing"
|
||||
|
||||
@@ -376,8 +376,8 @@ func Test_sshConfigOptions_addOption(t *testing.T) {
|
||||
return
|
||||
}
|
||||
require.NoError(t, err)
|
||||
slices.Sort(tt.Expect)
|
||||
slices.Sort(o.sshOptions)
|
||||
sort.Strings(tt.Expect)
|
||||
sort.Strings(o.sshOptions)
|
||||
require.Equal(t, tt.Expect, o.sshOptions)
|
||||
})
|
||||
}
|
||||
|
||||
@@ -46,7 +46,6 @@ func (r *RootCmd) Create(opts CreateOptions) *serpent.Command {
|
||||
autoUpdates string
|
||||
copyParametersFrom string
|
||||
useParameterDefaults bool
|
||||
noWait bool
|
||||
// Organization context is only required if more than 1 template
|
||||
// shares the same name across multiple organizations.
|
||||
orgContext = NewOrganizationContext()
|
||||
@@ -373,14 +372,6 @@ func (r *RootCmd) Create(opts CreateOptions) *serpent.Command {
|
||||
|
||||
cliutil.WarnMatchedProvisioners(inv.Stderr, workspace.LatestBuild.MatchedProvisioners, workspace.LatestBuild.Job)
|
||||
|
||||
if noWait {
|
||||
_, _ = fmt.Fprintf(inv.Stdout,
|
||||
"\nThe %s workspace has been created and is building in the background.\n",
|
||||
cliui.Keyword(workspace.Name),
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
err = cliui.WorkspaceBuild(inv.Context(), inv.Stdout, client, workspace.LatestBuild.ID)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("watch build: %w", err)
|
||||
@@ -454,12 +445,6 @@ func (r *RootCmd) Create(opts CreateOptions) *serpent.Command {
|
||||
Description: "Automatically accept parameter defaults when no value is provided.",
|
||||
Value: serpent.BoolOf(&useParameterDefaults),
|
||||
},
|
||||
serpent.Option{
|
||||
Flag: "no-wait",
|
||||
Env: "CODER_CREATE_NO_WAIT",
|
||||
Description: "Return immediately after creating the workspace. The build will run in the background.",
|
||||
Value: serpent.BoolOf(&noWait),
|
||||
},
|
||||
cliui.SkipPromptOption(),
|
||||
)
|
||||
cmd.Options = append(cmd.Options, parameterFlags.cliParameters()...)
|
||||
|
||||
@@ -603,81 +603,6 @@ func TestCreate(t *testing.T) {
|
||||
assert.Nil(t, ws.AutostartSchedule, "expected workspace autostart schedule to be nil")
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("NoWait", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
client := coderdtest.New(t, &coderdtest.Options{IncludeProvisionerDaemon: true})
|
||||
owner := coderdtest.CreateFirstUser(t, client)
|
||||
member, _ := coderdtest.CreateAnotherUser(t, client, owner.OrganizationID)
|
||||
version := coderdtest.CreateTemplateVersion(t, client, owner.OrganizationID, nil)
|
||||
coderdtest.AwaitTemplateVersionJobCompleted(t, client, version.ID)
|
||||
template := coderdtest.CreateTemplate(t, client, owner.OrganizationID, version.ID)
|
||||
|
||||
ctx := testutil.Context(t, testutil.WaitLong)
|
||||
inv, root := clitest.New(t, "create", "my-workspace",
|
||||
"--template", template.Name,
|
||||
"-y",
|
||||
"--no-wait",
|
||||
)
|
||||
clitest.SetupConfig(t, member, root)
|
||||
doneChan := make(chan struct{})
|
||||
pty := ptytest.New(t).Attach(inv)
|
||||
go func() {
|
||||
defer close(doneChan)
|
||||
err := inv.Run()
|
||||
assert.NoError(t, err)
|
||||
}()
|
||||
|
||||
pty.ExpectMatchContext(ctx, "building in the background")
|
||||
_ = testutil.TryReceive(ctx, t, doneChan)
|
||||
|
||||
// Verify workspace was actually created.
|
||||
ws, err := member.WorkspaceByOwnerAndName(ctx, codersdk.Me, "my-workspace", codersdk.WorkspaceOptions{})
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, ws.TemplateName, template.Name)
|
||||
})
|
||||
|
||||
t.Run("NoWaitWithParameterDefaults", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
client := coderdtest.New(t, &coderdtest.Options{IncludeProvisionerDaemon: true})
|
||||
owner := coderdtest.CreateFirstUser(t, client)
|
||||
member, _ := coderdtest.CreateAnotherUser(t, client, owner.OrganizationID)
|
||||
version := coderdtest.CreateTemplateVersion(t, client, owner.OrganizationID, prepareEchoResponses([]*proto.RichParameter{
|
||||
{Name: "region", Type: "string", DefaultValue: "us-east-1"},
|
||||
{Name: "instance_type", Type: "string", DefaultValue: "t3.micro"},
|
||||
}))
|
||||
coderdtest.AwaitTemplateVersionJobCompleted(t, client, version.ID)
|
||||
template := coderdtest.CreateTemplate(t, client, owner.OrganizationID, version.ID)
|
||||
|
||||
ctx := testutil.Context(t, testutil.WaitLong)
|
||||
inv, root := clitest.New(t, "create", "my-workspace",
|
||||
"--template", template.Name,
|
||||
"-y",
|
||||
"--use-parameter-defaults",
|
||||
"--no-wait",
|
||||
)
|
||||
clitest.SetupConfig(t, member, root)
|
||||
doneChan := make(chan struct{})
|
||||
pty := ptytest.New(t).Attach(inv)
|
||||
go func() {
|
||||
defer close(doneChan)
|
||||
err := inv.Run()
|
||||
assert.NoError(t, err)
|
||||
}()
|
||||
|
||||
pty.ExpectMatchContext(ctx, "building in the background")
|
||||
_ = testutil.TryReceive(ctx, t, doneChan)
|
||||
|
||||
// Verify workspace was created and parameters were applied.
|
||||
ws, err := member.WorkspaceByOwnerAndName(ctx, codersdk.Me, "my-workspace", codersdk.WorkspaceOptions{})
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, ws.TemplateName, template.Name)
|
||||
|
||||
buildParams, err := member.WorkspaceBuildParameters(ctx, ws.LatestBuild.ID)
|
||||
require.NoError(t, err)
|
||||
assert.Contains(t, buildParams, codersdk.WorkspaceBuildParameter{Name: "region", Value: "us-east-1"})
|
||||
assert.Contains(t, buildParams, codersdk.WorkspaceBuildParameter{Name: "instance_type", Value: "t3.micro"})
|
||||
})
|
||||
}
|
||||
|
||||
func prepareEchoResponses(parameters []*proto.RichParameter, presets ...*proto.Preset) *echo.Responses {
|
||||
|
||||
@@ -1000,12 +1000,6 @@ func mcpFromSDK(sdkTool toolsdk.GenericTool, tb toolsdk.Deps) server.ServerTool
|
||||
Properties: sdkTool.Schema.Properties,
|
||||
Required: sdkTool.Schema.Required,
|
||||
},
|
||||
Annotations: mcp.ToolAnnotation{
|
||||
ReadOnlyHint: mcp.ToBoolPtr(sdkTool.MCPAnnotations.ReadOnlyHint),
|
||||
DestructiveHint: mcp.ToBoolPtr(sdkTool.MCPAnnotations.DestructiveHint),
|
||||
IdempotentHint: mcp.ToBoolPtr(sdkTool.MCPAnnotations.IdempotentHint),
|
||||
OpenWorldHint: mcp.ToBoolPtr(sdkTool.MCPAnnotations.OpenWorldHint),
|
||||
},
|
||||
},
|
||||
Handler: func(ctx context.Context, request mcp.CallToolRequest) (*mcp.CallToolResult, error) {
|
||||
var buf bytes.Buffer
|
||||
|
||||
+1
-16
@@ -81,13 +81,7 @@ func TestExpMcpServer(t *testing.T) {
|
||||
var toolsResponse struct {
|
||||
Result struct {
|
||||
Tools []struct {
|
||||
Name string `json:"name"`
|
||||
Annotations struct {
|
||||
ReadOnlyHint *bool `json:"readOnlyHint"`
|
||||
DestructiveHint *bool `json:"destructiveHint"`
|
||||
IdempotentHint *bool `json:"idempotentHint"`
|
||||
OpenWorldHint *bool `json:"openWorldHint"`
|
||||
} `json:"annotations"`
|
||||
Name string `json:"name"`
|
||||
} `json:"tools"`
|
||||
} `json:"result"`
|
||||
}
|
||||
@@ -100,15 +94,6 @@ func TestExpMcpServer(t *testing.T) {
|
||||
}
|
||||
slices.Sort(foundTools)
|
||||
require.Equal(t, []string{"coder_get_authenticated_user"}, foundTools)
|
||||
annotations := toolsResponse.Result.Tools[0].Annotations
|
||||
require.NotNil(t, annotations.ReadOnlyHint)
|
||||
require.NotNil(t, annotations.DestructiveHint)
|
||||
require.NotNil(t, annotations.IdempotentHint)
|
||||
require.NotNil(t, annotations.OpenWorldHint)
|
||||
assert.True(t, *annotations.ReadOnlyHint)
|
||||
assert.False(t, *annotations.DestructiveHint)
|
||||
assert.True(t, *annotations.IdempotentHint)
|
||||
assert.False(t, *annotations.OpenWorldHint)
|
||||
|
||||
// Call the tool and ensure it works.
|
||||
toolPayload := `{"jsonrpc":"2.0","id":3,"method":"tools/call", "params": {"name": "coder_get_authenticated_user", "arguments": {}}}`
|
||||
|
||||
+45
-74
@@ -1732,18 +1732,19 @@ const (
|
||||
|
||||
func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
var (
|
||||
workspaceCount int64
|
||||
workspaceJobTimeout time.Duration
|
||||
autostartBuildTimeout time.Duration
|
||||
autostartDelay time.Duration
|
||||
template string
|
||||
noCleanup bool
|
||||
workspaceCount int64
|
||||
workspaceJobTimeout time.Duration
|
||||
autostartDelay time.Duration
|
||||
autostartTimeout time.Duration
|
||||
template string
|
||||
noCleanup bool
|
||||
|
||||
parameterFlags workspaceParameterFlags
|
||||
tracingFlags = &scaletestTracingFlags{}
|
||||
timeoutStrategy = &timeoutFlags{}
|
||||
cleanupStrategy = newScaletestCleanupStrategy()
|
||||
output = &scaletestOutputFlags{}
|
||||
prometheusFlags = &scaletestPrometheusFlags{}
|
||||
)
|
||||
|
||||
cmd := &serpent.Command{
|
||||
@@ -1771,7 +1772,7 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
|
||||
outputs, err := output.parse()
|
||||
if err != nil {
|
||||
return xerrors.Errorf("parse output flags: %w", err)
|
||||
return xerrors.Errorf("could not parse --output flags")
|
||||
}
|
||||
|
||||
tpl, err := parseTemplate(ctx, client, me.OrganizationIDs, template)
|
||||
@@ -1802,41 +1803,15 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
}
|
||||
tracer := tracerProvider.Tracer(scaletestTracerName)
|
||||
|
||||
reg := prometheus.NewRegistry()
|
||||
metrics := autostart.NewMetrics(reg)
|
||||
|
||||
setupBarrier := new(sync.WaitGroup)
|
||||
setupBarrier.Add(int(workspaceCount))
|
||||
|
||||
// The workspace-build-updates experiment must be enabled to use
|
||||
// the centralized pubsub channel for coordinating workspace builds.
|
||||
experiments, err := client.Experiments(ctx)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("get experiments: %w", err)
|
||||
}
|
||||
if !experiments.Enabled(codersdk.ExperimentWorkspaceBuildUpdates) {
|
||||
return xerrors.New("the workspace-build-updates experiment must be enabled to run the autostart scaletest")
|
||||
}
|
||||
|
||||
workspaceNames := make([]string, 0, workspaceCount)
|
||||
resultSink := make(chan autostart.RunResult, workspaceCount)
|
||||
th := harness.NewTestHarness(timeoutStrategy.wrapStrategy(harness.ConcurrentExecutionStrategy{}), cleanupStrategy.toStrategy())
|
||||
for i := range workspaceCount {
|
||||
id := strconv.Itoa(int(i))
|
||||
workspaceNames = append(workspaceNames, loadtestutil.GenerateDeterministicWorkspaceName(id))
|
||||
}
|
||||
dispatcher := autostart.NewWorkspaceDispatcher(workspaceNames)
|
||||
|
||||
decoder, err := client.WatchAllWorkspaceBuilds(ctx)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("watch all workspace builds: %w", err)
|
||||
}
|
||||
defer decoder.Close()
|
||||
|
||||
// Start the dispatcher. It will run in a goroutine and automatically
|
||||
// close all workspace channels when the build updates channel closes.
|
||||
dispatcher.Start(ctx, decoder.Chan())
|
||||
|
||||
th := harness.NewTestHarness(timeoutStrategy.wrapStrategy(harness.ConcurrentExecutionStrategy{}), cleanupStrategy.toStrategy())
|
||||
for workspaceName, buildUpdatesChannel := range dispatcher.Channels {
|
||||
id := strings.TrimPrefix(workspaceName, loadtestutil.ScaleTestPrefix+"-")
|
||||
|
||||
config := autostart.Config{
|
||||
User: createusers.Config{
|
||||
OrganizationID: me.OrganizationIDs[0],
|
||||
@@ -1846,16 +1821,13 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
Request: codersdk.CreateWorkspaceRequest{
|
||||
TemplateID: tpl.ID,
|
||||
RichParameterValues: richParameters,
|
||||
// Use deterministic workspace name so we can pre-create the channel.
|
||||
Name: workspaceName,
|
||||
},
|
||||
},
|
||||
WorkspaceJobTimeout: workspaceJobTimeout,
|
||||
AutostartBuildTimeout: autostartBuildTimeout,
|
||||
AutostartDelay: autostartDelay,
|
||||
SetupBarrier: setupBarrier,
|
||||
BuildUpdates: buildUpdatesChannel,
|
||||
ResultSink: resultSink,
|
||||
WorkspaceJobTimeout: workspaceJobTimeout,
|
||||
AutostartDelay: autostartDelay,
|
||||
AutostartTimeout: autostartTimeout,
|
||||
Metrics: metrics,
|
||||
SetupBarrier: setupBarrier,
|
||||
}
|
||||
if err := config.Validate(); err != nil {
|
||||
return xerrors.Errorf("validate config: %w", err)
|
||||
@@ -1877,11 +1849,18 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
th.AddRun(autostartTestName, id, runner)
|
||||
}
|
||||
|
||||
logger := inv.Logger
|
||||
prometheusSrvClose := ServeHandler(ctx, logger, promhttp.HandlerFor(reg, promhttp.HandlerOpts{}), prometheusFlags.Address, "prometheus")
|
||||
defer prometheusSrvClose()
|
||||
|
||||
defer func() {
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "\nUploading traces...")
|
||||
if err := closeTracing(ctx); err != nil {
|
||||
_, _ = fmt.Fprintf(inv.Stderr, "\nError uploading traces: %+v\n", err)
|
||||
}
|
||||
// Wait for prometheus metrics to be scraped
|
||||
_, _ = fmt.Fprintf(inv.Stderr, "Waiting %s for prometheus metrics to be scraped\n", prometheusFlags.Wait)
|
||||
<-time.After(prometheusFlags.Wait)
|
||||
}()
|
||||
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "Running autostart load test...")
|
||||
@@ -1892,40 +1871,31 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
return xerrors.Errorf("run test harness (harness failure, not a test failure): %w", err)
|
||||
}
|
||||
|
||||
// Collect all metrics from the channel.
|
||||
close(resultSink)
|
||||
var runResults []autostart.RunResult
|
||||
for r := range resultSink {
|
||||
runResults = append(runResults, r)
|
||||
// If the command was interrupted, skip stats.
|
||||
if notifyCtx.Err() != nil {
|
||||
return notifyCtx.Err()
|
||||
}
|
||||
|
||||
res := th.Results()
|
||||
if res.TotalFail > 0 {
|
||||
return xerrors.New("load test failed, see above for more details")
|
||||
}
|
||||
|
||||
_, _ = fmt.Fprintf(inv.Stderr, "\nAll %d autostart builds completed successfully (elapsed: %s)\n", res.TotalRuns, time.Duration(res.Elapsed).Round(time.Millisecond))
|
||||
|
||||
if len(runResults) > 0 {
|
||||
results := autostart.NewRunResults(runResults)
|
||||
for _, out := range outputs {
|
||||
if err := out.write(results.ToHarnessResults(), inv.Stdout); err != nil {
|
||||
return xerrors.Errorf("write output: %w", err)
|
||||
}
|
||||
for _, o := range outputs {
|
||||
err = o.write(res, inv.Stdout)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("write output %q to %q: %w", o.format, o.path, err)
|
||||
}
|
||||
}
|
||||
|
||||
if !noCleanup {
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "\nCleaning up...")
|
||||
cleanupCtx, cleanupCancel := cleanupStrategy.toContext(context.Background())
|
||||
cleanupCtx, cleanupCancel := cleanupStrategy.toContext(ctx)
|
||||
defer cleanupCancel()
|
||||
err = th.Cleanup(cleanupCtx)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("cleanup tests: %w", err)
|
||||
}
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "Cleanup complete")
|
||||
} else {
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "\nSkipping cleanup (--no-cleanup specified). Resources left running.")
|
||||
}
|
||||
|
||||
if res.TotalFail > 0 {
|
||||
return xerrors.New("load test failed, see above for more details")
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -1948,13 +1918,6 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
Description: "Timeout for workspace jobs (e.g. build, start).",
|
||||
Value: serpent.DurationOf(&workspaceJobTimeout),
|
||||
},
|
||||
{
|
||||
Flag: "autostart-build-timeout",
|
||||
Env: "CODER_SCALETEST_AUTOSTART_BUILD_TIMEOUT",
|
||||
Default: "15m",
|
||||
Description: "Timeout for the autostart build to complete. Must be longer than workspace-job-timeout to account for queueing time in high-load scenarios.",
|
||||
Value: serpent.DurationOf(&autostartBuildTimeout),
|
||||
},
|
||||
{
|
||||
Flag: "autostart-delay",
|
||||
Env: "CODER_SCALETEST_AUTOSTART_DELAY",
|
||||
@@ -1962,6 +1925,13 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
Description: "How long after all the workspaces have been stopped to schedule them to be started again.",
|
||||
Value: serpent.DurationOf(&autostartDelay),
|
||||
},
|
||||
{
|
||||
Flag: "autostart-timeout",
|
||||
Env: "CODER_SCALETEST_AUTOSTART_TIMEOUT",
|
||||
Default: "5m",
|
||||
Description: "Timeout for the autostart build to be initiated after the scheduled start time.",
|
||||
Value: serpent.DurationOf(&autostartTimeout),
|
||||
},
|
||||
{
|
||||
Flag: "template",
|
||||
FlagShorthand: "t",
|
||||
@@ -1980,9 +1950,10 @@ func (r *RootCmd) scaletestAutostart() *serpent.Command {
|
||||
|
||||
cmd.Options = append(cmd.Options, parameterFlags.cliParameters()...)
|
||||
tracingFlags.attach(&cmd.Options)
|
||||
output.attach(&cmd.Options)
|
||||
timeoutStrategy.attach(&cmd.Options)
|
||||
cleanupStrategy.attach(&cmd.Options)
|
||||
output.attach(&cmd.Options)
|
||||
prometheusFlags.attach(&cmd.Options)
|
||||
return cmd
|
||||
}
|
||||
|
||||
|
||||
+6
-12
@@ -19,18 +19,12 @@ func OverrideVSCodeConfigs(fs afero.Fs) error {
|
||||
return err
|
||||
}
|
||||
mutate := func(m map[string]interface{}) {
|
||||
// These defaults prevent VS Code from overriding
|
||||
// GIT_ASKPASS and using its own GitHub authentication,
|
||||
// which would circumvent cloning with Coder-configured
|
||||
// providers. We only set them if they are not already
|
||||
// present so that template authors can override them
|
||||
// via module settings (e.g. the vscode-web module).
|
||||
if _, ok := m["git.useIntegratedAskPass"]; !ok {
|
||||
m["git.useIntegratedAskPass"] = false
|
||||
}
|
||||
if _, ok := m["github.gitAuthentication"]; !ok {
|
||||
m["github.gitAuthentication"] = false
|
||||
}
|
||||
// This prevents VS Code from overriding GIT_ASKPASS, which
|
||||
// we use to automatically authenticate Git providers.
|
||||
m["git.useIntegratedAskPass"] = false
|
||||
// This prevents VS Code from using it's own GitHub authentication
|
||||
// which would circumvent cloning with Coder-configured providers.
|
||||
m["github.gitAuthentication"] = false
|
||||
}
|
||||
|
||||
for _, configPath := range []string{
|
||||
|
||||
@@ -61,31 +61,4 @@ func TestOverrideVSCodeConfigs(t *testing.T) {
|
||||
require.Equal(t, "something", mapping["hotdogs"])
|
||||
}
|
||||
})
|
||||
t.Run("NoOverwrite", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
fs := afero.NewMemMapFs()
|
||||
mapping := map[string]interface{}{
|
||||
"git.useIntegratedAskPass": true,
|
||||
"github.gitAuthentication": true,
|
||||
"other.setting": "preserved",
|
||||
}
|
||||
data, err := json.Marshal(mapping)
|
||||
require.NoError(t, err)
|
||||
for _, configPath := range configPaths {
|
||||
err = afero.WriteFile(fs, configPath, data, 0o600)
|
||||
require.NoError(t, err)
|
||||
}
|
||||
err = gitauth.OverrideVSCodeConfigs(fs)
|
||||
require.NoError(t, err)
|
||||
for _, configPath := range configPaths {
|
||||
data, err := afero.ReadFile(fs, configPath)
|
||||
require.NoError(t, err)
|
||||
mapping := map[string]interface{}{}
|
||||
err = json.Unmarshal(data, &mapping)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, true, mapping["git.useIntegratedAskPass"])
|
||||
require.Equal(t, true, mapping["github.gitAuthentication"])
|
||||
require.Equal(t, "preserved", mapping["other.setting"])
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
@@ -214,7 +214,7 @@ func (r *RootCmd) createOrganizationRole(orgContext *OrganizationContext) *serpe
|
||||
} else {
|
||||
updated, err = client.CreateOrganizationRole(ctx, customRole)
|
||||
if err != nil {
|
||||
return xerrors.Errorf("create role: %w", err)
|
||||
return xerrors.Errorf("patch role: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
-15
@@ -39,7 +39,6 @@ import (
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/codersdk/agentsdk"
|
||||
"github.com/coder/pretty"
|
||||
"github.com/coder/quartz"
|
||||
"github.com/coder/serpent"
|
||||
)
|
||||
|
||||
@@ -231,10 +230,6 @@ func (r *RootCmd) RunWithSubcommands(subcommands []*serpent.Command) {
|
||||
}
|
||||
|
||||
func (r *RootCmd) Command(subcommands []*serpent.Command) (*serpent.Command, error) {
|
||||
if r.clock == nil {
|
||||
r.clock = quartz.NewReal()
|
||||
}
|
||||
|
||||
fmtLong := `Coder %s — A tool for provisioning self-hosted development environments with Terraform.
|
||||
`
|
||||
hiddenAgentAuth := &AgentAuth{}
|
||||
@@ -553,16 +548,6 @@ type RootCmd struct {
|
||||
useKeyring bool
|
||||
keyringServiceName string
|
||||
useKeyringWithGlobalConfig bool
|
||||
|
||||
// clock is used for time-dependent operations. Initialized to
|
||||
// quartz.NewReal() in Command() if not set via SetClock.
|
||||
clock quartz.Clock
|
||||
}
|
||||
|
||||
// SetClock sets the clock used for time-dependent operations.
|
||||
// Must be called before Command() to take effect.
|
||||
func (r *RootCmd) SetClock(clk quartz.Clock) {
|
||||
r.clock = clk
|
||||
}
|
||||
|
||||
// ensureClientURL loads the client URL from the config file if it
|
||||
|
||||
+2
-4
@@ -24,7 +24,7 @@ import (
|
||||
"os/user"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"slices"
|
||||
"sort"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
@@ -2825,7 +2825,7 @@ func ReadExternalAuthProvidersFromEnv(environ []string) ([]codersdk.ExternalAuth
|
||||
// parsing of `GITAUTH` environment variables.
|
||||
func parseExternalAuthProvidersFromEnv(prefix string, environ []string) ([]codersdk.ExternalAuthConfig, error) {
|
||||
// The index numbers must be in-order.
|
||||
slices.Sort(environ)
|
||||
sort.Strings(environ)
|
||||
|
||||
var providers []codersdk.ExternalAuthConfig
|
||||
for _, v := range serpent.ParseEnviron(environ, prefix) {
|
||||
@@ -2909,8 +2909,6 @@ func parseExternalAuthProvidersFromEnv(prefix string, environ []string) ([]coder
|
||||
provider.MCPToolDenyRegex = v.Value
|
||||
case "PKCE_METHODS":
|
||||
provider.CodeChallengeMethodsSupported = strings.Split(v.Value, " ")
|
||||
case "API_BASE_URL":
|
||||
provider.APIBaseURL = v.Value
|
||||
}
|
||||
providers[providerNum] = provider
|
||||
}
|
||||
|
||||
@@ -188,17 +188,16 @@ func (r *RootCmd) newCreateAdminUserCommand() *serpent.Command {
|
||||
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "Creating user...")
|
||||
newUser, err = tx.InsertUser(ctx, database.InsertUserParams{
|
||||
ID: uuid.New(),
|
||||
Email: newUserEmail,
|
||||
Username: newUserUsername,
|
||||
Name: "Admin User",
|
||||
HashedPassword: []byte(hashedPassword),
|
||||
CreatedAt: dbtime.Now(),
|
||||
UpdatedAt: dbtime.Now(),
|
||||
RBACRoles: []string{rbac.RoleOwner().String()},
|
||||
LoginType: database.LoginTypePassword,
|
||||
Status: "",
|
||||
IsServiceAccount: false,
|
||||
ID: uuid.New(),
|
||||
Email: newUserEmail,
|
||||
Username: newUserUsername,
|
||||
Name: "Admin User",
|
||||
HashedPassword: []byte(hashedPassword),
|
||||
CreatedAt: dbtime.Now(),
|
||||
UpdatedAt: dbtime.Now(),
|
||||
RBACRoles: []string{rbac.RoleOwner().String()},
|
||||
LoginType: database.LoginTypePassword,
|
||||
Status: "",
|
||||
})
|
||||
if err != nil {
|
||||
return xerrors.Errorf("insert user: %w", err)
|
||||
|
||||
@@ -108,29 +108,6 @@ func TestReadExternalAuthProvidersFromEnv(t *testing.T) {
|
||||
})
|
||||
}
|
||||
|
||||
func TestReadExternalAuthProvidersFromEnv_APIBaseURL(t *testing.T) {
|
||||
t.Parallel()
|
||||
providers, err := cli.ReadExternalAuthProvidersFromEnv([]string{
|
||||
"CODER_EXTERNAL_AUTH_0_TYPE=github",
|
||||
"CODER_EXTERNAL_AUTH_0_CLIENT_ID=xxx",
|
||||
"CODER_EXTERNAL_AUTH_0_API_BASE_URL=https://ghes.corp.com/api/v3",
|
||||
})
|
||||
require.NoError(t, err)
|
||||
require.Len(t, providers, 1)
|
||||
assert.Equal(t, "https://ghes.corp.com/api/v3", providers[0].APIBaseURL)
|
||||
}
|
||||
|
||||
func TestReadExternalAuthProvidersFromEnv_APIBaseURLDefault(t *testing.T) {
|
||||
t.Parallel()
|
||||
providers, err := cli.ReadExternalAuthProvidersFromEnv([]string{
|
||||
"CODER_EXTERNAL_AUTH_0_TYPE=github",
|
||||
"CODER_EXTERNAL_AUTH_0_CLIENT_ID=xxx",
|
||||
})
|
||||
require.NoError(t, err)
|
||||
require.Len(t, providers, 1)
|
||||
assert.Equal(t, "", providers[0].APIBaseURL)
|
||||
}
|
||||
|
||||
// TestReadGitAuthProvidersFromEnv ensures that the deprecated `CODER_GITAUTH_`
|
||||
// environment variables are still supported.
|
||||
func TestReadGitAuthProvidersFromEnv(t *testing.T) {
|
||||
|
||||
@@ -21,8 +21,9 @@ type storedCredentials map[string]struct {
|
||||
APIToken string `json:"api_token"`
|
||||
}
|
||||
|
||||
//nolint:paralleltest, tparallel // OS keyring is flaky under concurrent access
|
||||
func TestKeyring(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
if runtime.GOOS != "windows" && runtime.GOOS != "darwin" {
|
||||
t.Skip("linux is not supported yet")
|
||||
}
|
||||
@@ -36,6 +37,8 @@ func TestKeyring(t *testing.T) {
|
||||
)
|
||||
|
||||
t.Run("ReadNonExistent", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -47,6 +50,8 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("DeleteNonExistent", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -58,6 +63,8 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("WriteAndRead", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -84,6 +91,8 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("WriteAndDelete", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -106,6 +115,8 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("OverwriteToken", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -135,6 +146,8 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("MultipleServers", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
backend := sessionstore.NewKeyringWithService(testhelpers.KeyringServiceName(t))
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
@@ -186,6 +199,7 @@ func TestKeyring(t *testing.T) {
|
||||
})
|
||||
|
||||
t.Run("StorageFormat", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
// The storage format must remain consistent to ensure we don't break
|
||||
// compatibility with other Coder related applications that may read
|
||||
// or decode the same credential.
|
||||
|
||||
@@ -25,8 +25,9 @@ func readRawKeychainCredential(t *testing.T, serviceName string) []byte {
|
||||
return winCred.CredentialBlob
|
||||
}
|
||||
|
||||
//nolint:paralleltest, tparallel // OS keyring is flaky under concurrent access
|
||||
func TestWindowsKeyring_WriteReadDelete(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
const testURL = "http://127.0.0.1:1337"
|
||||
srvURL, err := url.Parse(testURL)
|
||||
require.NoError(t, err)
|
||||
|
||||
+16
-8
@@ -180,11 +180,15 @@ func TestSSH(t *testing.T) {
|
||||
|
||||
// Delay until workspace is starting, otherwise the agent may be
|
||||
// booted due to outdated build.
|
||||
require.Eventually(t, func() bool {
|
||||
var err error
|
||||
var err error
|
||||
for {
|
||||
workspace, err = client.Workspace(ctx, workspace.ID)
|
||||
return err == nil && workspace.LatestBuild.Transition == codersdk.WorkspaceTransitionStart
|
||||
}, testutil.WaitShort, testutil.IntervalFast)
|
||||
require.NoError(t, err)
|
||||
if workspace.LatestBuild.Transition == codersdk.WorkspaceTransitionStart {
|
||||
break
|
||||
}
|
||||
time.Sleep(testutil.IntervalFast)
|
||||
}
|
||||
|
||||
// When the agent connects, the workspace was started, and we should
|
||||
// have access to the shell.
|
||||
@@ -759,11 +763,15 @@ func TestSSH(t *testing.T) {
|
||||
|
||||
// Delay until workspace is starting, otherwise the agent may be
|
||||
// booted due to outdated build.
|
||||
require.Eventually(t, func() bool {
|
||||
var err error
|
||||
var err error
|
||||
for {
|
||||
workspace, err = client.Workspace(ctx, workspace.ID)
|
||||
return err == nil && workspace.LatestBuild.Transition == codersdk.WorkspaceTransitionStart
|
||||
}, testutil.WaitShort, testutil.IntervalFast)
|
||||
require.NoError(t, err)
|
||||
if workspace.LatestBuild.Transition == codersdk.WorkspaceTransitionStart {
|
||||
break
|
||||
}
|
||||
time.Sleep(testutil.IntervalFast)
|
||||
}
|
||||
|
||||
// When the agent connects, the workspace was started, and we should
|
||||
// have access to the shell.
|
||||
|
||||
@@ -79,29 +79,6 @@ func (r *RootCmd) start() *serpent.Command {
|
||||
)
|
||||
build = workspace.LatestBuild
|
||||
default:
|
||||
// If the last build was a failed start, run a stop
|
||||
// first to clean up any partially-provisioned
|
||||
// resources.
|
||||
if workspace.LatestBuild.Status == codersdk.WorkspaceStatusFailed &&
|
||||
workspace.LatestBuild.Transition == codersdk.WorkspaceTransitionStart {
|
||||
_, _ = fmt.Fprintf(inv.Stdout, "The last start build failed. Cleaning up before retrying...\n")
|
||||
stopBuild, stopErr := client.CreateWorkspaceBuild(inv.Context(), workspace.ID, codersdk.CreateWorkspaceBuildRequest{
|
||||
Transition: codersdk.WorkspaceTransitionStop,
|
||||
})
|
||||
if stopErr != nil {
|
||||
return xerrors.Errorf("cleanup stop after failed start: %w", stopErr)
|
||||
}
|
||||
stopErr = cliui.WorkspaceBuild(inv.Context(), inv.Stdout, client, stopBuild.ID)
|
||||
if stopErr != nil {
|
||||
return xerrors.Errorf("wait for cleanup stop: %w", stopErr)
|
||||
}
|
||||
// Re-fetch workspace after stop completes so
|
||||
// startWorkspace sees the latest state.
|
||||
workspace, err = namedWorkspace(inv.Context(), client, inv.Args[0])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
build, err = startWorkspace(inv, client, workspace, parameterFlags, bflags, WorkspaceStart)
|
||||
// It's possible for a workspace build to fail due to the template requiring starting
|
||||
// workspaces with the active version.
|
||||
|
||||
@@ -534,55 +534,3 @@ func TestStart_WithReason(t *testing.T) {
|
||||
workspace = coderdtest.MustWorkspace(t, member, workspace.ID)
|
||||
require.Equal(t, codersdk.BuildReasonCLI, workspace.LatestBuild.Reason)
|
||||
}
|
||||
|
||||
func TestStart_FailedStartCleansUp(t *testing.T) {
|
||||
t.Parallel()
|
||||
ctx := testutil.Context(t, testutil.WaitLong)
|
||||
|
||||
store, ps := dbtestutil.NewDB(t)
|
||||
client := coderdtest.New(t, &coderdtest.Options{
|
||||
Database: store,
|
||||
Pubsub: ps,
|
||||
IncludeProvisionerDaemon: true,
|
||||
})
|
||||
owner := coderdtest.CreateFirstUser(t, client)
|
||||
memberClient, member := coderdtest.CreateAnotherUser(t, client, owner.OrganizationID)
|
||||
|
||||
version := coderdtest.CreateTemplateVersion(t, client, owner.OrganizationID, nil)
|
||||
coderdtest.AwaitTemplateVersionJobCompleted(t, client, version.ID)
|
||||
template := coderdtest.CreateTemplate(t, client, owner.OrganizationID, version.ID)
|
||||
workspace := coderdtest.CreateWorkspace(t, memberClient, template.ID)
|
||||
coderdtest.AwaitWorkspaceBuildJobCompleted(t, client, workspace.LatestBuild.ID)
|
||||
|
||||
// Insert a failed start build directly into the database so that
|
||||
// the workspace's latest build is a failed "start" transition.
|
||||
dbfake.WorkspaceBuild(t, store, database.WorkspaceTable{
|
||||
ID: workspace.ID,
|
||||
OwnerID: member.ID,
|
||||
OrganizationID: owner.OrganizationID,
|
||||
TemplateID: template.ID,
|
||||
}).
|
||||
Seed(database.WorkspaceBuild{
|
||||
TemplateVersionID: version.ID,
|
||||
Transition: database.WorkspaceTransitionStart,
|
||||
BuildNumber: workspace.LatestBuild.BuildNumber + 1,
|
||||
}).
|
||||
Failed().
|
||||
Do()
|
||||
|
||||
inv, root := clitest.New(t, "start", workspace.Name)
|
||||
clitest.SetupConfig(t, memberClient, root)
|
||||
pty := ptytest.New(t).Attach(inv)
|
||||
doneChan := make(chan struct{})
|
||||
go func() {
|
||||
defer close(doneChan)
|
||||
err := inv.Run()
|
||||
assert.NoError(t, err)
|
||||
}()
|
||||
|
||||
// The CLI should detect the failed start and clean up first.
|
||||
pty.ExpectMatch("Cleaning up before retrying")
|
||||
pty.ExpectMatch("workspace has been started")
|
||||
|
||||
_ = testutil.TryReceive(ctx, t, doneChan)
|
||||
}
|
||||
|
||||
+17
-26
@@ -113,20 +113,6 @@ func (r *RootCmd) supportBundle() *serpent.Command {
|
||||
)
|
||||
cliLog.Debug(inv.Context(), "invocation", slog.F("args", strings.Join(os.Args, " ")))
|
||||
|
||||
// Bypass rate limiting for support bundle collection since it makes many API calls.
|
||||
// Note: this can only be done by the owner user.
|
||||
if ok, err := support.CanGenerateFull(inv.Context(), client); err == nil && ok {
|
||||
cliLog.Debug(inv.Context(), "running as owner")
|
||||
client.HTTPClient.Transport = &codersdk.HeaderTransport{
|
||||
Transport: client.HTTPClient.Transport,
|
||||
Header: http.Header{codersdk.BypassRatelimitHeader: {"true"}},
|
||||
}
|
||||
} else if !ok {
|
||||
cliLog.Warn(inv.Context(), "not running as owner, not all information available")
|
||||
} else {
|
||||
cliLog.Error(inv.Context(), "failed to look up current user", slog.Error(err))
|
||||
}
|
||||
|
||||
// Check if we're running inside a workspace
|
||||
if val, found := os.LookupEnv("CODER"); found && val == "true" {
|
||||
cliui.Warn(inv.Stderr, "Running inside Coder workspace; this can affect results!")
|
||||
@@ -214,6 +200,12 @@ func (r *RootCmd) supportBundle() *serpent.Command {
|
||||
_, _ = fmt.Fprintln(inv.Stderr, "pprof data collection will take approximately 30 seconds...")
|
||||
}
|
||||
|
||||
// Bypass rate limiting for support bundle collection since it makes many API calls.
|
||||
client.HTTPClient.Transport = &codersdk.HeaderTransport{
|
||||
Transport: client.HTTPClient.Transport,
|
||||
Header: http.Header{codersdk.BypassRatelimitHeader: {"true"}},
|
||||
}
|
||||
|
||||
deps := support.Deps{
|
||||
Client: client,
|
||||
// Support adds a sink so we don't need to supply one ourselves.
|
||||
@@ -362,20 +354,19 @@ func summarizeBundle(inv *serpent.Invocation, bun *support.Bundle) {
|
||||
return
|
||||
}
|
||||
|
||||
var docsURL string
|
||||
if bun.Deployment.Config != nil {
|
||||
docsURL = bun.Deployment.Config.Values.DocsURL.String()
|
||||
} else {
|
||||
cliui.Warn(inv.Stdout, "No deployment configuration available. This may require the Owner role.")
|
||||
if bun.Deployment.Config == nil {
|
||||
cliui.Error(inv.Stdout, "No deployment configuration available!")
|
||||
return
|
||||
}
|
||||
|
||||
if bun.Deployment.HealthReport != nil {
|
||||
deployHealthSummary := bun.Deployment.HealthReport.Summarize(docsURL)
|
||||
if len(deployHealthSummary) > 0 {
|
||||
cliui.Warn(inv.Stdout, "Deployment health issues detected:", deployHealthSummary...)
|
||||
}
|
||||
} else {
|
||||
cliui.Warn(inv.Stdout, "No deployment health report available.")
|
||||
docsURL := bun.Deployment.Config.Values.DocsURL.String()
|
||||
if bun.Deployment.HealthReport == nil {
|
||||
cliui.Error(inv.Stdout, "No deployment health report available!")
|
||||
return
|
||||
}
|
||||
deployHealthSummary := bun.Deployment.HealthReport.Summarize(docsURL)
|
||||
if len(deployHealthSummary) > 0 {
|
||||
cliui.Warn(inv.Stdout, "Deployment health issues detected:", deployHealthSummary...)
|
||||
}
|
||||
|
||||
if bun.Network.Netcheck == nil {
|
||||
|
||||
+22
-47
@@ -28,9 +28,7 @@ import (
|
||||
"github.com/coder/coder/v2/coderd/database/dbauthz"
|
||||
"github.com/coder/coder/v2/coderd/database/dbfake"
|
||||
"github.com/coder/coder/v2/coderd/database/dbtime"
|
||||
"github.com/coder/coder/v2/coderd/healthcheck"
|
||||
"github.com/coder/coder/v2/coderd/healthcheck/derphealth"
|
||||
"github.com/coder/coder/v2/coderd/healthcheck/health"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/codersdk/agentsdk"
|
||||
"github.com/coder/coder/v2/codersdk/healthsdk"
|
||||
@@ -52,21 +50,9 @@ func TestSupportBundle(t *testing.T) {
|
||||
dc.Values.Prometheus.Enable = true
|
||||
secretValue := uuid.NewString()
|
||||
seedSecretDeploymentOptions(t, &dc, secretValue)
|
||||
// Use a mock healthcheck function to avoid flaky DERP health
|
||||
// checks in CI. The DERP checker performs real network operations
|
||||
// (portmapper gateway probing, STUN) that can hang for 60s+ on
|
||||
// macOS CI runners. Since this test validates support bundle
|
||||
// generation, not healthcheck correctness, a canned report is
|
||||
// sufficient.
|
||||
client, closer, api := coderdtest.NewWithAPI(t, &coderdtest.Options{
|
||||
DeploymentValues: dc.Values,
|
||||
HealthcheckFunc: func(_ context.Context, _ string, _ *healthcheck.Progress) *healthsdk.HealthcheckReport {
|
||||
return &healthsdk.HealthcheckReport{
|
||||
Time: time.Now(),
|
||||
Healthy: true,
|
||||
Severity: health.SeverityOK,
|
||||
}
|
||||
},
|
||||
DeploymentValues: dc.Values,
|
||||
HealthcheckTimeout: testutil.WaitSuperLong,
|
||||
})
|
||||
|
||||
t.Cleanup(func() { closer.Close() })
|
||||
@@ -74,7 +60,7 @@ func TestSupportBundle(t *testing.T) {
|
||||
memberClient, member := coderdtest.CreateAnotherUser(t, client, owner.OrganizationID)
|
||||
|
||||
// Set up test fixtures
|
||||
setupCtx := testutil.Context(t, testutil.WaitLong)
|
||||
setupCtx := testutil.Context(t, testutil.WaitSuperLong)
|
||||
workspaceWithAgent := setupSupportBundleTestFixture(setupCtx, t, api.Database, owner.OrganizationID, owner.UserID, func(agents []*proto.Agent) []*proto.Agent {
|
||||
// This should not show up in the bundle output
|
||||
agents[0].Env["SECRET_VALUE"] = secretValue
|
||||
@@ -83,6 +69,22 @@ func TestSupportBundle(t *testing.T) {
|
||||
workspaceWithoutAgent := setupSupportBundleTestFixture(setupCtx, t, api.Database, owner.OrganizationID, owner.UserID, nil)
|
||||
memberWorkspace := setupSupportBundleTestFixture(setupCtx, t, api.Database, owner.OrganizationID, member.ID, nil)
|
||||
|
||||
// Wait for healthcheck to complete successfully before continuing with sub-tests.
|
||||
// The result is cached so subsequent requests will be fast.
|
||||
healthcheckDone := make(chan *healthsdk.HealthcheckReport)
|
||||
go func() {
|
||||
defer close(healthcheckDone)
|
||||
hc, err := healthsdk.New(client).DebugHealth(setupCtx)
|
||||
if err != nil {
|
||||
assert.NoError(t, err, "seed healthcheck cache")
|
||||
return
|
||||
}
|
||||
healthcheckDone <- &hc
|
||||
}()
|
||||
if _, ok := testutil.AssertReceive(setupCtx, t, healthcheckDone); !ok {
|
||||
t.Fatal("healthcheck did not complete in time -- this may be a transient issue")
|
||||
}
|
||||
|
||||
t.Run("WorkspaceWithAgent", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
@@ -130,35 +132,12 @@ func TestSupportBundle(t *testing.T) {
|
||||
assertBundleContents(t, path, true, false, []string{secretValue})
|
||||
})
|
||||
|
||||
t.Run("MemberCanGenerateBundle", func(t *testing.T) {
|
||||
t.Run("NoPrivilege", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
d := t.TempDir()
|
||||
path := filepath.Join(d, "bundle.zip")
|
||||
inv, root := clitest.New(t, "support", "bundle", memberWorkspace.Workspace.Name, "--output-file", path, "--yes")
|
||||
inv, root := clitest.New(t, "support", "bundle", memberWorkspace.Workspace.Name, "--yes")
|
||||
clitest.SetupConfig(t, memberClient, root)
|
||||
err := inv.Run()
|
||||
require.NoError(t, err)
|
||||
r, err := zip.OpenReader(path)
|
||||
require.NoError(t, err, "open zip file")
|
||||
defer r.Close()
|
||||
fileNames := make(map[string]struct{}, len(r.File))
|
||||
for _, f := range r.File {
|
||||
fileNames[f.Name] = struct{}{}
|
||||
}
|
||||
// These should always be present in the zip structure, even if
|
||||
// the content is null/empty for non-admin users.
|
||||
for _, name := range []string{
|
||||
"deployment/buildinfo.json",
|
||||
"deployment/config.json",
|
||||
"workspace/workspace.json",
|
||||
"logs.txt",
|
||||
"cli_logs.txt",
|
||||
"network/netcheck.json",
|
||||
"network/interfaces.json",
|
||||
} {
|
||||
require.Contains(t, fileNames, name)
|
||||
}
|
||||
require.ErrorContains(t, err, "failed authorization check")
|
||||
})
|
||||
|
||||
// This ensures that the CLI does not panic when trying to generate a support bundle
|
||||
@@ -180,10 +159,6 @@ func TestSupportBundle(t *testing.T) {
|
||||
srv := httptest.NewServer(http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
|
||||
t.Logf("received request: %s %s", r.Method, r.URL)
|
||||
switch r.URL.Path {
|
||||
case "/api/v2/users/me":
|
||||
resp := codersdk.User{}
|
||||
w.WriteHeader(http.StatusOK)
|
||||
assert.NoError(t, json.NewEncoder(w).Encode(resp))
|
||||
case "/api/v2/authcheck":
|
||||
// Fake auth check
|
||||
resp := codersdk.AuthorizationResponse{
|
||||
|
||||
+14
-12
@@ -7,6 +7,7 @@ import (
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
@@ -102,13 +103,13 @@ func TestSyncCommands_Golden(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
client.Close()
|
||||
|
||||
outBuf := testutil.NewWaitBuffer()
|
||||
// Start a goroutine to complete the dependency after a short delay
|
||||
// This simulates the dependency being satisfied while start is waiting
|
||||
// The delay ensures the "Waiting..." message appears in the output
|
||||
done := make(chan error, 1)
|
||||
go func() {
|
||||
if err := outBuf.WaitFor(ctx, "Waiting"); err != nil {
|
||||
done <- err
|
||||
return
|
||||
}
|
||||
// Wait a moment to let the start command begin waiting and print the message
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
|
||||
compCtx := context.Background()
|
||||
compClient, err := agentsocket.NewClient(compCtx, agentsocket.WithPath(path))
|
||||
@@ -118,7 +119,7 @@ func TestSyncCommands_Golden(t *testing.T) {
|
||||
}
|
||||
defer compClient.Close()
|
||||
|
||||
// Start and complete the dependency unit.
|
||||
// Start and complete the dependency unit
|
||||
err = compClient.SyncStart(compCtx, "dep-unit")
|
||||
if err != nil {
|
||||
done <- err
|
||||
@@ -128,20 +129,21 @@ func TestSyncCommands_Golden(t *testing.T) {
|
||||
done <- err
|
||||
}()
|
||||
|
||||
var outBuf bytes.Buffer
|
||||
inv, _ := clitest.New(t, "exp", "sync", "start", "test-unit", "--socket-path", path)
|
||||
inv.Stdout = outBuf
|
||||
inv.Stderr = outBuf
|
||||
inv.Stdout = &outBuf
|
||||
inv.Stderr = &outBuf
|
||||
|
||||
// Run the start command - it should wait for the dependency.
|
||||
// Run the start command - it should wait for the dependency
|
||||
err = inv.WithContext(ctx).Run()
|
||||
require.NoError(t, err)
|
||||
|
||||
// Ensure the completion goroutine finished.
|
||||
// Ensure the completion goroutine finished
|
||||
select {
|
||||
case err := <-done:
|
||||
require.NoError(t, err, "complete dependency")
|
||||
case <-ctx.Done():
|
||||
t.Fatal("timed out waiting for dependency completion goroutine")
|
||||
case <-time.After(time.Second):
|
||||
// Goroutine should have finished by now
|
||||
}
|
||||
|
||||
clitest.TestGoldenFile(t, "TestSyncCommands_Golden/start_with_dependencies", outBuf.Bytes(), nil)
|
||||
|
||||
+5
-5
@@ -90,7 +90,7 @@ func (r *RootCmd) taskStatus() *serpent.Command {
|
||||
return err
|
||||
}
|
||||
|
||||
tsr := toStatusRow(task, r.clock.Now())
|
||||
tsr := toStatusRow(task)
|
||||
out, err := formatter.Format(ctx, []taskStatusRow{tsr})
|
||||
if err != nil {
|
||||
return xerrors.Errorf("format task status: %w", err)
|
||||
@@ -112,7 +112,7 @@ func (r *RootCmd) taskStatus() *serpent.Command {
|
||||
}
|
||||
|
||||
// Only print if something changed
|
||||
newStatusRow := toStatusRow(task, r.clock.Now())
|
||||
newStatusRow := toStatusRow(task)
|
||||
if !taskStatusRowEqual(lastStatusRow, newStatusRow) {
|
||||
out, err := formatter.Format(ctx, []taskStatusRow{newStatusRow})
|
||||
if err != nil {
|
||||
@@ -166,10 +166,10 @@ func taskStatusRowEqual(r1, r2 taskStatusRow) bool {
|
||||
taskStateEqual(r1.CurrentState, r2.CurrentState)
|
||||
}
|
||||
|
||||
func toStatusRow(task codersdk.Task, now time.Time) taskStatusRow {
|
||||
func toStatusRow(task codersdk.Task) taskStatusRow {
|
||||
tsr := taskStatusRow{
|
||||
Task: task,
|
||||
ChangedAgo: now.Sub(task.UpdatedAt).Truncate(time.Second).String() + " ago",
|
||||
ChangedAgo: time.Since(task.UpdatedAt).Truncate(time.Second).String() + " ago",
|
||||
}
|
||||
tsr.Healthy = task.WorkspaceAgentHealth != nil &&
|
||||
task.WorkspaceAgentHealth.Healthy &&
|
||||
@@ -178,7 +178,7 @@ func toStatusRow(task codersdk.Task, now time.Time) taskStatusRow {
|
||||
!task.WorkspaceAgentLifecycle.ShuttingDown()
|
||||
|
||||
if task.CurrentState != nil {
|
||||
tsr.ChangedAgo = now.Sub(task.CurrentState.Timestamp).Truncate(time.Second).String() + " ago"
|
||||
tsr.ChangedAgo = time.Since(task.CurrentState.Timestamp).Truncate(time.Second).String() + " ago"
|
||||
}
|
||||
return tsr
|
||||
}
|
||||
|
||||
+9
-12
@@ -19,7 +19,6 @@ import (
|
||||
"github.com/coder/coder/v2/coderd/util/ptr"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
"github.com/coder/quartz"
|
||||
)
|
||||
|
||||
func Test_TaskStatus(t *testing.T) {
|
||||
@@ -29,12 +28,12 @@ func Test_TaskStatus(t *testing.T) {
|
||||
args []string
|
||||
expectOutput string
|
||||
expectError string
|
||||
hf func(context.Context, quartz.Clock) func(http.ResponseWriter, *http.Request)
|
||||
hf func(context.Context, time.Time) func(http.ResponseWriter, *http.Request)
|
||||
}{
|
||||
{
|
||||
args: []string{"doesnotexist"},
|
||||
expectError: httpapi.ResourceNotFoundResponse.Message,
|
||||
hf: func(ctx context.Context, _ quartz.Clock) func(w http.ResponseWriter, r *http.Request) {
|
||||
hf: func(ctx context.Context, _ time.Time) func(w http.ResponseWriter, r *http.Request) {
|
||||
return func(w http.ResponseWriter, r *http.Request) {
|
||||
switch r.URL.Path {
|
||||
case "/api/v2/tasks/me/doesnotexist":
|
||||
@@ -50,8 +49,7 @@ func Test_TaskStatus(t *testing.T) {
|
||||
args: []string{"exists"},
|
||||
expectOutput: `STATE CHANGED STATUS HEALTHY STATE MESSAGE
|
||||
0s ago active true working Thinking furiously...`,
|
||||
hf: func(ctx context.Context, clk quartz.Clock) func(w http.ResponseWriter, r *http.Request) {
|
||||
now := clk.Now()
|
||||
hf: func(ctx context.Context, now time.Time) func(w http.ResponseWriter, r *http.Request) {
|
||||
return func(w http.ResponseWriter, r *http.Request) {
|
||||
switch r.URL.Path {
|
||||
case "/api/v2/tasks/me/exists":
|
||||
@@ -86,8 +84,7 @@ func Test_TaskStatus(t *testing.T) {
|
||||
4s ago active true
|
||||
3s ago active true working Reticulating splines...
|
||||
2s ago active true complete Splines reticulated successfully!`,
|
||||
hf: func(ctx context.Context, clk quartz.Clock) func(http.ResponseWriter, *http.Request) {
|
||||
now := clk.Now()
|
||||
hf: func(ctx context.Context, now time.Time) func(http.ResponseWriter, *http.Request) {
|
||||
var calls atomic.Int64
|
||||
return func(w http.ResponseWriter, r *http.Request) {
|
||||
switch r.URL.Path {
|
||||
@@ -218,7 +215,7 @@ func Test_TaskStatus(t *testing.T) {
|
||||
"created_at": "2025-08-26T12:34:56Z",
|
||||
"updated_at": "2025-08-26T12:34:56Z"
|
||||
}`,
|
||||
hf: func(ctx context.Context, _ quartz.Clock) func(http.ResponseWriter, *http.Request) {
|
||||
hf: func(ctx context.Context, now time.Time) func(http.ResponseWriter, *http.Request) {
|
||||
ts := time.Date(2025, 8, 26, 12, 34, 56, 0, time.UTC)
|
||||
return func(w http.ResponseWriter, r *http.Request) {
|
||||
switch r.URL.Path {
|
||||
@@ -255,8 +252,8 @@ func Test_TaskStatus(t *testing.T) {
|
||||
|
||||
var (
|
||||
ctx = testutil.Context(t, testutil.WaitShort)
|
||||
mClock = quartz.NewMock(t)
|
||||
srv = httptest.NewServer(http.HandlerFunc(tc.hf(ctx, mClock)))
|
||||
now = time.Now().UTC() // TODO: replace with quartz
|
||||
srv = httptest.NewServer(http.HandlerFunc(tc.hf(ctx, now)))
|
||||
client = codersdk.New(testutil.MustURL(t, srv.URL))
|
||||
sb = strings.Builder{}
|
||||
args = []string{"task", "status", "--watch-interval", testutil.IntervalFast.String()}
|
||||
@@ -264,10 +261,10 @@ func Test_TaskStatus(t *testing.T) {
|
||||
|
||||
t.Cleanup(srv.Close)
|
||||
args = append(args, tc.args...)
|
||||
inv, cfgDir := clitest.NewWithClock(t, mClock, args...)
|
||||
inv, root := clitest.New(t, args...)
|
||||
inv.Stdout = &sb
|
||||
inv.Stderr = &sb
|
||||
clitest.SetupConfig(t, client, cfgDir)
|
||||
clitest.SetupConfig(t, client, root)
|
||||
err := inv.WithContext(ctx).Run()
|
||||
if tc.expectError == "" {
|
||||
assert.NoError(t, err)
|
||||
|
||||
+3
-3
@@ -7,7 +7,7 @@ import (
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"slices"
|
||||
"sort"
|
||||
|
||||
"golang.org/x/exp/maps"
|
||||
"golang.org/x/xerrors"
|
||||
@@ -31,7 +31,7 @@ func (*RootCmd) templateInit() *serpent.Command {
|
||||
for _, ex := range exampleList {
|
||||
templateIDs = append(templateIDs, ex.ID)
|
||||
}
|
||||
slices.Sort(templateIDs)
|
||||
sort.Strings(templateIDs)
|
||||
cmd := &serpent.Command{
|
||||
Use: "init [directory]",
|
||||
Short: "Get started with a templated template.",
|
||||
@@ -50,7 +50,7 @@ func (*RootCmd) templateInit() *serpent.Command {
|
||||
optsToID[name] = example.ID
|
||||
}
|
||||
opts := maps.Keys(optsToID)
|
||||
slices.Sort(opts)
|
||||
sort.Strings(opts)
|
||||
_, _ = fmt.Fprintln(
|
||||
inv.Stdout,
|
||||
pretty.Sprint(
|
||||
|
||||
@@ -4,7 +4,7 @@ import (
|
||||
"bytes"
|
||||
"context"
|
||||
"encoding/json"
|
||||
"slices"
|
||||
"sort"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
@@ -47,7 +47,7 @@ func TestTemplateList(t *testing.T) {
|
||||
|
||||
// expect that templates are listed alphabetically
|
||||
templatesList := []string{firstTemplate.Name, secondTemplate.Name}
|
||||
slices.Sort(templatesList)
|
||||
sort.Strings(templatesList)
|
||||
|
||||
require.NoError(t, <-errC)
|
||||
|
||||
|
||||
-4
@@ -20,10 +20,6 @@ OPTIONS:
|
||||
--copy-parameters-from string, $CODER_WORKSPACE_COPY_PARAMETERS_FROM
|
||||
Specify the source workspace name to copy parameters from.
|
||||
|
||||
--no-wait bool, $CODER_CREATE_NO_WAIT
|
||||
Return immediately after creating the workspace. The build will run in
|
||||
the background.
|
||||
|
||||
--parameter string-array, $CODER_RICH_PARAMETER
|
||||
Rich parameter value in the format "name=value".
|
||||
|
||||
|
||||
@@ -6,7 +6,7 @@ USAGE:
|
||||
List all organization members
|
||||
|
||||
OPTIONS:
|
||||
-c, --column [username|name|last seen at|user created at|user updated at|user id|organization id|created at|updated at|organization roles] (default: username,organization roles)
|
||||
-c, --column [username|name|user id|organization id|created at|updated at|organization roles] (default: username,organization roles)
|
||||
Columns to display in table output.
|
||||
|
||||
-o, --output table|json (default: table)
|
||||
|
||||
@@ -7,7 +7,7 @@
|
||||
"last_seen_at": "====[timestamp]=====",
|
||||
"name": "test-daemon",
|
||||
"version": "v0.0.0-devel",
|
||||
"api_version": "1.16",
|
||||
"api_version": "1.15",
|
||||
"provisioners": [
|
||||
"echo"
|
||||
],
|
||||
|
||||
+5
-6
@@ -143,6 +143,11 @@ AI BRIDGE OPTIONS:
|
||||
--aibridge-enabled bool, $CODER_AIBRIDGE_ENABLED (default: false)
|
||||
Whether to start an in-memory aibridged instance.
|
||||
|
||||
--aibridge-inject-coder-mcp-tools bool, $CODER_AIBRIDGE_INJECT_CODER_MCP_TOOLS (default: false)
|
||||
Whether to inject Coder's MCP tools into intercepted AI Bridge
|
||||
requests (requires the "oauth2" and "mcp-server-http" experiments to
|
||||
be enabled).
|
||||
|
||||
--aibridge-max-concurrency int, $CODER_AIBRIDGE_MAX_CONCURRENCY (default: 0)
|
||||
Maximum number of concurrent AI Bridge requests per replica. Set to 0
|
||||
to disable (unlimited).
|
||||
@@ -170,12 +175,6 @@ AI BRIDGE OPTIONS:
|
||||
exporting these records to external SIEM or observability systems.
|
||||
|
||||
AI BRIDGE PROXY OPTIONS:
|
||||
--aibridge-proxy-allowed-private-cidrs string-array, $CODER_AIBRIDGE_PROXY_ALLOWED_PRIVATE_CIDRS
|
||||
Comma-separated list of CIDR ranges that are permitted even though
|
||||
they fall within blocked private/reserved IP ranges. By default all
|
||||
private ranges are blocked to prevent SSRF attacks. Use this to allow
|
||||
access to specific internal networks.
|
||||
|
||||
--aibridge-proxy-enabled bool, $CODER_AIBRIDGE_PROXY_ENABLED (default: false)
|
||||
Enable the AI Bridge MITM Proxy for intercepting and decrypting AI
|
||||
provider requests.
|
||||
|
||||
+10
-11
@@ -8,17 +8,16 @@ USAGE:
|
||||
Aliases: user
|
||||
|
||||
SUBCOMMANDS:
|
||||
activate Update a user's status to 'active'. Active users can fully
|
||||
interact with the platform
|
||||
create Create a new user.
|
||||
delete Delete a user by username or user_id.
|
||||
edit-roles Edit a user's roles by username or id
|
||||
list Prints the list of users.
|
||||
oidc-claims Display the OIDC claims for the authenticated user.
|
||||
show Show a single user. Use 'me' to indicate the currently
|
||||
authenticated user.
|
||||
suspend Update a user's status to 'suspended'. A suspended user
|
||||
cannot log into the platform
|
||||
activate Update a user's status to 'active'. Active users can fully
|
||||
interact with the platform
|
||||
create Create a new user.
|
||||
delete Delete a user by username or user_id.
|
||||
edit-roles Edit a user's roles by username or id
|
||||
list Prints the list of users.
|
||||
show Show a single user. Use 'me' to indicate the currently
|
||||
authenticated user.
|
||||
suspend Update a user's status to 'suspended'. A suspended user cannot
|
||||
log into the platform
|
||||
|
||||
———
|
||||
Run `coder --help` for a list of global options.
|
||||
|
||||
@@ -24,10 +24,6 @@ OPTIONS:
|
||||
-p, --password string
|
||||
Specifies a password for the new user.
|
||||
|
||||
--service-account bool
|
||||
Create a user account intended to be used by a service or as an
|
||||
intermediary rather than by a human.
|
||||
|
||||
-u, --username string
|
||||
Specifies a username for the new user.
|
||||
|
||||
|
||||
@@ -1,24 +0,0 @@
|
||||
coder v0.0.0-devel
|
||||
|
||||
USAGE:
|
||||
coder users oidc-claims [flags]
|
||||
|
||||
Display the OIDC claims for the authenticated user.
|
||||
|
||||
- Display your OIDC claims:
|
||||
|
||||
$ coder users oidc-claims
|
||||
|
||||
- Display your OIDC claims as JSON:
|
||||
|
||||
$ coder users oidc-claims -o json
|
||||
|
||||
OPTIONS:
|
||||
-c, --column [key|value] (default: key,value)
|
||||
Columns to display in table output.
|
||||
|
||||
-o, --output table|json (default: table)
|
||||
Output format.
|
||||
|
||||
———
|
||||
Run `coder --help` for a list of global options.
|
||||
+2
-15
@@ -752,11 +752,6 @@ workspace_prebuilds:
|
||||
# limit; disabled when set to zero.
|
||||
# (default: 3, type: int)
|
||||
failure_hard_limit: 3
|
||||
# Configure the background chat processing daemon.
|
||||
chat:
|
||||
# How many pending chats a worker should acquire per polling cycle.
|
||||
# (default: 10, type: int)
|
||||
acquireBatchSize: 10
|
||||
aibridge:
|
||||
# Whether to start an in-memory aibridged instance.
|
||||
# (default: false, type: bool)
|
||||
@@ -783,10 +778,8 @@ aibridge:
|
||||
# https://docs.claude.com/en/docs/claude-code/settings#environment-variables.
|
||||
# (default: global.anthropic.claude-haiku-4-5-20251001-v1:0, type: string)
|
||||
bedrock_small_fast_model: global.anthropic.claude-haiku-4-5-20251001-v1:0
|
||||
# Deprecated: Injected MCP in AI Bridge is deprecated and will be removed in a
|
||||
# future release. Whether to inject Coder's MCP tools into intercepted AI Bridge
|
||||
# requests (requires the "oauth2" and "mcp-server-http" experiments to be
|
||||
# enabled).
|
||||
# Whether to inject Coder's MCP tools into intercepted AI Bridge requests
|
||||
# (requires the "oauth2" and "mcp-server-http" experiments to be enabled).
|
||||
# (default: false, type: bool)
|
||||
inject_coder_mcp_tools: false
|
||||
# Length of time to retain data such as interceptions and all related records
|
||||
@@ -873,12 +866,6 @@ aibridgeproxy:
|
||||
# by the system. If not provided, the system certificate pool is used.
|
||||
# (default: <unset>, type: string)
|
||||
upstream_proxy_ca: ""
|
||||
# Comma-separated list of CIDR ranges that are permitted even though they fall
|
||||
# within blocked private/reserved IP ranges. By default all private ranges are
|
||||
# blocked to prevent SSRF attacks. Use this to allow access to specific internal
|
||||
# networks.
|
||||
# (default: <unset>, type: string-array)
|
||||
allowed_private_cidrs: []
|
||||
# Configure data retention policies for various database tables. Retention
|
||||
# policies automatically purge old data to reduce database size and improve
|
||||
# performance. Setting a retention duration to 0 disables automatic purging for
|
||||
|
||||
+3
-2
@@ -4,6 +4,7 @@ import (
|
||||
"fmt"
|
||||
"os"
|
||||
"slices"
|
||||
"sort"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
@@ -193,7 +194,7 @@ func joinScopes(scopes []codersdk.APIKeyScope) string {
|
||||
return ""
|
||||
}
|
||||
vals := slice.ToStrings(scopes)
|
||||
slices.Sort(vals)
|
||||
sort.Strings(vals)
|
||||
return strings.Join(vals, ", ")
|
||||
}
|
||||
|
||||
@@ -205,7 +206,7 @@ func joinAllowList(entries []codersdk.APIAllowListTarget) string {
|
||||
for i, entry := range entries {
|
||||
vals[i] = entry.String()
|
||||
}
|
||||
slices.Sort(vals)
|
||||
sort.Strings(vals)
|
||||
return strings.Join(vals, ", ")
|
||||
}
|
||||
|
||||
|
||||
+12
-37
@@ -17,14 +17,13 @@ import (
|
||||
|
||||
func (r *RootCmd) userCreate() *serpent.Command {
|
||||
var (
|
||||
email string
|
||||
username string
|
||||
name string
|
||||
password string
|
||||
disableLogin bool
|
||||
loginType string
|
||||
serviceAccount bool
|
||||
orgContext = NewOrganizationContext()
|
||||
email string
|
||||
username string
|
||||
name string
|
||||
password string
|
||||
disableLogin bool
|
||||
loginType string
|
||||
orgContext = NewOrganizationContext()
|
||||
)
|
||||
cmd := &serpent.Command{
|
||||
Use: "create",
|
||||
@@ -33,23 +32,6 @@ func (r *RootCmd) userCreate() *serpent.Command {
|
||||
serpent.RequireNArgs(0),
|
||||
),
|
||||
Handler: func(inv *serpent.Invocation) error {
|
||||
if serviceAccount {
|
||||
switch {
|
||||
case loginType != "":
|
||||
return xerrors.New("You cannot use --login-type with --service-account")
|
||||
case password != "":
|
||||
return xerrors.New("You cannot use --password with --service-account")
|
||||
case email != "":
|
||||
return xerrors.New("You cannot use --email with --service-account")
|
||||
case disableLogin:
|
||||
return xerrors.New("You cannot use --disable-login with --service-account")
|
||||
}
|
||||
}
|
||||
|
||||
if disableLogin && loginType != "" {
|
||||
return xerrors.New("You cannot specify both --disable-login and --login-type")
|
||||
}
|
||||
|
||||
client, err := r.InitClient(inv)
|
||||
if err != nil {
|
||||
return err
|
||||
@@ -77,7 +59,7 @@ func (r *RootCmd) userCreate() *serpent.Command {
|
||||
return err
|
||||
}
|
||||
}
|
||||
if email == "" && !serviceAccount {
|
||||
if email == "" {
|
||||
email, err = cliui.Prompt(inv, cliui.PromptOptions{
|
||||
Text: "Email:",
|
||||
Validate: func(s string) error {
|
||||
@@ -105,7 +87,10 @@ func (r *RootCmd) userCreate() *serpent.Command {
|
||||
}
|
||||
}
|
||||
userLoginType := codersdk.LoginTypePassword
|
||||
if disableLogin || serviceAccount {
|
||||
if disableLogin && loginType != "" {
|
||||
return xerrors.New("You cannot specify both --disable-login and --login-type")
|
||||
}
|
||||
if disableLogin {
|
||||
userLoginType = codersdk.LoginTypeNone
|
||||
} else if loginType != "" {
|
||||
userLoginType = codersdk.LoginType(loginType)
|
||||
@@ -126,7 +111,6 @@ func (r *RootCmd) userCreate() *serpent.Command {
|
||||
Password: password,
|
||||
OrganizationIDs: []uuid.UUID{organization.ID},
|
||||
UserLoginType: userLoginType,
|
||||
ServiceAccount: serviceAccount,
|
||||
})
|
||||
if err != nil {
|
||||
return err
|
||||
@@ -143,10 +127,6 @@ func (r *RootCmd) userCreate() *serpent.Command {
|
||||
case codersdk.LoginTypeOIDC:
|
||||
authenticationMethod = `Login is authenticated through the configured OIDC provider.`
|
||||
}
|
||||
if serviceAccount {
|
||||
email = "n/a"
|
||||
authenticationMethod = "Service accounts must authenticate with a token and cannot log in."
|
||||
}
|
||||
|
||||
_, _ = fmt.Fprintln(inv.Stderr, `A new user has been created!
|
||||
Share the instructions below to get them started.
|
||||
@@ -214,11 +194,6 @@ Create a workspace `+pretty.Sprint(cliui.DefaultStyles.Code, "coder create")+`!
|
||||
)),
|
||||
Value: serpent.StringOf(&loginType),
|
||||
},
|
||||
{
|
||||
Flag: "service-account",
|
||||
Description: "Create a user account intended to be used by a service or as an intermediary rather than by a human.",
|
||||
Value: serpent.BoolOf(&serviceAccount),
|
||||
},
|
||||
}
|
||||
|
||||
orgContext.AttachOptions(cmd)
|
||||
|
||||
@@ -8,7 +8,6 @@ import (
|
||||
|
||||
"github.com/coder/coder/v2/cli/clitest"
|
||||
"github.com/coder/coder/v2/coderd/coderdtest"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/pty/ptytest"
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
)
|
||||
@@ -125,56 +124,4 @@ func TestUserCreate(t *testing.T) {
|
||||
assert.Equal(t, args[5], created.Username)
|
||||
assert.Empty(t, created.Name)
|
||||
})
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
args []string
|
||||
err string
|
||||
}{
|
||||
{
|
||||
name: "ServiceAccount",
|
||||
args: []string{"--service-account", "-u", "dean"},
|
||||
},
|
||||
{
|
||||
name: "ServiceAccountLoginType",
|
||||
args: []string{"--service-account", "-u", "dean", "--login-type", "none"},
|
||||
err: "You cannot use --login-type with --service-account",
|
||||
},
|
||||
{
|
||||
name: "ServiceAccountDisableLogin",
|
||||
args: []string{"--service-account", "-u", "dean", "--disable-login"},
|
||||
err: "You cannot use --disable-login with --service-account",
|
||||
},
|
||||
{
|
||||
name: "ServiceAccountEmail",
|
||||
args: []string{"--service-account", "-u", "dean", "--email", "dean@coder.com"},
|
||||
err: "You cannot use --email with --service-account",
|
||||
},
|
||||
{
|
||||
name: "ServiceAccountPassword",
|
||||
args: []string{"--service-account", "-u", "dean", "--password", "1n5ecureP4ssw0rd!"},
|
||||
err: "You cannot use --password with --service-account",
|
||||
},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
t.Parallel()
|
||||
client := coderdtest.New(t, nil)
|
||||
coderdtest.CreateFirstUser(t, client)
|
||||
inv, root := clitest.New(t, append([]string{"users", "create"}, tt.args...)...)
|
||||
clitest.SetupConfig(t, client, root)
|
||||
err := inv.Run()
|
||||
if tt.err == "" {
|
||||
require.NoError(t, err)
|
||||
ctx := testutil.Context(t, testutil.WaitShort)
|
||||
created, err := client.User(ctx, "dean")
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, codersdk.LoginTypeNone, created.LoginType)
|
||||
} else {
|
||||
require.Error(t, err)
|
||||
require.ErrorContains(t, err, tt.err)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,79 +0,0 @@
|
||||
package cli
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"golang.org/x/xerrors"
|
||||
|
||||
"github.com/coder/coder/v2/cli/cliui"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/serpent"
|
||||
)
|
||||
|
||||
func (r *RootCmd) userOIDCClaims() *serpent.Command {
|
||||
formatter := cliui.NewOutputFormatter(
|
||||
cliui.ChangeFormatterData(
|
||||
cliui.TableFormat([]claimRow{}, []string{"key", "value"}),
|
||||
func(data any) (any, error) {
|
||||
resp, ok := data.(codersdk.OIDCClaimsResponse)
|
||||
if !ok {
|
||||
return nil, xerrors.Errorf("expected type %T, got %T", resp, data)
|
||||
}
|
||||
rows := make([]claimRow, 0, len(resp.Claims))
|
||||
for k, v := range resp.Claims {
|
||||
rows = append(rows, claimRow{
|
||||
Key: k,
|
||||
Value: fmt.Sprintf("%v", v),
|
||||
})
|
||||
}
|
||||
return rows, nil
|
||||
},
|
||||
),
|
||||
cliui.JSONFormat(),
|
||||
)
|
||||
|
||||
cmd := &serpent.Command{
|
||||
Use: "oidc-claims",
|
||||
Short: "Display the OIDC claims for the authenticated user.",
|
||||
Long: FormatExamples(
|
||||
Example{
|
||||
Description: "Display your OIDC claims",
|
||||
Command: "coder users oidc-claims",
|
||||
},
|
||||
Example{
|
||||
Description: "Display your OIDC claims as JSON",
|
||||
Command: "coder users oidc-claims -o json",
|
||||
},
|
||||
),
|
||||
Middleware: serpent.Chain(
|
||||
serpent.RequireNArgs(0),
|
||||
),
|
||||
Handler: func(inv *serpent.Invocation) error {
|
||||
client, err := r.InitClient(inv)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
resp, err := client.UserOIDCClaims(inv.Context())
|
||||
if err != nil {
|
||||
return xerrors.Errorf("get oidc claims: %w", err)
|
||||
}
|
||||
|
||||
out, err := formatter.Format(inv.Context(), resp)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = fmt.Fprintln(inv.Stdout, out)
|
||||
return err
|
||||
},
|
||||
}
|
||||
|
||||
formatter.AttachOptions(&cmd.Options)
|
||||
return cmd
|
||||
}
|
||||
|
||||
type claimRow struct {
|
||||
Key string `json:"-" table:"key,default_sort"`
|
||||
Value string `json:"-" table:"value"`
|
||||
}
|
||||
@@ -1,161 +0,0 @@
|
||||
package cli_test
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/json"
|
||||
"testing"
|
||||
|
||||
"github.com/golang-jwt/jwt/v4"
|
||||
"github.com/google/uuid"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
"github.com/coder/coder/v2/cli/clitest"
|
||||
"github.com/coder/coder/v2/coderd"
|
||||
"github.com/coder/coder/v2/coderd/coderdtest"
|
||||
"github.com/coder/coder/v2/coderd/coderdtest/oidctest"
|
||||
"github.com/coder/coder/v2/codersdk"
|
||||
"github.com/coder/coder/v2/testutil"
|
||||
)
|
||||
|
||||
func TestUserOIDCClaims(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
newOIDCTest := func(t *testing.T) (*oidctest.FakeIDP, *codersdk.Client) {
|
||||
t.Helper()
|
||||
|
||||
fake := oidctest.NewFakeIDP(t,
|
||||
oidctest.WithServing(),
|
||||
)
|
||||
cfg := fake.OIDCConfig(t, nil, func(cfg *coderd.OIDCConfig) {
|
||||
cfg.AllowSignups = true
|
||||
})
|
||||
ownerClient := coderdtest.New(t, &coderdtest.Options{
|
||||
OIDCConfig: cfg,
|
||||
})
|
||||
return fake, ownerClient
|
||||
}
|
||||
|
||||
t.Run("OwnClaims", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
fake, ownerClient := newOIDCTest(t)
|
||||
claims := jwt.MapClaims{
|
||||
"email": "alice@coder.com",
|
||||
"email_verified": true,
|
||||
"sub": uuid.NewString(),
|
||||
"groups": []string{"admin", "eng"},
|
||||
}
|
||||
userClient, loginResp := fake.Login(t, ownerClient, claims)
|
||||
defer loginResp.Body.Close()
|
||||
|
||||
inv, root := clitest.New(t, "users", "oidc-claims", "-o", "json")
|
||||
clitest.SetupConfig(t, userClient, root)
|
||||
|
||||
buf := bytes.NewBuffer(nil)
|
||||
inv.Stdout = buf
|
||||
err := inv.WithContext(testutil.Context(t, testutil.WaitMedium)).Run()
|
||||
require.NoError(t, err)
|
||||
|
||||
var resp codersdk.OIDCClaimsResponse
|
||||
err = json.Unmarshal(buf.Bytes(), &resp)
|
||||
require.NoError(t, err, "unmarshal JSON output")
|
||||
require.NotEmpty(t, resp.Claims, "claims should not be empty")
|
||||
assert.Equal(t, "alice@coder.com", resp.Claims["email"])
|
||||
})
|
||||
|
||||
t.Run("Table", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
fake, ownerClient := newOIDCTest(t)
|
||||
claims := jwt.MapClaims{
|
||||
"email": "bob@coder.com",
|
||||
"email_verified": true,
|
||||
"sub": uuid.NewString(),
|
||||
}
|
||||
userClient, loginResp := fake.Login(t, ownerClient, claims)
|
||||
defer loginResp.Body.Close()
|
||||
|
||||
inv, root := clitest.New(t, "users", "oidc-claims")
|
||||
clitest.SetupConfig(t, userClient, root)
|
||||
|
||||
buf := bytes.NewBuffer(nil)
|
||||
inv.Stdout = buf
|
||||
err := inv.WithContext(testutil.Context(t, testutil.WaitMedium)).Run()
|
||||
require.NoError(t, err)
|
||||
|
||||
output := buf.String()
|
||||
require.Contains(t, output, "email")
|
||||
require.Contains(t, output, "bob@coder.com")
|
||||
})
|
||||
|
||||
t.Run("NotOIDCUser", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
client := coderdtest.New(t, nil)
|
||||
_ = coderdtest.CreateFirstUser(t, client)
|
||||
|
||||
inv, root := clitest.New(t, "users", "oidc-claims")
|
||||
clitest.SetupConfig(t, client, root)
|
||||
|
||||
err := inv.WithContext(testutil.Context(t, testutil.WaitMedium)).Run()
|
||||
require.Error(t, err)
|
||||
require.Contains(t, err.Error(), "not an OIDC user")
|
||||
})
|
||||
|
||||
// Verify that two different OIDC users each only see their own
|
||||
// claims. The endpoint has no user parameter, so there is no way
|
||||
// to request another user's claims by design.
|
||||
t.Run("OnlyOwnClaims", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
aliceFake, aliceOwnerClient := newOIDCTest(t)
|
||||
aliceClaims := jwt.MapClaims{
|
||||
"email": "alice-isolation@coder.com",
|
||||
"email_verified": true,
|
||||
"sub": uuid.NewString(),
|
||||
}
|
||||
aliceClient, aliceLoginResp := aliceFake.Login(t, aliceOwnerClient, aliceClaims)
|
||||
defer aliceLoginResp.Body.Close()
|
||||
|
||||
bobFake, bobOwnerClient := newOIDCTest(t)
|
||||
bobClaims := jwt.MapClaims{
|
||||
"email": "bob-isolation@coder.com",
|
||||
"email_verified": true,
|
||||
"sub": uuid.NewString(),
|
||||
}
|
||||
bobClient, bobLoginResp := bobFake.Login(t, bobOwnerClient, bobClaims)
|
||||
defer bobLoginResp.Body.Close()
|
||||
|
||||
ctx := testutil.Context(t, testutil.WaitMedium)
|
||||
|
||||
// Alice sees her own claims.
|
||||
aliceResp, err := aliceClient.UserOIDCClaims(ctx)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "alice-isolation@coder.com", aliceResp.Claims["email"])
|
||||
|
||||
// Bob sees his own claims.
|
||||
bobResp, err := bobClient.UserOIDCClaims(ctx)
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, "bob-isolation@coder.com", bobResp.Claims["email"])
|
||||
})
|
||||
|
||||
t.Run("ClaimsNeverNull", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
fake, ownerClient := newOIDCTest(t)
|
||||
// Use minimal claims — just enough for OIDC login.
|
||||
claims := jwt.MapClaims{
|
||||
"email": "minimal@coder.com",
|
||||
"email_verified": true,
|
||||
"sub": uuid.NewString(),
|
||||
}
|
||||
userClient, loginResp := fake.Login(t, ownerClient, claims)
|
||||
defer loginResp.Body.Close()
|
||||
|
||||
ctx := testutil.Context(t, testutil.WaitMedium)
|
||||
resp, err := userClient.UserOIDCClaims(ctx)
|
||||
require.NoError(t, err)
|
||||
require.NotNil(t, resp.Claims, "claims should never be nil, expected empty map")
|
||||
})
|
||||
}
|
||||
@@ -19,7 +19,6 @@ func (r *RootCmd) users() *serpent.Command {
|
||||
r.userSingle(),
|
||||
r.userDelete(),
|
||||
r.userEditRoles(),
|
||||
r.userOIDCClaims(),
|
||||
r.createUserStatusCommand(codersdk.UserStatusActive),
|
||||
r.createUserStatusCommand(codersdk.UserStatusSuspended),
|
||||
},
|
||||
|
||||
@@ -116,10 +116,10 @@ func TestWorkspaceActivityBump(t *testing.T) {
|
||||
// is required. The Activity Bump behavior is also coupled with
|
||||
// Last Used, so it would be obvious to the user if we
|
||||
// are falsely recognizing activity.
|
||||
require.Never(t, func() bool {
|
||||
workspace, err = client.Workspace(ctx, workspace.ID)
|
||||
return err == nil && !workspace.LatestBuild.Deadline.Time.Equal(firstDeadline)
|
||||
}, testutil.IntervalMedium, testutil.IntervalFast, "deadline should not change")
|
||||
time.Sleep(testutil.IntervalMedium)
|
||||
workspace, err = client.Workspace(ctx, workspace.ID)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, workspace.LatestBuild.Deadline.Time, firstDeadline)
|
||||
return
|
||||
}
|
||||
|
||||
|
||||
+8
-13
@@ -103,7 +103,7 @@ type Options struct {
|
||||
UpdateAgentMetricsFn func(ctx context.Context, labels prometheusmetrics.AgentMetricLabels, metrics []*agentproto.Stats_Metric)
|
||||
}
|
||||
|
||||
func New(opts Options, workspace database.Workspace, agent database.WorkspaceAgent) *API {
|
||||
func New(opts Options, workspace database.Workspace) *API {
|
||||
if opts.Clock == nil {
|
||||
opts.Clock = quartz.NewReal()
|
||||
}
|
||||
@@ -156,8 +156,7 @@ func New(opts Options, workspace database.Workspace, agent database.WorkspaceAge
|
||||
}
|
||||
|
||||
api.StatsAPI = &StatsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentName: agent.Name,
|
||||
AgentFn: api.agent,
|
||||
Workspace: api.cachedWorkspaceFields,
|
||||
Database: opts.Database,
|
||||
Log: opts.Log,
|
||||
@@ -176,18 +175,16 @@ func New(opts Options, workspace database.Workspace, agent database.WorkspaceAge
|
||||
}
|
||||
|
||||
api.AppsAPI = &AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: api.agent,
|
||||
Database: opts.Database,
|
||||
Log: opts.Log,
|
||||
Workspace: api.cachedWorkspaceFields,
|
||||
PublishWorkspaceUpdateFn: api.publishWorkspaceUpdate,
|
||||
Clock: opts.Clock,
|
||||
NotificationsEnqueuer: opts.NotificationsEnqueuer,
|
||||
}
|
||||
|
||||
api.MetadataAPI = &MetadataAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: api.agent,
|
||||
Workspace: api.cachedWorkspaceFields,
|
||||
Database: opts.Database,
|
||||
Log: opts.Log,
|
||||
@@ -207,8 +204,7 @@ func New(opts Options, workspace database.Workspace, agent database.WorkspaceAge
|
||||
}
|
||||
|
||||
api.ConnLogAPI = &ConnLogAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentName: agent.Name,
|
||||
AgentFn: api.agent,
|
||||
ConnectionLogger: opts.ConnectionLogger,
|
||||
Database: opts.Database,
|
||||
Workspace: api.cachedWorkspaceFields,
|
||||
@@ -226,6 +222,7 @@ func New(opts Options, workspace database.Workspace, agent database.WorkspaceAge
|
||||
api.SubAgentAPI = &SubAgentAPI{
|
||||
OwnerID: opts.OwnerID,
|
||||
OrganizationID: opts.OrganizationID,
|
||||
AgentID: opts.AgentID,
|
||||
AgentFn: api.agent,
|
||||
Log: opts.Log,
|
||||
Clock: opts.Clock,
|
||||
@@ -300,10 +297,8 @@ func (a *API) agent(ctx context.Context) (database.WorkspaceAgent, error) {
|
||||
func (a *API) refreshCachedWorkspace(ctx context.Context) {
|
||||
ws, err := a.opts.Database.GetWorkspaceByID(ctx, a.opts.WorkspaceID)
|
||||
if err != nil {
|
||||
// Do not clear the cache on transient DB errors. Stale data is
|
||||
// preferable to no data, which forces callers to fall back to
|
||||
// expensive queries like GetWorkspaceByAgentID.
|
||||
a.opts.Log.Warn(ctx, "failed to refresh cached workspace fields", slog.Error(err))
|
||||
a.cachedWorkspaceFields.Clear()
|
||||
return
|
||||
}
|
||||
|
||||
@@ -346,11 +341,11 @@ func (a *API) startCacheRefreshLoop(ctx context.Context) {
|
||||
a.cachedWorkspaceFields.Clear()
|
||||
}
|
||||
|
||||
func (a *API) publishWorkspaceUpdate(ctx context.Context, agentID uuid.UUID, kind wspubsub.WorkspaceEventKind) error {
|
||||
func (a *API) publishWorkspaceUpdate(ctx context.Context, agent *database.WorkspaceAgent, kind wspubsub.WorkspaceEventKind) error {
|
||||
a.opts.PublishWorkspaceUpdateFn(ctx, a.opts.OwnerID, wspubsub.WorkspaceEvent{
|
||||
Kind: kind,
|
||||
WorkspaceID: a.opts.WorkspaceID,
|
||||
AgentID: &agentID,
|
||||
AgentID: &agent.ID,
|
||||
})
|
||||
return nil
|
||||
}
|
||||
|
||||
+33
-38
@@ -24,19 +24,22 @@ import (
|
||||
)
|
||||
|
||||
type AppsAPI struct {
|
||||
AgentID uuid.UUID
|
||||
AgentFn func(context.Context) (database.WorkspaceAgent, error)
|
||||
Database database.Store
|
||||
Log slog.Logger
|
||||
Workspace *CachedWorkspaceFields
|
||||
PublishWorkspaceUpdateFn func(context.Context, uuid.UUID, wspubsub.WorkspaceEventKind) error
|
||||
PublishWorkspaceUpdateFn func(context.Context, *database.WorkspaceAgent, wspubsub.WorkspaceEventKind) error
|
||||
NotificationsEnqueuer notifications.Enqueuer
|
||||
Clock quartz.Clock
|
||||
}
|
||||
|
||||
func (a *AppsAPI) BatchUpdateAppHealths(ctx context.Context, req *agentproto.BatchUpdateAppHealthRequest) (*agentproto.BatchUpdateAppHealthResponse, error) {
|
||||
workspaceAgent, err := a.AgentFn(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
a.Log.Debug(ctx, "got batch app health update",
|
||||
slog.F("agent_id", a.AgentID.String()),
|
||||
slog.F("agent_id", workspaceAgent.ID.String()),
|
||||
slog.F("updates", req.Updates),
|
||||
)
|
||||
|
||||
@@ -44,9 +47,9 @@ func (a *AppsAPI) BatchUpdateAppHealths(ctx context.Context, req *agentproto.Bat
|
||||
return &agentproto.BatchUpdateAppHealthResponse{}, nil
|
||||
}
|
||||
|
||||
apps, err := a.Database.GetWorkspaceAppsByAgentID(ctx, a.AgentID)
|
||||
apps, err := a.Database.GetWorkspaceAppsByAgentID(ctx, workspaceAgent.ID)
|
||||
if err != nil {
|
||||
return nil, xerrors.Errorf("get workspace apps by agent ID %q: %w", a.AgentID, err)
|
||||
return nil, xerrors.Errorf("get workspace apps by agent ID %q: %w", workspaceAgent.ID, err)
|
||||
}
|
||||
|
||||
var newApps []database.WorkspaceApp
|
||||
@@ -107,7 +110,7 @@ func (a *AppsAPI) BatchUpdateAppHealths(ctx context.Context, req *agentproto.Bat
|
||||
}
|
||||
|
||||
if a.PublishWorkspaceUpdateFn != nil && len(newApps) > 0 {
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, a.AgentID, wspubsub.WorkspaceEventKindAppHealthUpdate)
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, &workspaceAgent, wspubsub.WorkspaceEventKindAppHealthUpdate)
|
||||
if err != nil {
|
||||
return nil, xerrors.Errorf("publish workspace update: %w", err)
|
||||
}
|
||||
@@ -146,8 +149,12 @@ func (a *AppsAPI) UpdateAppStatus(ctx context.Context, req *agentproto.UpdateApp
|
||||
})
|
||||
}
|
||||
|
||||
workspaceAgent, err := a.AgentFn(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
app, err := a.Database.GetWorkspaceAppByAgentIDAndSlug(ctx, database.GetWorkspaceAppByAgentIDAndSlugParams{
|
||||
AgentID: a.AgentID,
|
||||
AgentID: workspaceAgent.ID,
|
||||
Slug: req.Slug,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -157,10 +164,11 @@ func (a *AppsAPI) UpdateAppStatus(ctx context.Context, req *agentproto.UpdateApp
|
||||
})
|
||||
}
|
||||
|
||||
ws, ok := a.Workspace.AsWorkspaceIdentity()
|
||||
if !ok {
|
||||
return nil, codersdk.NewError(http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Workspace identity not cached.",
|
||||
workspace, err := a.Database.GetWorkspaceByAgentID(ctx, workspaceAgent.ID)
|
||||
if err != nil {
|
||||
return nil, codersdk.NewError(http.StatusBadRequest, codersdk.Response{
|
||||
Message: "Failed to get workspace.",
|
||||
Detail: err.Error(),
|
||||
})
|
||||
}
|
||||
|
||||
@@ -182,8 +190,8 @@ func (a *AppsAPI) UpdateAppStatus(ctx context.Context, req *agentproto.UpdateApp
|
||||
_, err = a.Database.InsertWorkspaceAppStatus(dbauthz.AsSystemRestricted(ctx), database.InsertWorkspaceAppStatusParams{
|
||||
ID: uuid.New(),
|
||||
CreatedAt: dbtime.Now(),
|
||||
WorkspaceID: ws.ID,
|
||||
AgentID: a.AgentID,
|
||||
WorkspaceID: workspace.ID,
|
||||
AgentID: workspaceAgent.ID,
|
||||
AppID: app.ID,
|
||||
State: dbState,
|
||||
Message: cleaned,
|
||||
@@ -200,7 +208,7 @@ func (a *AppsAPI) UpdateAppStatus(ctx context.Context, req *agentproto.UpdateApp
|
||||
}
|
||||
|
||||
if a.PublishWorkspaceUpdateFn != nil {
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, a.AgentID, wspubsub.WorkspaceEventKindAgentAppStatusUpdate)
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, &workspaceAgent, wspubsub.WorkspaceEventKindAgentAppStatusUpdate)
|
||||
if err != nil {
|
||||
return nil, codersdk.NewError(http.StatusInternalServerError, codersdk.Response{
|
||||
Message: "Failed to publish workspace update.",
|
||||
@@ -209,14 +217,14 @@ func (a *AppsAPI) UpdateAppStatus(ctx context.Context, req *agentproto.UpdateApp
|
||||
}
|
||||
}
|
||||
|
||||
// Notify on state change to Working/Idle for AI tasks.
|
||||
a.enqueueAITaskStateNotification(ctx, app.ID, latestAppStatus, dbState)
|
||||
// Notify on state change to Working/Idle for AI tasks
|
||||
a.enqueueAITaskStateNotification(ctx, app.ID, latestAppStatus, dbState, workspace, workspaceAgent)
|
||||
|
||||
if shouldBump(dbState, latestAppStatus) {
|
||||
// We pass time.Time{} for nextAutostart since we don't have access to
|
||||
// TemplateScheduleStore here. The activity bump logic handles this by
|
||||
// defaulting to the template's activity_bump duration (typically 1 hour).
|
||||
workspacestats.ActivityBumpWorkspace(ctx, a.Log, a.Database, ws.ID, time.Time{})
|
||||
workspacestats.ActivityBumpWorkspace(ctx, a.Log, a.Database, workspace.ID, time.Time{})
|
||||
}
|
||||
// just return a blank response because it doesn't contain any settable fields at present.
|
||||
return new(agentproto.UpdateAppStatusResponse), nil
|
||||
@@ -253,6 +261,8 @@ func (a *AppsAPI) enqueueAITaskStateNotification(
|
||||
appID uuid.UUID,
|
||||
latestAppStatus database.WorkspaceAppStatus,
|
||||
newAppStatus database.WorkspaceAppStatusState,
|
||||
workspace database.Workspace,
|
||||
agent database.WorkspaceAgent,
|
||||
) {
|
||||
var notificationTemplate uuid.UUID
|
||||
switch newAppStatus {
|
||||
@@ -269,20 +279,11 @@ func (a *AppsAPI) enqueueAITaskStateNotification(
|
||||
return
|
||||
}
|
||||
|
||||
taskID := a.Workspace.TaskID()
|
||||
if !taskID.Valid {
|
||||
if !workspace.TaskID.Valid {
|
||||
// Workspace has no task ID, do nothing.
|
||||
return
|
||||
}
|
||||
|
||||
// Only fetch fresh agent state for task workspaces, since we need
|
||||
// the current lifecycle state to decide whether to send notifications.
|
||||
agent, err := a.AgentFn(ctx)
|
||||
if err != nil {
|
||||
a.Log.Warn(ctx, "failed to get agent for AI task notification", slog.Error(err))
|
||||
return
|
||||
}
|
||||
|
||||
// Only send notifications when the agent is ready. We want to skip
|
||||
// any state transitions that occur whilst the workspace is starting
|
||||
// up as it doesn't make sense to receive them.
|
||||
@@ -295,7 +296,7 @@ func (a *AppsAPI) enqueueAITaskStateNotification(
|
||||
return
|
||||
}
|
||||
|
||||
task, err := a.Database.GetTaskByID(ctx, taskID.UUID)
|
||||
task, err := a.Database.GetTaskByID(ctx, workspace.TaskID.UUID)
|
||||
if err != nil {
|
||||
a.Log.Warn(ctx, "failed to get task", slog.Error(err))
|
||||
return
|
||||
@@ -320,20 +321,14 @@ func (a *AppsAPI) enqueueAITaskStateNotification(
|
||||
return
|
||||
}
|
||||
|
||||
ws, ok := a.Workspace.AsWorkspaceIdentity()
|
||||
if !ok {
|
||||
a.Log.Warn(ctx, "failed to get workspace identity for AI task notification")
|
||||
return
|
||||
}
|
||||
|
||||
if _, err := a.NotificationsEnqueuer.EnqueueWithData(
|
||||
// nolint:gocritic // Need notifier actor to enqueue notifications
|
||||
dbauthz.AsNotifier(ctx),
|
||||
ws.OwnerID,
|
||||
workspace.OwnerID,
|
||||
notificationTemplate,
|
||||
map[string]string{
|
||||
"task": task.Name,
|
||||
"workspace": ws.Name,
|
||||
"workspace": workspace.Name,
|
||||
},
|
||||
map[string]any{
|
||||
// Use a 1-minute bucketed timestamp to bypass per-day dedupe,
|
||||
@@ -343,7 +338,7 @@ func (a *AppsAPI) enqueueAITaskStateNotification(
|
||||
},
|
||||
"api-workspace-agent-app-status",
|
||||
// Associate this notification with related entities
|
||||
ws.ID, ws.OwnerID, ws.OrganizationID, appID,
|
||||
workspace.ID, workspace.OwnerID, workspace.OrganizationID, appID,
|
||||
); err != nil {
|
||||
a.Log.Warn(ctx, "failed to notify of task state", slog.Error(err))
|
||||
return
|
||||
|
||||
@@ -67,10 +67,12 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
|
||||
publishCalled := false
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, _ uuid.UUID, kind wspubsub.WorkspaceEventKind) error {
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, wa *database.WorkspaceAgent, kind wspubsub.WorkspaceEventKind) error {
|
||||
publishCalled = true
|
||||
return nil
|
||||
},
|
||||
@@ -103,10 +105,12 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
|
||||
publishCalled := false
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, _ uuid.UUID, kind wspubsub.WorkspaceEventKind) error {
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, wa *database.WorkspaceAgent, kind wspubsub.WorkspaceEventKind) error {
|
||||
publishCalled = true
|
||||
return nil
|
||||
},
|
||||
@@ -140,10 +144,12 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
|
||||
publishCalled := false
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, _ uuid.UUID, kind wspubsub.WorkspaceEventKind) error {
|
||||
PublishWorkspaceUpdateFn: func(ctx context.Context, wa *database.WorkspaceAgent, kind wspubsub.WorkspaceEventKind) error {
|
||||
publishCalled = true
|
||||
return nil
|
||||
},
|
||||
@@ -174,7 +180,9 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
dbM.EXPECT().GetWorkspaceAppsByAgentID(gomock.Any(), agent.ID).Return([]database.WorkspaceApp{app3}, nil)
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: nil,
|
||||
@@ -201,7 +209,9 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
dbM.EXPECT().GetWorkspaceAppsByAgentID(gomock.Any(), agent.ID).Return([]database.WorkspaceApp{app1, app2}, nil)
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: nil,
|
||||
@@ -229,7 +239,9 @@ func TestBatchUpdateAppHealths(t *testing.T) {
|
||||
dbM.EXPECT().GetWorkspaceAppsByAgentID(gomock.Any(), agent.ID).Return([]database.WorkspaceApp{app1, app2}, nil)
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: dbM,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: nil,
|
||||
@@ -267,26 +279,14 @@ func TestWorkspaceAgentAppStatus(t *testing.T) {
|
||||
}
|
||||
workspaceUpdates := make(chan wspubsub.WorkspaceEventKind, 100)
|
||||
|
||||
workspace := database.Workspace{
|
||||
ID: uuid.UUID{9},
|
||||
TaskID: uuid.NullUUID{
|
||||
Valid: true,
|
||||
UUID: uuid.UUID{7},
|
||||
},
|
||||
}
|
||||
cachedWs := &agentapi.CachedWorkspaceFields{}
|
||||
cachedWs.UpdateValues(workspace)
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: mDB,
|
||||
Log: testutil.Logger(t),
|
||||
Workspace: cachedWs,
|
||||
PublishWorkspaceUpdateFn: func(_ context.Context, agnt uuid.UUID, kind wspubsub.WorkspaceEventKind) error {
|
||||
assert.Equal(t, agnt, agent.ID)
|
||||
Database: mDB,
|
||||
Log: testutil.Logger(t),
|
||||
PublishWorkspaceUpdateFn: func(_ context.Context, agnt *database.WorkspaceAgent, kind wspubsub.WorkspaceEventKind) error {
|
||||
assert.Equal(t, *agnt, agent)
|
||||
testutil.AssertSend(ctx, t, workspaceUpdates, kind)
|
||||
return nil
|
||||
},
|
||||
@@ -309,6 +309,14 @@ func TestWorkspaceAgentAppStatus(t *testing.T) {
|
||||
},
|
||||
}
|
||||
mDB.EXPECT().GetTaskByID(gomock.Any(), task.ID).Times(1).Return(task, nil)
|
||||
workspace := database.Workspace{
|
||||
ID: uuid.UUID{9},
|
||||
TaskID: uuid.NullUUID{
|
||||
Valid: true,
|
||||
UUID: task.ID,
|
||||
},
|
||||
}
|
||||
mDB.EXPECT().GetWorkspaceByAgentID(gomock.Any(), agent.ID).Times(1).Return(workspace, nil)
|
||||
appStatus := database.WorkspaceAppStatus{
|
||||
ID: uuid.UUID{6},
|
||||
}
|
||||
@@ -355,7 +363,9 @@ func TestWorkspaceAgentAppStatus(t *testing.T) {
|
||||
Return(database.WorkspaceApp{}, sql.ErrNoRows)
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: mDB,
|
||||
Log: testutil.Logger(t),
|
||||
}
|
||||
@@ -382,7 +392,9 @@ func TestWorkspaceAgentAppStatus(t *testing.T) {
|
||||
}
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: mDB,
|
||||
Log: testutil.Logger(t),
|
||||
}
|
||||
@@ -410,7 +422,9 @@ func TestWorkspaceAgentAppStatus(t *testing.T) {
|
||||
}
|
||||
|
||||
api := &agentapi.AppsAPI{
|
||||
AgentID: agent.ID,
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Database: mDB,
|
||||
Log: testutil.Logger(t),
|
||||
}
|
||||
|
||||
@@ -4,7 +4,6 @@ import (
|
||||
"context"
|
||||
"sync"
|
||||
|
||||
"github.com/google/uuid"
|
||||
"golang.org/x/xerrors"
|
||||
|
||||
"github.com/coder/coder/v2/coderd/database"
|
||||
@@ -24,14 +23,12 @@ type CachedWorkspaceFields struct {
|
||||
lock sync.RWMutex
|
||||
|
||||
identity database.WorkspaceIdentity
|
||||
taskID uuid.NullUUID
|
||||
}
|
||||
|
||||
func (cws *CachedWorkspaceFields) Clear() {
|
||||
cws.lock.Lock()
|
||||
defer cws.lock.Unlock()
|
||||
cws.identity = database.WorkspaceIdentity{}
|
||||
cws.taskID = uuid.NullUUID{}
|
||||
}
|
||||
|
||||
func (cws *CachedWorkspaceFields) UpdateValues(ws database.Workspace) {
|
||||
@@ -45,13 +42,6 @@ func (cws *CachedWorkspaceFields) UpdateValues(ws database.Workspace) {
|
||||
cws.identity.OwnerUsername = ws.OwnerUsername
|
||||
cws.identity.TemplateName = ws.TemplateName
|
||||
cws.identity.AutostartSchedule = ws.AutostartSchedule
|
||||
cws.taskID = ws.TaskID
|
||||
}
|
||||
|
||||
func (cws *CachedWorkspaceFields) TaskID() uuid.NullUUID {
|
||||
cws.lock.RLock()
|
||||
defer cws.lock.RUnlock()
|
||||
return cws.taskID
|
||||
}
|
||||
|
||||
// Returns the Workspace, true, unless the workspace has not been cached (nuked or was a prebuild).
|
||||
|
||||
@@ -14,11 +14,11 @@ import (
|
||||
"github.com/coder/coder/v2/coderd/connectionlog"
|
||||
"github.com/coder/coder/v2/coderd/database"
|
||||
"github.com/coder/coder/v2/coderd/database/db2sdk"
|
||||
"github.com/coder/coder/v2/coderd/database/dbauthz"
|
||||
)
|
||||
|
||||
type ConnLogAPI struct {
|
||||
AgentID uuid.UUID
|
||||
AgentName string
|
||||
AgentFn func(context.Context) (database.WorkspaceAgent, error)
|
||||
ConnectionLogger *atomic.Pointer[connectionlog.ConnectionLogger]
|
||||
Workspace *CachedWorkspaceFields
|
||||
Database database.Store
|
||||
@@ -53,12 +53,27 @@ func (a *ConnLogAPI) ReportConnection(ctx context.Context, req *agentproto.Repor
|
||||
}
|
||||
}
|
||||
|
||||
// Inject RBAC object into context for dbauthz fast path, avoid having to
|
||||
// call GetWorkspaceByAgentID on every metadata update.
|
||||
rbacCtx := ctx
|
||||
var ws database.WorkspaceIdentity
|
||||
if dbws, ok := a.Workspace.AsWorkspaceIdentity(); ok {
|
||||
ws = dbws
|
||||
rbacCtx, err = dbauthz.WithWorkspaceRBAC(ctx, dbws.RBACObject())
|
||||
if err != nil {
|
||||
// Don't error level log here, will exit the function. We want to fall back to GetWorkspaceByAgentID.
|
||||
//nolint:gocritic
|
||||
a.Log.Debug(ctx, "Cached workspace was present but RBAC object was invalid", slog.F("err", err))
|
||||
}
|
||||
}
|
||||
|
||||
// Fetch contextual data for this connection log event.
|
||||
workspaceAgent, err := a.AgentFn(rbacCtx)
|
||||
if err != nil {
|
||||
return nil, xerrors.Errorf("get agent: %w", err)
|
||||
}
|
||||
if ws.Equal(database.WorkspaceIdentity{}) {
|
||||
workspace, err := a.Database.GetWorkspaceByAgentID(ctx, a.AgentID)
|
||||
workspace, err := a.Database.GetWorkspaceByAgentID(ctx, workspaceAgent.ID)
|
||||
if err != nil {
|
||||
return nil, xerrors.Errorf("get workspace by agent id: %w", err)
|
||||
}
|
||||
@@ -82,7 +97,7 @@ func (a *ConnLogAPI) ReportConnection(ctx context.Context, req *agentproto.Repor
|
||||
WorkspaceOwnerID: ws.OwnerID,
|
||||
WorkspaceID: ws.ID,
|
||||
WorkspaceName: ws.Name,
|
||||
AgentName: a.AgentName,
|
||||
AgentName: workspaceAgent.Name,
|
||||
Type: connectionType,
|
||||
Code: code,
|
||||
Ip: logIP,
|
||||
|
||||
@@ -114,9 +114,10 @@ func TestConnectionLog(t *testing.T) {
|
||||
api := &agentapi.ConnLogAPI{
|
||||
ConnectionLogger: asAtomicPointer[connectionlog.ConnectionLogger](connLogger),
|
||||
Database: mDB,
|
||||
AgentID: agent.ID,
|
||||
AgentName: agent.Name,
|
||||
Workspace: &agentapi.CachedWorkspaceFields{},
|
||||
AgentFn: func(context.Context) (database.WorkspaceAgent, error) {
|
||||
return agent, nil
|
||||
},
|
||||
Workspace: &agentapi.CachedWorkspaceFields{},
|
||||
}
|
||||
api.ReportConnection(context.Background(), &agentproto.ReportConnectionRequest{
|
||||
Connection: &agentproto.Connection{
|
||||
|
||||
@@ -30,7 +30,7 @@ type LifecycleAPI struct {
|
||||
WorkspaceID uuid.UUID
|
||||
Database database.Store
|
||||
Log slog.Logger
|
||||
PublishWorkspaceUpdateFn func(context.Context, uuid.UUID, wspubsub.WorkspaceEventKind) error
|
||||
PublishWorkspaceUpdateFn func(context.Context, *database.WorkspaceAgent, wspubsub.WorkspaceEventKind) error
|
||||
|
||||
TimeNowFn func() time.Time // defaults to dbtime.Now()
|
||||
Metrics *LifecycleMetrics
|
||||
@@ -122,7 +122,7 @@ func (a *LifecycleAPI) UpdateLifecycle(ctx context.Context, req *agentproto.Upda
|
||||
}
|
||||
|
||||
if a.PublishWorkspaceUpdateFn != nil {
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, workspaceAgent.ID, wspubsub.WorkspaceEventKindAgentLifecycleUpdate)
|
||||
err = a.PublishWorkspaceUpdateFn(ctx, &workspaceAgent, wspubsub.WorkspaceEventKindAgentLifecycleUpdate)
|
||||
if err != nil {
|
||||
return nil, xerrors.Errorf("publish workspace update: %w", err)
|
||||
}
|
||||
@@ -134,12 +134,9 @@ func (a *LifecycleAPI) UpdateLifecycle(ctx context.Context, req *agentproto.Upda
|
||||
case database.WorkspaceAgentLifecycleStateReady,
|
||||
database.WorkspaceAgentLifecycleStateStartTimeout,
|
||||
database.WorkspaceAgentLifecycleStateStartError:
|
||||
// Only emit metrics for the parent agent, this metric is not intended to measure devcontainer durations.
|
||||
if !workspaceAgent.ParentID.Valid {
|
||||
a.emitMetricsOnce.Do(func() {
|
||||
a.emitBuildDurationMetric(ctx, workspaceAgent.ResourceID)
|
||||
})
|
||||
}
|
||||
a.emitMetricsOnce.Do(func() {
|
||||
a.emitBuildDurationMetric(ctx, workspaceAgent.ResourceID)
|
||||
})
|
||||
}
|
||||
|
||||
return req.Lifecycle, nil
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user